### Enthalpy Changes IThe reaction of hydrogen (\( \text{H}_2 \)(g)) with oxygen (\( \text{O}_2 \)(g)) to form water (\( \text{H}_2\text{O} \)(g)) proceeds as follows:\[ 2\text{H}_2(g) + \text{O}_2(g) \rightarrow 2\text{H}_2\text{O}(g) \]When 0.637 g of \( \text{H}_2 \)(g) reacts with sufficient \( \text{O}_2 \)(g), 76.5 kJ is evolved.Calculate the value of \( \Delta H \) for the chemical equation given.\[ \boxed{} \, \text{kJ/mol} \]**Instructions:**1. Fill in the text box with your calculated value of \( \Delta H \).2. Click on "Submit" to check your answer.3. If needed, you can view the approach or detailed steps by selecting "Show Approach" or "Show Tutor Steps".**Note:**You have 4 item attempts remaining.**Options:**- Submit Answer- Try Another Version---

Answered: Image /qna-images/answer/43c3b5ff-54ba-4276-8d74-11513efd130b.jpg

The reaction of hydrogen(g) with oxygen(g) to form water(g) proceeds as follows: 2H2(g) + O2(g)-2H20(g) When 0.637 g H2(g) reacts with sufficient O2(g), 76.5 kJ is evolved. Calculate the value of A,H for the chemical equation given. kJ/mol

The reaction of hydrogen(g) with oxygen(g) to form water(g) proceeds as follows: 2H2(g) + O2(g)-2H20(g) When 0.637 g H2(g) reacts with sufficient O2(g), 76.5 kJ is evolved. Calculate the value of A,H for the chemical equation given. kJ/mol

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: The reaction of hydrogen chloride (g) with oxygen (g) to form water(g) and chlorine(g) proceeds as…

A: The given chemical reaction is- 4HCl(g)+O2(g)→2H2O(g)+2Cl2(g) The heat evolved is 10.4 kJ The mass…

Q: Organic Functional Groups Predicting the reactants or products of ester hydrolysis Predict the…

A: Step 1: This is acidic hydrolysis of given ester. It gives acetic acid and alpha hydroxy ketone as…

Q: When 0.746 g of benzoic acid, C7H6O2 (122.12 g/mol) is burned in a bomb calorimeter, the temperature…

A: Given: massC7H6O2=0.746g;MC7H6O2=122.12g/mol;Ti=21.04°C;Tf=23.90°CΔE=−3226kJ/molStep 1:…

Q: The reaction of hydrogen chloride (g) with oxygen (g) to form water (g) and chlorine(g) proceeds as…

Q: Consider the following chemical reaction: C5H12(l) + O2(g) ------------> CO2(g) + H2O(g) Calculate…

Q: Methane combusts via the following balanced reaction: CH4(g) + 2O2(g) --> CO2(g) + 2 H2O(g)…

A: Given that the gas is in 50.0 L container at 298 K and 1 atm. At STP 1 mole of gas occupies 22.4 L…

Q: Using the provided table, determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO₂ (g)→…

A: Determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO₂ (g)→ 2 CO (g)

Q: 2. The hydrogenation of coal is a method of producing methane by the following reaction: Ca + 2H2@)…

Q: The reaction of hydrogen sulfide(g) with oxygen(g) to form water(g) and sulfur dioxide(g) proceeds…

A: Answer: In this question enthalpy of the given balanced reaction in which combustion of 2 mole H2S…

Q: Enter your answer in the provided box. Consider the reaction H2g) + Ch@) → 2HCI(2) AH =-184.6 kJ/…

Q: Based from the chemical reaction below, calculate the heat of combustion of one mole of propane to…

Q: dont provide handwriting solution ....

A: Approach to solving the question:The standard enthalpies of formation are given:{eq}\Delta…

Q: When glucose is metabolized in the body, the reaction it undergoes is represented by the following…

Q: Consider the balanced reaction 3 A + 7 B -→ 8 C + 6 D and the enthalpies of formation provided in…

Q: Consider the following chemical reaction: C5H12(l) + O2(g) ------------> CO2(g) + H2O(g) Calculate…

Q: How much heat is produced by the complete reaction of 3.43 kg of nitromethane? Express your answer…

Q: The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate…

A: Here we are required to find the Enthalpy change for the reaction.

