Calculate the enthalpy of the reaction4B(s) + 302(g)2B2 03(s) given the following pertinent information:B2O3(s ) + 3H20(g)302(g) + B2H6(g), HA = +2035 kJ2B(s) + 3 H2(g)B2H6(g), HB = +36 kJH2(g) + 1202(g)H20(1), HC 285 kJH20(1)H2O(g), HD = +44 kJExpress your answer with the appropriate units.

Calculate the enthalpy of the reaction4B(s) + 302(g)2B2 03(s) given the following pertinent information:B2O3(s ) + 3H20(g)302(g) + B2H6(g), HA = +2035 kJ2B(s) + 3 H2(g)B2H6(g), HB = +36 kJH2(g) + 1202(g)H20(1), HC 285 kJH20(1)H2O(g), HD = +44 kJExpress your answer with the appropriate units.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Hydrogen sulfide, H2S, is a foul-smelling gas. It burns to form sulfur dioxide. Calculate the…

A: The problem is asking us to calculate the enthalpy change when 27.4 g of hydrogen sulfide (H2S) is…

Q: Given the following enthalpies of combustion: (a) 2H2(g) + O2(g) --> 2H2O(g);…

A: The reactions given are, a) 2 H2(g) + O2(g) --> 2 H2O(g); ΔH1 =…

Q: Please provide detailed solution and give the explanation of the concept

A: Step 1:From the given data 5230 J heat is produced by 0.5030 grams of sodium metal Then calculate…

Q: CS2(1) + 302(g) CO2(g) + 2SO2(g) Given: C(s) + O2(g) S(s) + O2(g) C(s) + 2S(s) CO2(g) ni AH =…

A: Given, CS2(l) + 3O2(g) ➝ CO2(g) + 2SO2(g) ∆H = ? a) C(s) + O2(g) ➝ CO2(g) ∆H = -393.5 kJ b) S(s) +…

Q: Calculate the change of enthalpy for the reaction 2Al (s) + 3Cl2 (g) --> 2AlCl3 (s) from the…

Q: Calculate the standard enthalpy of formation of nitric acid using the following equations: 4NH3(g) +…

A: According to Ostwald's process the chemical equation for the formation of nitric acid is: NH3(g) + 2…

Q: e enthalpy chang

Q: The following equation represents the combustion of ethylene glycol, (CH2OH)2 (CH2OH)2 (l) + 2.5O2…

Q: For which one of the following is the enthalpy of the reaction the same as the enthalpy of…

A: Enthalpy of fornation :- The enthalpy change involved in the formation of 1 mole of a compound from…

Q: 2. I tahes Il63.hJ/mol to brcah Gn nitrogen - nitroges Sing le bond. Calcu late the maymum wave tor…

A: We are authorized to answer one question at a time, since you have not mentioned which question you…

Q: What is the standard enthalpy change for the reaction: 2C5H10(1) + 1502(g) → 10CO2(g) + 10H20(1);…

A: The reaction is as follows: 2C5H10(l) + 15O2(g)→10CO2(g) +10H2O(l). ∆H0f(C5H10)= - 905 KJ/mol.…

Q: From the following enthalpies of reaction, calculate the AH for the reaction in kJ of N2H4(1) with…

A: We have to calculate the ∆H for Given reaction.

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: The standard enthalpy change of a reaction is calculated using the following equation:…

Q: Calculate the enthalpy of the reaction 4 B (s) + 3 O2 (g) → 2 B203 (s) given the following pertinent…

A: Target equation is 4B(s) + 3O2(g) ------> 2B2O3(s) ; ∆H° = ? Given thermo chemical reactions are…

Q: Given that the molar enthalpy of combustion of propanoic acid is -1527.2 kJ/mol, when the enthalpy…

A: Dear student since you have posted multiple questions,we will solve only first question for you as…

Q: If 20.0 g of CH4 reacts with excess oxygen, what is the change in enthalpy for the reaction?…

A: The reaction considered is the combustion of methane and it is exothermic.

