Which of the following is not true about low molar mass carboxylic acids? They have a sour taste. They change red litmus to blue. They form aqueous solutions with a pH less than 7. They react with bases to form water and a salt. Which of the following statements best describes the solubility of aliphatic carboxylic acids in water? The solubility decreases as the number of carbon atoms increase. The fist 4-carbon acids are miscible with water, while those with 8 or more carbons are insoluble. The solubility increases as the number of carbon atoms decrease. All of them are soluble in water. What is the order of increasing acidity for the following compounds? (least to most) COOH COOH COOH COOH CH3 NO₂ I II III IV IV, I, III, II III, II, I, IV II, III, I, IV III, II, IV, I

Which of the following is not true about low molar mass carboxylic acids? They have a sour taste. They change red litmus to blue. They form aqueous solutions with a pH less than 7. They react with bases to form water and a salt. Which of the following statements best describes the solubility of aliphatic carboxylic acids in water? The solubility decreases as the number of carbon atoms increase. The fist 4-carbon acids are miscible with water, while those with 8 or more carbons are insoluble. The solubility increases as the number of carbon atoms decrease. All of them are soluble in water. What is the order of increasing acidity for the following compounds? (least to most) COOH COOH COOH COOH CH3 NO₂ I II III IV IV, I, III, II III, II, I, IV II, III, I, IV III, II, IV, I

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

I am researching about Iron (III) chloride test for alcohols and phenols. As shown in the picture, I have found a lot of different chemical equations for the said qualitative test. My questions are: What is the right chemical equation when FeCl3 (aq) is added to aqueous phenol? What is the name of the major product based on IUPAC? What is the type of reaction that occurred and what is the coordinate bond (why is it formed when Iron (III) chloride is added to aqueous phenol?)
What is / are the products when you mix acetaldehyde, acetone, and sodium hydroxide together?
Name the carboxylic acid that is formed by the acidic hydrolysis of the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH2C. NH2
If a nonpolar carboxylic acid donates a proton to a base, which of the following results is true? The carboxylic acid becomes a negative ion. The ion is more soluble in water than the original carboxylic acid. The carboxylic acid becomes a positive ion. The ion is more soluble in water than the original carboxylic acid. The carboxylic acid becomes a negative ion. The ion is less soluble in water than the original carboxylic acid. The carboxylic acid becomes a positive ion. The ion is less soluble in water than the original carboxylic acid.
Complete the following chemical reaction by showing the structural formulas of all products The esterification of butanoic acid and 1-propanol Thank you!
The purity of the aspirin sample is tested with iron (III) chloride. A purple color resulting from iron (III) chloride test indicates the aspirin sample contains some unreacted salicylic acid and the carboxylic acid group in salicylic acid gives a purple color. the structure of aspirin itself contains a phenolic -OH group. O the aspirin sample contains some unreacted salicylic acid and the phenolic -OH group in salicylic acid gives a purple color. the aspirin sample contains some unreacted salicylic acid and the ring structure in salicylic acid gives a purple color.
Which one of the following functional groups is a base? aldehyde alcohol carboxylic acid ether amine
Give one reason why benzene can act as an acid in the following reaction,
Complete the following chemical reaction by showing the structural formulas of all products The oxidation of 2-butanol. Thank you!
Write the products of the following ester acid-hydrolysis reaction:
Create a flowchart to illustrate the process of separating a combination that contains hexane and butyric acid.
Name the major organic product formed in the following reaction, give the IUPAC name: OH KMnO4