Q: 5. Calculate A H for H2(g) + Cl, (g) → 2HCI (g) based on the reactions: AH = -176 kJ AH = -99.22 kJ…

A: Given, a) NH3 (g) + HCl (g) → NH4Cl (s) ∆H = -176 kJ b) N2 (g) + 3H2 (g) → 2NH3 (g) ∆H = -99.22 kJ…

Q: Consider the combustion of liquid CsHs in oxygen gas to produce carbon dioxide gas and water vapor.…

A: Balanced chemical equation :C5H8l + 7O2g → 5CO2g + 4H2Og∆H = -3068 kJmolCompound ∆H°f…

Q: 3.) Consider the reaction for the combustion of liquid propanol: C3H₂OH() + O2(g) → 3 CO₂(g) +…

Q: Using the provided table, determine the enthalpy (in kJ/mol) for the reaction C:H³ (g) + 5 O2 (g) →…

A: The standard enthalpy of a reaction (ΔrHo) is the enthalpy change accompanying a given reaction when…

Q: An electron in an abm is hnow n to be in a stale m, -0. What 1s the with magnetic quantum number m,…

A: Dear student, There are more than one question are asked with are independent of each other. Since…

Q: What is the standard enthalpy (in KJ) of formation for this reaction: Hint: balance the reaction…

A: Standard enthalpy of reaction is calculated as follows:

Q: The reaction of nitrogen monoxide(g) with oxygen(g) to form nitrogen dioxide(g) proceeds as follows:…

Q: How much energy in kJ is released in burning 2.41 mL of gasoline (assuming that all of it is octane…

Q: Consider the reaction: 2 CO (g) + O₂ (g) → CO₂ (g) What is AH for: CO₂ (g) 2 CO (g) + O₂ (g) ΔΗ = ?…

A: In given question, Change in Enthalpy is asked for reversed reaction. Enthalpy is a state function…

Q: Use the References to access important values if needed for this question. The reaction of…

Q: None

A: To calculate the quantity of heat released during the combustion of 17.43 L of methane (CH₄) at…

Q: When 1 mole of H₂CO(g) reacts with O₂(g) to form CO₂(g) and H₂O(1) according to the following…

A: Given, Number of moles of H2CO = 1 mole Amount of heat evolved = 563 KJ Equation is : H2CO (g)…

Q: 3. Methanol undergoes combustion according to the equation: 2CH,OH + 30, 2C0 2(g) + 4H,0 ) AH = -1…

Q: Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is…

A: In order to determine the final temperature of the calorimeter, the concept of the bomb calorimeter…

Q: The enthalpy of reaction is -11.7 kJ/mol for the following reaction: HCN(aq) + NaOH(aq) -->…

Q: Methanol undergoes combustion according to the equation 2 CH3OH (1) + 3 O2 (4) → 2 CO2 (e) + 4 H20µ)…

Q: Calculate the amount of heat released (absolute value) when 2.20 kg of propane gas (C3H8) is burned…

A: Enthalpy of reaction is the enthalpy change when one mol of substance undergoes reaction. It can be…

Q: A 0.602-g sample of isophthalic acid (C₂H4O₂) is burned in a bomb calorimeter and the temperature…

Q: 4. det erMIne ene producu show Stepwise mechanism ant

A: In this question we have to tell the product of the reaction and mechanism.

Q: You mix 125 mL of 0.270 M CsOH with 50.0 mL of 0.675 M HF in a coffee-cup calorimeter, and the…

A: Given: 125 ml of 0.270 M CsOH 50 ml of 0.675 M HF Temperature T1 = 22.30 +273 = 295.3 K T2 = 25.42 +…

Q: 5. Calculate and draw the enthalpy diagram for the following reaction: Mg(s) + H 20(g) –→ Mg0(s) +…

A: Enthalpy diagram : An enthalpy diagram plots potential energy on the Y-axis and reaction progress on…

Q: The enthalpy of reaction is -11.7 kJ/mol for the following reaction: HCN(aq) + NaOH(aq) -->…

A: Given : Mass of HCN = 0.899 g Enthalpy of reaction = -11.7 KJ/mol Total Mass in the calorimeter =…

Q: Canada is the world's eighth largest producer of iron ore. The smelting of iron ore involves many…

Q: Calculate the quantity of energy transferred (q), in kJ, by the combustion of 177 mL of acetone…

Q: The reaction of carbon dioxide (g) with hydrogen (g) to form carbon monoxide (g) and water(g)…

A: Recall the given reaction, CO2 g + H2 g → CO g + H2O g12.7 g of CO2 g…

Q: Using the given chemical equation, determine the enthalpy of reaction (in kJ) when 0.500 moles of…

Question

### Enthalpy Changes I

The reaction of hydrogen (\( \text{H}_2 \)(g)) with oxygen (\( \text{O}_2 \)(g)) to form water (\( \text{H}_2\text{O} \)(g)) proceeds as follows:

\[ 2\text{H}_2(g) + \text{O}_2(g) \rightarrow 2\text{H}_2\text{O}(g) \]

When 0.637 g of \( \text{H}_2 \)(g) reacts with sufficient \( \text{O}_2 \)(g), 76.5 kJ is evolved.