Q: The combustion reaction of octane is represented by the following equations: 2C8 H18 (1) + 25 O2 (g)…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: PCI5(s) can be prepared by the reaction PCI3(1) + Cl2(g) - PCI5(s). Calculate the enthalpy change…

Q: Calculate the standard reaction enthalpy for the following reaction in KJ*mol. CH4(g) + H2O(g) -->…

A: Hess's law states that enthalpy change of reaction is independent of initial and final states. If…

Q: Calculate the enthalpy change for the reaction. P4O6(a) +202(g) → P4010(*) given the following…

Q: The chemical equation that represents the combustion of methane is CH4(9) +20₂(9) - CO₂(g) + 2H₂O(g)…

A: The energy difference between the enthalpy of the products and enthalpy of the reactants is called…

Q: Determine the enthalpy of the reaction: S (s) + 3/2 O2 (g) → SO3 (g), given the following reactions.…

A: Given, Determine the enthalpy of the reaction, S(s) + 3/2 O2(g) ---> SO3(g) ∆Hrxn = ? Enthalpy…

Q: ) Calculate the standard enthalpy of reaction 4 using the given data: A(g)+X2(g)⟶AX2(g)…

A: The Heat of Reaction (also known and Enthalpy of Reaction) is the change in the enthalpy of a…

Q: When 0.278 g of sodium metal is added to an excess of hydrochloric acid, 2890 J of heat are…

A: The balanced reaction given is, => 2 Na (s) + 2 HCl (aq) → 2 NaCl (aq) + H2 (g) Given: Mass of Na…

Q: Calculate the enthalpy of formation of 1 mole SO2(g) from the standard enthalpy changes of the…

A: a) 2SO3 ....> 2SO2 + O2 dH°rxn = 196KJ b) 2S + 3O2 ....> 2SO3 dH°rxn = -790 KJ In reverse…

Q: Hydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an…

A: The problem is asking us to calculate the enthalpy change for the reaction H2(g) + O2(g) to H2O2(l).…

Q: Calculate the standard enthalpy of reaction for the following reaction 3Co (s) + 2O2 (g) Co3O4…

A: The objective of the question is to find the standard enthalpy of the following reaction.Given…

Q: 2NO(g) O2(g) - 2NO2(g), AH=-113.1 kJ 2N20(g) 2N2(g) + O2(g), AH=-163.2 kJ -> use Hess's law to…

A: Use ∆H equation and do experiement to get resulting equation. ∆H rxn= 43.53kj

Q: THERMODYNAMICS: Calculate the value of AH (in kJ) for the reaction, 2AR3 (g) + Q (s) → A2R4 (g) +…

A: The balanced thermo chemical reactions given are 2 AR3 (g) + 2 AX (g) → A2R4 (g) + 2 XR (g), ∆H =…

Q: Use standard heats of formation and the following equation to determine the enthalpy of formation of…

Q: A scientist measures the standard enthalpy change for the following reaction to be -340.6 kJ: 2Na(s)…

A: The given reaction is :The standard enthalpy change for the following reaction is measured to be…

Q: a particu andard conditions. 25 C₂H, (g) + O₂(g) → 8 CO₂(g) + 9 H₂O(g) - hat is the standard…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: AHixn

Q: Calculate the standard molar enthalpy of formation of nitrogen monoxide, NO, given the following…

A: This is an application of Hess's law

Q: Sucrose (C₁2H22011) burns at 25°C to form CO₂ gas and liquid H₂O, releasing 5,640,000 kJ/kmol of…

A: The answer for this problem is provided below in great details within the attached figure.

Q: Butane is the liquid found in lighter fluid. If it reacts with oxygen, it can undergo a combustion…

A: Since, The standard enthalpy of the formation is defined as change of enthalpy of 1 mol of the…

Q: Nitric oxide (NO, also called nitrogen monoxide), is used as a signaling agent within various…

A: When one mole of the substance is formed by its constituent elements in its standard states, the…

Q: Calculate the change of enthalpy for the reaction 2Al (s) + 3Cl2 (g) --> 2AlCl3 (s) from the…

A: Enthalpy of reaction is calculated below.

Q: Dimethyl ether, a useful organic solvent, is prepared in two steps. In the first step, carbon…

Q: Consider the following thermochemical equation: 2X2Y6(g) + 7O2(g) ⟶ 4XO2 + 6Y2O Δ?= -2.615 x 103 kJ…

A: Balanced chemical equation: 2X2Y6(g) + 7O2(g) ⟶ 4XO2 + 6Y2O ΔH= -2.615 x 103 kJ Number of mol =…

Q: A scientist measures the standard enthalpy change for the following reaction to be 161.3 k):…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Styrene (C8H8) is one of the substances used in the production of synthetic rubber and burns…

Question

Calculate the enthalpy of the reaction4B(s) + 302(g)2B2
03(s) given the following pertinent information:B2O3(s
) + 3H20(g)302(g) + B2H6(g), HA = +2035 kJ2B(s) + 3
H2(g)B2H6(g), HB = +36 kJH2(g) + 1202(g)H20(1),
HC 285 kJH20(1)H2O(g), HD = +44 kJExpress your
answer with the appropriate units.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Trending now

This is a popular solution!

