Benzoic acid, C;HsO:H, is typically used as a çalibrant for determining the specific heat of bomb calorimeters. It combusts via the following unbalanced chemical reaction: C,H5O2H (s) + 02(g) → CO2 (g) + H2O (1) 3. For this experimental setup and reaction, the constant volume heat flow is known to be gy = -26.979 kJ. Over the course of the reaction, the temperature rose from 19.863 °C to 22.540 °C. Calculate the heat capacity, Ceu, for this calorimeter in kJ °C-.

Benzoic acid, C;HsO:H, is typically used as a çalibrant for determining the specific heat of bomb calorimeters. It combusts via the following unbalanced chemical reaction: C,H5O2H (s) + 02(g) → CO2 (g) + H2O (1) 3. For this experimental setup and reaction, the constant volume heat flow is known to be gy = -26.979 kJ. Over the course of the reaction, the temperature rose from 19.863 °C to 22.540 °C. Calculate the heat capacity, Ceu, for this calorimeter in kJ °C-.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Indicate the true option about calorimetry.(A). Internal energy is an intensive quantity.(B). The enthalpy does not depend on p, since this variable is the amount of heat put into play during an isobaric transformation.(C). The superscript ° added to the thermodynamic functions indicates that it is operated at p = 1 atm and T = 298.15 K.(D). The heat exchanged between a system and the medium is not a state function.
a) What is the standard enthalpy of reaction per mole of either HCl or NaOH when 50.00 cm3 of 0.1 moldm-3 of hydrochloric acid (HCl) and 50.00 cm3 of 0.1 moldm-3 of sodium hydroxide (NaOH) are mixed? According to your simulation, the temperature rose by 0.68 oC. (Density of water = 1gcm-3, Specific heat capacity of water = 4.18 J g-1 oC-1) Show your working below:
o-phthalic acid, C8H6O4, is sometimes used as a calorimetric standard. Its heat ofcombustion is - 3.224 × 103 kJ/mol C8H6O4. From the following data determine theheat capacity of a bomb calorimeter assembly (i.e., of the bomb, water, stirrer,thermometer, wires, etc.)mass of o-phthalic acid burned: 1.078 ginitial calorimeter temperature 24.96 °Cfinal calorimeter temperature 30.76 °C
For a particular isomer of C3H,8, the combustion reaction produces 5099.5 kJ of heat per mole of C3H13(g) consumed, under standard conditions. 25 C,H1g(g) + 0,(8) – 8 CO,(g) + 9 H,O(g) 8 CO,(g) + 9 H,0(g) AHixn = -5099.5 kJ/mol rxi What is the standard enthalpy of formation of this isomer of C3H13(g)? ΔΗ -215 kJ/mol Incorrect
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
Which equation from the formula bank is used to determine the experimental heat (q) in kJ involved when in a combustion reaction of 0.45 g of ethylene (MM = 28.00 g/mol) in an uninsulated device submerged in 100.0 mL of water (density 1.00 g/mL, s = 4.184 J/goC) where the temperature change (DT) is recorded as 12.5oC?
A 124 gram ice cube at -33°C is placed into a 2.50 kg iron container (assume no energy is transfered as heat to or from the surroundings). The temperature of the iron container drops by 55°C. Calculate the final temperature in °C of the water in the container. The density of water is 1.00g/mL and the heat capacity of ice to be 37.7 J mol-1K-1 and the heat capacity of water is 75.3 J mol-1K-1. The molar enthalpy of fusion of water is 6.01 kJ/mol and the heat capacity of iron is 0.45 J/(gK).
-1 -1 A 30.0 g sample of polyisoprene, which has a specific heat capacity of 1.880 J.g¹ºC, is dropped into an insulated container containing 250.0 g of water at 30.0 °C and a constant pressure of 1 atm. The initial temperature of the polyisoprene is 87.8 °C. Assuming no heat is absorbed from or by the container, or the surroundings, calculate the equilibrium temperature of the water. Be sure your answer has 3 significant digits. [°C G
The relationship between heat transfer and change in temperature is given by Q = mcAt, where c is specific heat capacity. Under what conditions will C = Q? 1 kg ΔΤ AT = 1°C = Om 10 g ΔΤ AT = 10 °C Om 100 g AT = 10 °C Om 1 g ΔΤ AT = 10 °C Om = 1g AT = 1°C
Calculate the enthalpy of the reaction4B(s) + 302(g)2B2 03(s) given the following pertinent information:B2O3(s ) + 3H20(g)302(g) + B2H6(g), HA = +2035 kJ2B(s) + 3 H2(g)B2H6(g), HB = +36 kJH2(g) + 1202(g)H20(1), HC 285 kJH20(1)H2O(g), HD = +44 kJExpress your answer with the appropriate units.
A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction АТР(аq) + H,О() — ADP(aq) + НРО (аq) ADP(aq) + HPO (aq) for which AGixn = -30.5 kJ/mol at 37.0 °C and pH 7.0. Calculate the value of AGrxn in a biological cell in which [ATP] = 5.0 mM, [ADP] = 0.40 mM, and [HPO;-] = 5.0 mM. AGrxn kJ/mol * TOOLS x10 Is the hydrolysis of ATP spontaneous under these conditions? yes no