Calculate the value of \( \Delta H \) for the chemical equation given.

\[ \boxed{} \, \text{kJ/mol} \]

**Instructions:**
1. Fill in the text box with your calculated value of \( \Delta H \).
2. Click on "Submit" to check your answer.
3. If needed, you can view the approach or detailed steps by selecting "Show Approach" or "Show Tutor Steps".

**Note:**
You have 4 item attempts remaining.

**Options:**
- Submit Answer
- Try Another Version

---

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

[References] The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate as fuel. A possible reaction is 3A1(s) +3NH,CIo,(s) → Al,0,(s) + AlCls (s) + 3NO(g) + 6H2O(g) Calculate AH for this reaction. Substance and State AH; (kJ/mol) Al(s) Al2O3 (s) AICI3 (s) H20(g) NO(g) NH CIO.(s) -1676 -704 -242 90. -295 AH: kJ Submit Answer Try Another Version 1 item attempt remaining Prev
The enthalpy of reaction is -11.7 kJ/mol for the following reaction: HCN(aq) + NaOH(aq) --> H2O(l) + NaCN(aq) If 0.541g of HCN react with excess NaOH in a coffee cup calorimeter, what amount will the temperature change by? Use 63.5 g as the total mass in the calorimeter and use 4.184 J/gC as the specific heat. Give your answer to 2 decimal places.
Use the standard reaction enthalpies given below to determine Hᵒrxn for the following reaction: Given: 2 NO(g) + O2(g) → 2 NO2(g) N2(g) + O2(g) → 2 NO(g) 1/2N2(g) + O2(g) → NO2(g) -150. KJ -117 kJ -333 kJ +115 kJ +238 kJ AH°, rxn AHᵒr = ? rxn +183 kJ AH°rxn = +33 kJ
A scientist measures the standard enthalpy change for the following reaction to be -572.6 kJ:H2CO(g) + O2(g)CO2(g) + H2O(l)Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of H2O(l) is?
The reaction of methane(g) with water(g) to form hydrogen(g) and carbon monoxide(g) proceeds as follows: CH4(g) + H2O(g) -----> 3 H2(g) + CO(g) When 5.41 grams of CH4(g) react with sufficient H2O(g) , 69.5 kJ of energy are absorbed .What is the value of H for the chemical equation given?
Hydrogen cyanide is used in the manufacture of clear plastic such as plexiglas. it is prepared from ammonia and methane according to the following reaction. calculate the value of q(KJ) if 9.436 g of ammonia react with excess oxygen and methane.
a) How would you find the molar enthalpy (in kJ/g) for each fuel and would they compare with each other? b) what are two other factors that can be used to evaluate the fuels
The reaction of ammonia(g) with oxygen(g) to form nitrogen monoxide(g) and water(g) proceeds as follows: 4NH3(g) + 50,(g)–→4NO(g) + 6H2O(g) When 5.96 g NH3(g) reacts with sufficient O2(g), 79.2 kJ is evolved. Calculate the value of A,H for the chemical equation given. kJ/mol
A bomb calorimeter can be used to measure the enthalpy of reaction for combustions, such as the combustion of diborane represented by the following balanced equation: B2H6(g)+3O2(g)=B2O3(s)+3H2O(g)ΔHcombustion for this process is –1958 kJ/mol. Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is 7.854 kJ/°C at 22.61°C. What is the final temperature of the calorimeter?
( is the answer is + 46.48 or -46.48 plzz telll ...why + or why - also explain
According to the reaction below what is the value of KKJ for the complete combustion of 1.00 g of CH4g?
The combustion of neopentane is described by the reaction: C5H12(s) + O2(g) → CO2(g) + H2O (unbalanced) AH = -3456 kJ/mol neopentane %3D If 100.0 milligrams of neopentane is burned in a bomb calorimeter to heat 100.0 mL of water at 25°C, what would be the final temperature of water in °C? The specific heat of water is 4.184 J/g°C, The MW of neopentane is 72.15 g/mol. Answer in four significant figures. Indicate the unit.