![Chemistry for Engineering Students](https://www.bartleby.com/isbn_cover_images/9781285199023/9781285199023_largeCoverImage.gif)
Concept explainers
Interpretation: The additional data required to determine the
Concept introduction:
Chemical reactions proceed with the absorption (endothermic) or evolution (exothermic) of heat.- Enthalpy change or the change in the energy of a chemical reaction can be deduced in terms of the enthalpy of formation of the products and reactants.
- The enthalpy of formation of any chemical system in its natural state is zero.
![Check Mark](/static/check-mark.png)
Answer to Problem 9.95PAE
Solution: The data showing the standard enthalpy of formation of solid silicon dioxide is required.
Explanation of Solution
The given reaction is:
Reaction enthalpy can be calculated using the following equation
nproducts and nreactants are the number of moles of products and reactants respectively
Based on equation (1) for the given reaction we can write:
Therefore,
The standard enthalpy of formation of solid silicon dioxide is required to calculate the enthalpy of formation of silicon nitride.
Want to see more full solutions like this?
Chapter 9 Solutions
Chemistry for Engineering Students
- 9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forward
- The decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forward
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardGiven the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- An industrial process for manufacturing sulfuric acid, H2SO4, uses hydrogen sulfide, H2S, from the purification of natural gas. In the first step of this process, the hydrogen sulfide is burned to obtain sulfur dioxide, SO2. 2H2S(g)+3O2(g)2H2O(l)+2SO2(g);H=1124kJ The density of sulfur dioxide at 25C and 1.00 atm is 2.62 g/L, and the molar heat capacity is 30.2 J/(mol C). (a) How much heat would be evolved in producing 1.00 L of SO2 at 25C and 1.00 atm? (b) Suppose heat from this reaction is used to heat 1.00 L of the SO2 from 25C to 500C for its use in the next step of the process. What percentage of the heat evolved is required for this?arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardHydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJarrow_forward
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
![Text book image](https://www.bartleby.com/isbn_cover_images/9781337398909/9781337398909_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9780534420123/9780534420123_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305580343/9781305580343_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781133949640/9781133949640_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781337399074/9781337399074_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781285199047/9781285199047_smallCoverImage.gif)