Show work with explanation needed...don't give Ai generated solution. Don't copy answer anywhere Give IUPAC and the common ame for the following amine. Careful with spelling.(CH3CH2CH2)2NCH2CH3

Here's the steps for naming a tertiary amine using IUPAC nomenclature:See the alkyl groups attached…

Answered: Give IUPAC and the common ame for the…

Science

Chemistry

Give IUPAC and the common ame for the following amine. Careful with spelling. (CH3CH2CH2)2NCH2CH3

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter16: Amines And Amides

Section: Chapter Questions

Problem 16.10E: Give each of the following amines an IUPAC name. a. b. c.

See similar textbooks

Related questions

Q: Part D CH3CHCH2CH3 ОН Draw all missing reactants and/or products in the appropriate boxes by placing…

A: Step 1: Step 2: Step 3: Step 4:

Q: Please correct answer and don't used hand raiting

A: 2-methyl-1-butene:In this molecule, the vinylic hydrogens are attached to the carbons of the double…

Q: a) the sample of a polymer must be polydisperse.b) the sample of a polymer must be naturally…

A: In polymer science, the terms polydisperse and monodisperse are used to describe the distribution of…

Q: It takes 957 J to raise the temperature of 35.7 g of sample by 5.7°C.The specific heat capacity of…

Q: Give detailed mechanism Solution with explanation needed. don't give Ai generated solution

A: Step 1: ReactionGiven reaction is a nucleophilic substitution reaction.It occurs via SN2 mechanism.…

Q: Question 3 For the following reaction, which structure represents the major product? Br2 of Br A B C…

Q: Step 1. Write Equations for the Pertinent Equilibria Three equilibria need to be considered:…

A: To calculate the molar solubility of Ag2CO3 in a solution buffered to a pH of 5.00, we'll follow the…

Q: I have to spell out the names of these

A: Step 1: Rules for IUPAC NamingFind the highest priority functional group.Determine and name the…

Q: Please correct answer and don't use hand rating

Q: A gas chromatographic peak had a retention time of 633 sec. The base width obtained from…

A: Step 1:Step 2:

Q: Propose a mechanism that accounts for the following reaction.

Q: The average separation between successive lines in the far-infrared absorption spectrum of hydrogen…

A: In the rotational Raman spectrum, the energy difference between the initial and final states…

Q: Dr. Schaefer performs a reaction of an unknown alkene with ozone. She obtains a single compound with…

A: Alkene+ozone is ozonolysis where the alkene's C=C bonds break and form two C=O bonds. Since there…

Q: Predict the products of the reaction below. That is, complete the right-hand side of the chemical…

Q: CH3 + H-O H H CH₁₂ ло- OH

A: This is a type of chemical reaction known as a proton transfer reaction or acid-base reaction. In…

Q: 19.56 Write out the steps needed to separate hydrocarbon A and carboxylic acid B by using an…

Q: Please correct answer and don't used hand raiting

A: The Gibbs free energy change (ΔG) is related to enthalpy change (ΔH) and entropy change (ΔS) by the…

Q: 5. Relative Rates and Stereochemistry ( (a) For the following sets of substitution reactions, draw…

A: Step 1: Step 2: Step 3: Step 4:

Q: Choose the reagent(s) that would be most likely to complete this reaction. Problem 41 of 48 A HBr (1…

Q: for given chemical equation 2Fe(s) + 3 Cl2(g) => 2FeCl3(s) How many moles of chlorine gas…

A: In the given chemical equation, 2Fe(s) + 3 Cl2(g) => 2FeCl3(s), the coefficients in front of the…

Q: Please whats the tue option

Q: 3. Write molecular, ionic, and net ionic equations for each of the following a. NaNO3(aq) + Bal2(aq)…

A: Steps to follow to write molecular equation, complete ionic equation and net ionic equationStep…

Q: Please correct answer and don't used hand raiting

Q: Suppose the molecule below is in basic aqueous solution. Is keto-enol tautomerization possible? • If…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: Please correct answer and don't used hand raiting

A: In figure we can see that the height if mercury column is larger in open end and smaller in gas end…

Q: A student proposes the following mechanism for a nucleophilic substitution reaction: ? t H₂O H OTH…

A: Step 1:The reactant is tertiary alkyl chloride, and the reagent is water. The given reaction is an…

Q: Decide whether each of the molecules in the table below is stable, in the exact form in which it is…

A: Step 1: Step 2: Step 3: Step 4:

Q: Give the products that would be formed when each of the following alcohols is subjected to…

A: Step 1:Alcohol dehydration is the process that turns the alcohol functional group into an alkene.…