Step by step

Solved in 1 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Hydrogen sulfide, H2S, is a foul-smelling gas. It burns to form sulfur dioxide. Calculate the enthalpy change to burn 27.4 g of hydrogen sulfide. 2H2S(g) + 3O2(g) à 2SO2(g) + 2H2O(g); ΔH = -1036 kJ
For reaction (b) HCl(g) + NaOH(s) NaCl(s) + H20(I), what is the equation for the change in enthalpy of this reaction? O [AHf° (NaCI(s)) + AHf°(H20(1)] - [AHP(HCI(g)) + AHP(N2OH(s))] O [AHP (HCI(g)) + AHP(N2OH(s))] - [AHP(NaCI(s)) + AHP(H20(1))] Click if you would like to Show Work for this question: Open Show Work SHOW HINT SHOW SOLUTION Part 4 X Your answer is incorrect. Try again. Use the values from the given table and the equation you chose in Part 3 to find the overall change in enthalpy for the reaction. -55200
Calculate the standard enthalpy for the reaction 1/2N2(g) + 1/2O2(g) -> NO (g) given the following information: As part of your answer, show how the equations can be added together to give the overall or net equation. N2(g) + 3H2(g) -> 2NH3 (g) enthalpy = -91.8 kJ 4NH3(g) + 5O2(g) -> 4NO(g) + 6H2O(g) enthalpy= -906.2kJ H2(g) + 1/2O2 g) -> H2O(g) enthalpy+ - 241.8kJ
The question is in the image. I would gladly appreciate it, it is typed instead of written down on paper
In a generic chemical reaction involving reactants A and B and products C and D, aA+bB→cC+dD, the standard enthalpy ΔH∘rxn of the reaction is given by ΔH∘rxn=cΔH∘f(C)+dΔH∘f(D) −aΔH∘f(A)−bΔH∘f(B) Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is often generalized as follows, where the first sum on the right-hand side of the equation is a sum over the products and the second sum is over the reactants: ΔH∘rxn=∑productsnΔH∘f−∑reactantsmΔH∘f where m and n represent the appropriate stoichiometric coefficients for each substance. What is ΔH∘rxnΔHrxn∘ for the following chemical reaction? CO(g)+NH3(g)→HCN(g)+H2O(g) You can use the following table of standard heats of formation (ΔH∘f)(ΔHf∘) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218218 N(g) 473473 H2(g) 00 O2(g) 00 NH3(g) −45.90 O(g) 249 CO(g)…
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
The question is in the image.
Which of the following reactions occuring at 25° C defines the standard enthalpy of formation (TriangleHf) of liquid water? - 2 H (g) + O (g) -> H2O (l) - H2O(g) + O (g) -> H2O (l) - H2 (g) + ½O2 (g) -> H2O (l) - 2 H2 (g) + O2 (g) -> 2 H2O (l)
In the laboratory, a student dilutes 17.8 mL of a 9.80 M hydrobromic acid solution to a total volume of 125.0 mL. What is the concentration of the diluted solution? Concentration = 0.78 M
7.Using the following standard enthalpies of reaction4NH3(g) + 7 O2(g) 4 NO2(g) + 6 H2O(l)H ̊rxn= -1395 kJN2(g) + 2 O22 NO2(g)H ̊rxn= +67.4 kJFind the standard enthalpy of reaction for the equation:2N2(g) + 6 H2O(l) 4 NH3(g) + 3 O2(g) Based on your work above, determine the standard enthalpy of reaction for the following equation:N2(g) + 3 H2O(l) 2 NH3(g) + 3/2 O2(g)
to calculate the true enthalpies of these reactions by the Hess’ law, as: ΔH°(rxn) = Σ[ν × ΔHf°(product)] – Σ[ν × ΔHf°(reactant)] for: Mg(s) + ½O2(g) → MgO(s)
1) From the following data, C(graphite) + O2(g) à CO2(g) = -393.5 kJ/mol H2(g) + 1/2O2(g) = H2O(l) delta H = -285.8 kJ/mol 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l) delta H = -3119.6 kJ/mol calculate the enthalpy change for the reaction 2C(graphite) + 3H2(g) =C2H6(g) a) –2417.2 kJ b) –84.6 kJ c) 2417.2 kJ d) –3204.2 kJ