The reaction of hydrogen sulfide(g) with oxygen(g) to form water(g) and sulfur dioxide(g) proceeds as follows: 2H2S(g) + 302(g) →2H20(g) + 2SO2(g) When 11.3 g H,S(g) reacts with sufficient O2(g), 172 kJ is evolved. Calculate the value of A,H for the chemical equation given. kJ/mol Submit Show Approach Show Tutor Steps

The reaction of hydrogen sulfide(g) with oxygen(g) to form water(g) and sulfur dioxide(g) proceeds as follows: 2H2S(g) + 302(g) →2H20(g) + 2SO2(g) When 11.3 g H,S(g) reacts with sufficient O2(g), 172 kJ is evolved. Calculate the value of A,H for the chemical equation given. kJ/mol Submit Show Approach Show Tutor Steps

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Industrial production of nitric acid, which is used in many products including fertilizers and explosives, approaches 10 billion kg per year worldwide. The first step in its production is the exothermic oxidation of ammonia, represented by the following equation. 4 NH3(g) + 5 O2(g) → 4 NO(g) + 6 H2O(g) ΔH⁰rxn = −902.0 kJ If this reaction is carried out using 7.000 ✕ 103 g NH3 as the limiting reactant, what is the change in enthalpy?
Use the standard reaction enthalpies given below to determine Hᵒrxn for the following reaction: Given: 2 NO(g) + O2(g) → 2 NO2(g) N2(g) + O2(g) → 2 NO(g) 1/2N2(g) + O2(g) → NO2(g) -150. KJ -117 kJ -333 kJ +115 kJ +238 kJ AH°, rxn AHᵒr = ? rxn +183 kJ AH°rxn = +33 kJ
The reaction of methane(g) with water(g) to form hydrogen(g) and carbon monoxide(g) proceeds as follows: CH4(g) + H2O(g) -----> 3 H2(g) + CO(g) When 5.41 grams of CH4(g) react with sufficient H2O(g) , 69.5 kJ of energy are absorbed .What is the value of H for the chemical equation given?
The following thermochemical equation is for the reaction of carbon dioxide(g) with hydrogen(g) to form acetylene(g) (C2H2) and water(g). 2CO2(g) + 5H2(g)→C,H2(g) + 4H2O(g) AH= 46.5 kJ When 9.15 grams of carbon dioxide(g) react with excess hydrogen(g), kJ of energy are
The oxidation of glucose, C6H12O6(s), is described by the following thermochemical equation:C6H12O6(s) + 6 O2(g) → 6 CO2(g) + 6 H2O(l) ΔH = -2772 kJHow much heat, in kilojoules, can be produced by the oxidation of 3.56 g of fuel C6H12O6?Molar mass of C6H12O6 = 180.156 g/mol
What is the change in enthalpy for the reaction: 2B (s) + 3H2(g) → B2H6 (g) given these thermochemical equations? B2H6 (g) + 302 (g) →B2O3 (s) + 3 H₂O (g) AH = -2032 kJ 2B (s) + 3/2 O2 (g) → B2O3 (s) AH = -1272 kJ H2(g) + 1/2 O2 (g) → H2O (g) AH -241.8 kJ -4029 kJ +518.2 kJ +34.6 kJ -3546 kJ
The average molecular speed in a sample of Kr gas at a certain temperature is 298 m/s. The average molecular speed in a sample of O3 gas is m/s at the same temperature.
The following thermochemical equation is for the reaction of sodium(s) with water(1) to form sodium hydroxide(aq) and hydrogen(g). 2Na(s) + 2H2O(1)- →2NaOH(aq) +H2(g) AH= -369 kJ When 5.86 grams of sodium(s) react with excess water(1), kJ of energy are
A bomb calorimeter can be used to measure the enthalpy of reaction for combustions, such as the combustion of diborane represented by the following balanced equation: B2H6(g)+3O2(g)=B2O3(s)+3H2O(g)ΔHcombustion for this process is –1958 kJ/mol. Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is 7.854 kJ/°C at 22.61°C. What is the final temperature of the calorimeter?
The following thermochemical equation is for the reaction of Fe3O4(s) with hydrogen (g) to form iron(s) and water(g). Fe3O4(s) + 4H₂(g) 3Fe(s) + 4H₂O(g) ΔΗ = 151 kJ When 81.5 grams of Fe3O4(s) react with excess hydrogen (g), kJ of energy are 0. Hint: An amount of energy is expressed as a positive number. The sign of AH in the thermochemical equation indicates whether the energy is absorbed or evolved.
Carbon disulfide reacts with chlorine according to the following reaction equation: CS2(g) + 3 Cl2(g) S2 Cl2(g) + CCI4(g) kJ A,H° = -230 mol If 15.0 g of Cl2 (70.906 g/mol) reacts with excess CS2, how much heat is transferred (include any sign needed) for this reaction? Give your answer in kJ but do not put units in the answer box. Report it to two decimal places.