Q: Please correct answer and don't used hand raiting

Q: Please correct answer and don't use hand raiting

A: Step 1:In quantum mechanics, each electron in an atom is described by a set of four quantum numbers:…

Q: Draw the products of the following reactions. Ignore inorganic byproducts. Select to Draw H2 Pd/C

A: H2, Pd/C reduces alkyne as well as alkene to the alkane. Explanation: H2/Lindlar's catalyst reduces…

Q: a. Identify and fill in the missing reagent in the box. CH3 CH3CH2O Na CH3 b. Provide arrow pushing…

A: Step 2: Step 3: Step 4:

Q: Please correct answer and don't use hand rating

A: SN2 reaction:The given starting material is primary alkyl halide, and the methoxide anion from…

Q: QUESTION 3 Many fruits will "brown" after being cut. This is due to the fact that an enzyme,…

A: This is because the enzyme polyphenol oxidase that causes browning is inhibited by acid. When the…

Q: Problem # 3 (10 pts) Provide a detailed stepwise mechanism for the following conversion. Use arrows…

Q: Please help, thanks

Q: Help me understand these

A: Step 1: Step 2: Step 3: Step 4:

Q: Please correct answer and don't use hand raiting

A: Step 1:The naming of organic molecules:The naming of the compound is written out with the…

Q: Determine the chemical structure given the 13C NMR and 1H NMR spectra.

A: Step 1: Step 2: Step 3: Step 4:

Q: 9.17 Select the member of each pair that shows the greater rate of SN2 reaction with KI in acetone.…

A: Bimolecular nucleophilic substitution (SN2) is a one-step process in which a nucleophile (I-)…

Q: Which product (or products) would you expect to obtain from each of the following reactions? In each…

A: The products(s) and mechanism of the reaction depend on the reaction conditions. A) At 50oC in…

Q: V Arter running various experiments, you determine that the rate law for the following reaction has…

A: If you have any confusion related to any step, you can ask!

Q: Show work with structures....

Q: 3. In patients with early stage lung cancer, stereotactic body radiation therapy (SBRT) has greatly…

A: I have provided you the template and example and all the context where you can extract and improvise…

Q: Draw the product of syn addition of Br₂ across the double bond of the alkene in the drawing area…

Q: Show work with explanation needed..don't give Ai generated solution

A: Step 1.In Flying-wedge projection.When lowest priorty group is in below the plane 1-2-3 ; Clockwise…

Q: Show work with explanation needed. Don't give Ai generated solution

A: Step 2: Step 3: Step 4:

Q: Please help

Q: 8. Calculate K for the following reaction run at 25°C: C(s) + CO2(g) → 2 CO(g) Substance So…

A: Step 1: To answer this question, first we have to calculate ΔGo from ΔSo and ΔHo by using the…

Q: please draw major product and mechanism for this reaction?

A: Step 1:The given reactant is a tertiary alkyl bromide and the reagent is a strong base, sodium…

Question

Show work with explanation needed...don't give Ai generated solution. Don't copy answer anywhere

Give IUPAC and the common ame for the following amine. Careful with spelling.
(CH3CH2CH2)2NCH2CH3

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Question -S1
For each of the following, draw a structural formula that meets the stated requirements, then name each structureyour drew (unless otherwise indicated) according to either IUPAC or common nomenclature.
I need help with this please will consider subscribing for I have tons of classes.
Give the common names for each of the following ethers ot amines (a) CH3---O--CH2CH2CH2CH3 (b) CH3CH2----O---CH2CH3 (c) CH3CH2--N---CH3 I CH3 (d) CH3CH2----N---CH3 | H
Give the following amine an IUPAC name: CH;-N-CH3 CH3-CH-CH3 Name:
Give the following amine an IUPAC name: NH₂
Provide the IUPAC name of (CH3)3CCH₂CH₂NHCH₂CH3. N-methyl-3-ethyl-1-butanamine N-ethyl-3,3-dimethyl-1-butanamine N,N-dimethyl-1-pentanamine octanamine
Look at the structure of acetanilide (refer to the handout if the image doesn't show properly). Which functional groups are present in the compound (check all answers)? H. N' CH3 alkene aromatic alcohol ether alkyne amide ketone aldehyde amine alkane ester carboxylic acid
A) Name the following amine. H3C−CH2−CH2−NH−CH2−CH2−CH3 Spell out the full name of the compound. B ) Name the following amine. CH3−CH2−NH−CH2−CH2−CH3 Spell out the full name of the compound.
OH Amide H-C-0 H 100 (C) (a)
please answer the 2 questions please
Answer with solutions please. II: Assign common name to each of the following amines: