Write a chemical equation representing the decomposition of water into two gaseous products. What are the products?

Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)arefurnaceElectricSi(s)+CO(g) b. Liquid silicon tetrachloride is reacted with very pure solid magnesium, producing solid silicon and solid magnesium chloride. c. Na2SiF6(s) + Na(s) Si(s) + NaF(s)

Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)

The carbon dioxide exhaled in the breath of astronauts is often removed from the spacecraft by reaction with lithium hydroxide 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(l) Estimate the grams of lithium hydroxide required per astronaut per day. Assume that each astronaut requires 2.50 103 kcal of energy per day. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 2.50 103 kcal of heat, calculate the amount of CO2 produced and hence the amount of LiOH required. The H for glucose(s) is 1273 kJ/mol.

Consider the iron alloy described in Question 19. Suppose it is desired to prepare 1.00 kg of this alloy, what mass of each component would be necessary?

Without consulting your textbook, list and explain the main postulates of the kinetic molecular theory for gases. How do these postulates help us account for the following bulk properties of a gas: the pressure of the gas and why the pressure of the gas increases with increased temperature; the fact that a gas tills its entire container; and the fact that the volume of a given sample of gas increases as its temperature is increased.

What mass of solid NaOH (97.0% NaOH by mass) is required to prepare 1.00 L of a 10.0% solution of NaOH by mass? The density of the 10.0% solution is 1.109 g/mL.

Rewrite the following word equation using chemical formulas. Balance the equation and write the balanced equation in net ionic form: bariumchloride(aq)+sodiumsulfate(aq)sodiumchloride(aq)+bariumsulfate(s)

Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)Si(s)+CO(g) b. Silicon tetrachloride is reacted with very pure magnesium, producing silicon and magnesium chloride. c. Na2SiF6(s)+Na(s)Si(s)+NaF(s)