3.1 Write the IUPAC and common names for each of the following: a. CH3—CH₂—OH b. C. OH CH3-CH2-CH-CH3 SH ES d. OH $ OH F

Q: Write the IUPAC name for each of the following:

A: The alkene is given and we to tell the IUPAC name of the compound.

Q: 12.26 Write the balanced chemical equation for the complete combustion of each of the following…

A: Balanced chemical equation: it can be define as a reaction in which number of atoms of all the…

Q: 14.4 Write the IUPAC and common name, if any, for each of the following carboxylic acids: O || a.…

A: #14.4:  While giving IUPAC name to an organic molecule, we follow rules assigned by IUPAC…

Q: Draw the products of each reaction. 1. 2. 3. CH3 CH3-C-CH₂CH3 OH OH HI OH HCI HBr

A: This question belong to reaction mechanism that is reactive intermediate. Mechanism have done via…

Q: 9. 8. 3 на фон CH 3 двое OH CH₂ H3C CI + 60₂ CH HẠCH3 CH₂ CH3

A: The question is based on organic reactions.     we need to identify the product formed and explain…

Q: 58 Draw the line-angle formula for each of the following compounds: a. toluene c.…

A: Line angle formula :-  In this only bonds between the atoms are shown as lines without showing the…

Q: None

A: c. CH3-CH2-CH2-C(=O)-O-CH2-CH3This ester is formed from:Carboxylic Acid: Butanoic acid,…

Q: 11.18 Draw the line-angle formula for each of the following: a. 1-bromo-2-methylpentane c.…

A:

Q: Why does incomplete combustion occur? Select one: poor supply of energy O a. O b. poor supply of…

A: the incomplete combustion occurs due to the

Q: What is the major organic product obtained from the following reaction? OB A OD OC A. N GO H* B. C.…

A: The reaction between cyclohexanone with secondary amine results in the formation of enamine which is…

Q: 11.34 Draw the structural formula for the product in each of the fol- lowing reactions: a.…

A:

Q: Draw the condensed structural or line-angle formula for each of the following: a. diethyl ether b.…

A: a) The compound given is diethyl ether. Hence there are 2 ethyl groups attached with a ether bond.…

Q: 5. What is the IUPAC name for the compound shown in the box? 3-ethyl-2.4.5.6.7-pentamethylheptane…

A: The IUPAC nomenclature rules for the organic alkane, alkene and alkyne are : Identify the Longest…

Q: 11.28 Draw the condensed structural formula, or line-angle formula, if cyclic, for each of the…

A: We have to write the condensed structural formula and line angle formula for four molecules.

Q: The intermediate and final products of the following reaction (in that order) are: 4 then 3 2 then 5…

A: We have to identify the intermediate and final products of the given reaction.

Q: a. pentyl formate b. 5-bromopentanoic acid c. 3,5-dimethylhexanoic acid d. butyl propanoate

A: Answer:    the condensed structural formulas for compounds pentyl formate and 5-bromopentanoic…

Q: 1) BH3, THF 2) H2O2 H,O, NAOH 10. 3) NaH 4) CH3B

A:

Q: 14.6 Draw the condensed structural formulas for a and b and line-angle formulas for c and d: a.…

A:

Q: Use your notes and the Tables P, Q, and R in your Reference Guide to name each of the following…

A: Write name of the given structure--

Q: 12.44 Classify each of the following alcohols as primary (1°), secondary (2°), or tertiary (3°):…

A: Note: Since you have posted a question with multiple sub-parts, we will solve the first three…

Q: %23 Provide the IUPAC name for the compound below. HO- Select one: O a. 2-methyl-5-heptanoic acid O…

A: Select the longest hydrocarbon chain containing functional groups. Number in such a way that…

Q: Specify the number of nonbonding electron pairs that are missing from the labelled atoms, a-c in…

A: The nonbonding electron pair is  an electron pair of valence electrons which doesn't  participate in…

Q: Give the IUPAC name for each of the following structures. Thank you!

A: IUPAC nomenclature of organic chemistry is a method of naming organic chemical compounds as…

Q: 1. 2. 3. Write the correct name for the following compound. CH₂-CH3 H₂C-CH₂ H3C-CH-CH-CH LI CH3 CH₂…

A: 1. Select longest carbon chain as parent chain . 2. Start numbering from where we get substituent…

Q: Problem 9.6 Rank the following compounds in order of increasing boiling point. a. HO, HO HO OH adt

A: Compounds with stronger intermolecular force,larger molecules, less branching will have higher…

Q: for each of the following compounds: (12.1, 12.2) a. 2,3-dichlorocyclobutyl alcohol b. butyl propyl…

A: In this question, four compounds name are given,by which we form their structure.

Q: 5. Arrange the following in decreasing boiling point (Highest first, lowest last) butanoic acid,…

A: The temperature at which the vapor pressure of the liquid is same as the external atmospheric…

Q: formulas for the aldehyde and carboxylic acid produced when each of the following is oxidized: a. b.…

A: -> Alcohols on oxidation first of all gives aldehyde then again on oxidation form carboxylic acid…

Q: 11.36 Give the IUPAC name for each of the following: a. b. C. Br CI Br Cl OH CI CI

A: The given compound are derivatives of benzene. The IUPAC name of the benzene derivative is given on…

Q: a b O d B Show products of the following reactions, a- j. (7.5 HNO3 H₂SO4, heat CI H₂SO4 heat Cl₂,…

A: All the given reactions are electrophilic aromatic substitution reactions.

Q: 10. Draw the condensed structural formula, or line-angle formula if cyclic for each of the…

A: The objective of the question is to draw the condensed structural formula or line-angle formula for…