Concept explainers
(a)
Interpretation:
The standard enthalpy change for the given “cracking” reaction has to be calculated
Concept Introduction:
Enthalpy of reaction: (
The enthalpy of a reaction is calculated by subtracting the heat of formation of reactatns from heat of formation of products.
(a)
Answer to Problem 21.123QP
The standard enthalpy change for the given “cracking” reaction is
Explanation of Solution
Given data:
The given cracking reaction is:
To Calculate: The standard enthalpy change for the given “cracking” reaction.
Using the Appendix C, the heat of formation (
The
Hence, the standard enthalpy change is
The standard enthalpy change for the given “cracking” reaction is calculated as
(b)
Interpretation:
The standard enthalpy change for the given “cracking” reaction has to be calculated
Concept Introduction:
Enthalpy of reaction: (
The enthalpy of a reaction is calculated by subtracting the heat of formation of reactatns from heat of formation of products.
(b)
Answer to Problem 21.123QP
The standard enthalpy change for the given “cracking” reaction is
Explanation of Solution
Given data:
The given cracking reaction is:
To Calculate: The standard enthalpy change for the given “cracking” reaction.
Using the Appendix C, the heat of formation (
The
Hence, the standard enthalpy change is
The standard enthalpy change for the given “cracking” reaction is calculated as
Want to see more full solutions like this?
Chapter 21 Solutions
OWLv2 for Ebbing/Gammon's General Chemistry, 11th Edition, [Instant Access], 1 term (6 months)
- When one mole of ethylene gas, C2H4, reacts with fluorine gas, hydrogen fluoride and carbon tetrafluoride gases are formed and 2496.7 kJ of heat are given off. What is Hf for CF4(g)?arrow_forwardWhen lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardOne step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?arrow_forward
- The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardAlthough the gas used in an oxyacetylene torch (Figure 5.7) is essentially pure acetylene, the heat produced by combustion of one mole of acetylene in such a torch is likely not equal to the enthalpy of combustion of acetylene listed in Table 5.2. Considering the conditions for which the tabulated data are reported, suggest an explanation.arrow_forwardCalculate the enthalpy change when 1.0(1 g of methane is burned in excess oxygen according to the reaction CH,(g) 4- 2O2(g) ->CO2(g) + H-CH/) 1H = -891 kJ/molarrow_forward
- Given: 2Cu2O(s) + O2(g) 4CuO(s)H = 288 kJ Cu2O(s) CuO(s) + CuO(s)H = 11kJ Calculate the standard enthalpy of formation (Ht) for CuO(s).arrow_forwardWe burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forward
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardThe reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forward
- Introductory Chemistry: A FoundationChemistryISBN:9781285199030Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningWorld of ChemistryChemistryISBN:9780618562763Author:Steven S. ZumdahlPublisher:Houghton Mifflin College Div
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co