Chromium(VI) forms two different oxyanions, the orangedichromate ion
Explain why orange dichromate solutions turn yellowwhen sodium hydroxide is added.
Want to see the full answer?
Check out a sample textbook solutionChapter 6 Solutions
Chemical Principles
- Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?arrow_forwardWrite an equation for an equilibrium system that would lead to the following expressions (ac) for K. (a) K=(Pco)2 (PH2)5(PC2H6)(PH2O)2 (b) K=(PNH3)4 (PO2)5(PNO)4 (PH2O)6 (c) K=[ ClO3 ]2 [ Mn2+ ]2(Pcl2)[ MNO4 ]2 [ H+ ]4 ; liquid water is a productarrow_forwardSuppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?arrow_forward
- Write the equilibrium constant expression for each of the following reactions in terms of concentrations. (a) CO2(g) + C(s) 2 CO(g) (b) [Cu(NH3)4)2+(aq) Cu2+(aq) + 4 NH3(aq) (c) CH3CO2H(aq) + H2O() CH3CO2(aq) + H3O+(aq)arrow_forwardThe creation of shells by mollusk species is a fascinating process. By utilizing the Ca2+ in their food and aqueous environment, as well as some complex equilibrium processes, a hard calcium carbonate shell can be produced. One important equilibrium reaction in this complex process is HCO3(aq)H+(aq)+CO32(aq)K=5.61011 If 0.16 mole of HCO3 is placed into 1.00 L of solution, what will be the equilibrium concentration of CO32?arrow_forwardWhat is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.arrow_forward
- Chromium(VI) forms two different oxyanions, the orange dichromate ion, Cr2O72 , and the yellow chromate ion, CrO42 . (See the following photos.) The equilibrium reaction between the two ions is Cr2O72(aq)+H2O(l)2CrO42(aq)+2H+(aq) Explain why orange dichromate solutions turn yellow when sodium hydroxide is added.arrow_forwardThe value of the equilibrium constant, K, is dependent on which of the following? (There may be more than one answer.) a. the initial concentrations of the reactants b. the initial concentrations of the products c. the temperature of the system d. the nature of the reactants and products Explain.arrow_forwardConsider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forward
- The chapter opening photograph (page 670) showed how the cobalt(II) chloride equilibrium responded to temperature changes. (a) Look back at that photograph. Is the conversion of the red cation to the blue anion exothermic or endothermic? (b) If hydrochloric acid is added to the violet mixture of cobalt(II) ions shown below, the blue CoCl42 ion is favored. If water is then added to the mixture, a red solution favoring [Co(H2O)]2+ results. Explain these observations in terms of Le Chateliers principle. (c) How do these observations prove the reaction is reversible?arrow_forwardThe following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forwardConsider the reaction 2N2O(g) + O2(g) 4NO(g) Suppose the system is at equilibrium, and then an additional mole of N2O(g) is injected into the system at constant temperature. Once the reaction reestablishes equilibrium, has the amount of N2O increased or decreased from its original equilibrium amount? Explain. What happens to the value of the equilibrium constant with this change?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning