Calculate the enthalpy of the reaction4B(s) + 302(g)2B2 03(s) given the following pertinent information:B2O3(s ) + 3H20(g)302(g) + B2H6(g), HA = +2035 kJ2B(s) + 3 H2(g)B2H6(g), HB = +36 kJH2(g) + 1202(g)H20(1), HC 285 kJH20(1)H2O(g), HD = +44 kJExpress your answer with the appropriate units.

Calculate the enthalpy of the reaction4B(s) + 302(g)2B2 03(s) given the following pertinent information:B2O3(s ) + 3H20(g)302(g) + B2H6(g), HA = +2035 kJ2B(s) + 3 H2(g)B2H6(g), HB = +36 kJH2(g) + 1202(g)H20(1), HC 285 kJH20(1)H2O(g), HD = +44 kJExpress your answer with the appropriate units.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Hydrogen sulfide, H2S, is a foul-smelling gas. It burns to form sulfur dioxide. Calculate the enthalpy change to burn 27.4 g of hydrogen sulfide. 2H2S(g) + 3O2(g) à 2SO2(g) + 2H2O(g); ΔH = -1036 kJ
For reaction (b) HCl(g) + NaOH(s) NaCl(s) + H20(I), what is the equation for the change in enthalpy of this reaction? O [AHf° (NaCI(s)) + AHf°(H20(1)] - [AHP(HCI(g)) + AHP(N2OH(s))] O [AHP (HCI(g)) + AHP(N2OH(s))] - [AHP(NaCI(s)) + AHP(H20(1))] Click if you would like to Show Work for this question: Open Show Work SHOW HINT SHOW SOLUTION Part 4 X Your answer is incorrect. Try again. Use the values from the given table and the equation you chose in Part 3 to find the overall change in enthalpy for the reaction. -55200
Calculate the standard enthalpy for the reaction 1/2N2(g) + 1/2O2(g) -> NO (g) given the following information: As part of your answer, show how the equations can be added together to give the overall or net equation. N2(g) + 3H2(g) -> 2NH3 (g) enthalpy = -91.8 kJ 4NH3(g) + 5O2(g) -> 4NO(g) + 6H2O(g) enthalpy= -906.2kJ H2(g) + 1/2O2 g) -> H2O(g) enthalpy+ - 241.8kJ
The question is in the image. I would gladly appreciate it, it is typed instead of written down on paper
In a generic chemical reaction involving reactants A and B and products C and D, aA+bB→cC+dD, the standard enthalpy ΔH∘rxn of the reaction is given by ΔH∘rxn=cΔH∘f(C)+dΔH∘f(D) −aΔH∘f(A)−bΔH∘f(B) Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is often generalized as follows, where the first sum on the right-hand side of the equation is a sum over the products and the second sum is over the reactants: ΔH∘rxn=∑productsnΔH∘f−∑reactantsmΔH∘f where m and n represent the appropriate stoichiometric coefficients for each substance. What is ΔH∘rxnΔHrxn∘ for the following chemical reaction? CO(g)+NH3(g)→HCN(g)+H2O(g) You can use the following table of standard heats of formation (ΔH∘f)(ΔHf∘) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218218 N(g) 473473 H2(g) 00 O2(g) 00 NH3(g) −45.90 O(g) 249 CO(g)…
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
The question is in the image.
Which of the following reactions occuring at 25° C defines the standard enthalpy of formation (TriangleHf) of liquid water? - 2 H (g) + O (g) -> H2O (l) - H2O(g) + O (g) -> H2O (l) - H2 (g) + ½O2 (g) -> H2O (l) - 2 H2 (g) + O2 (g) -> 2 H2O (l)
In the laboratory, a student dilutes 17.8 mL of a 9.80 M hydrobromic acid solution to a total volume of 125.0 mL. What is the concentration of the diluted solution? Concentration = 0.78 M
7.Using the following standard enthalpies of reaction4NH3(g) + 7 O2(g) 4 NO2(g) + 6 H2O(l)H ̊rxn= -1395 kJN2(g) + 2 O22 NO2(g)H ̊rxn= +67.4 kJFind the standard enthalpy of reaction for the equation:2N2(g) + 6 H2O(l) 4 NH3(g) + 3 O2(g) Based on your work above, determine the standard enthalpy of reaction for the following equation:N2(g) + 3 H2O(l) 2 NH3(g) + 3/2 O2(g)
to calculate the true enthalpies of these reactions by the Hess’ law, as: ΔH°(rxn) = Σ[ν × ΔHf°(product)] – Σ[ν × ΔHf°(reactant)] for: Mg(s) + ½O2(g) → MgO(s)
1) From the following data, C(graphite) + O2(g) à CO2(g) = -393.5 kJ/mol H2(g) + 1/2O2(g) = H2O(l) delta H = -285.8 kJ/mol 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l) delta H = -3119.6 kJ/mol calculate the enthalpy change for the reaction 2C(graphite) + 3H2(g) =C2H6(g) a) –2417.2 kJ b) –84.6 kJ c) 2417.2 kJ d) –3204.2 kJ