1. Draw the carboxylic acids formed by the oxidation of each of the following molecules. HOH₂C H2 CH3 L H3CH2C + 2. Draw the esters formed by the following reactions. a. H3C H3C-C-C H₂ H3C. OH H3C OH b. OH H3C H3CHCH2CH2C- + H3C CH `CH2CH3 OH H₂ 3. Indicate the products of the following reaction: CH3 + H2O H3CH2CH2C CH₂OH

1. Draw the carboxylic acids formed by the oxidation of each of the following molecules. HOH₂C H2 CH3 L H3CH2C + 2. Draw the esters formed by the following reactions. a. H3C H3C-C-C H₂ H3C. OH H3C OH b. OH H3C H3CHCH2CH2C- + H3C CH `CH2CH3 OH H₂ 3. Indicate the products of the following reaction: CH3 + H2O H3CH2CH2C CH₂OH

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Name the carboxylic acid that is formed by the acidic hydrolysis of the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH2C. NH2
Synthesis of Aspirin: How to fight students' migraines Question 1: Now that you have learned what an esterification reaction is let me ask you a question. Which of the following molecules do you think would be the correct reagents to perform such a reaction? CH₂ Diethyl ether A CH3 OH Benzoic acid B 1. B and D 2. A and B 3. A and C 4. Cand D Question 2: Now that we are here, which step would you take next in your synthetic route? 1. Clip the flask to the support above the water bath to secure it 2. Insert the condenser in the flask to start the reflux 3. Connect the water tubes to the condenser and run the warm water 4. Place the flask on the table and insert the condenser H₂C Ethyl propionate C Question 3: But now we do have our crystals, so let's focus on the yield. Why do you think it is important to wait until the crystals are dry before calculating the yield? 1. Because otherwise the mass of water will add weight on the scale 2. Because water will react with the product 3. Because…
What are the products of the reaction between acetyl chloride and diethylamine? HCl and N,N-diethylacetamide Оа. o b. HCl and diethylamine chloride ос. HCl and N-ethylacetamide d. Diethylacetamide and acid
Draw a reaction showing the reactants (the ester and water) and the products (the alcohol and the carboxylic acid) for each ester below. You can google the structures of the esters. Ester 1 aspirin, Ester 2 benzocaine, Ester 3 gamma-butyrolactone
Draw the skeletal structure of the ester formed when carboxylic acid CH3CH2CH2CH2CO₂H is treated with ethanol (CH3CH₂OH) in the presence of H2SO4 Click and drag to start drawing a structure. G
4. Number these in order of ease of hydrolysis. 1 = easiest to hydrolyze, 4 = hardest to hydrolyze. C.H.&CI C6H5CNHC(CH3)3 CH₂C=NCHCOCH
Please answer question 18 Part A, B, and C
40. Name the following esters b. H3C a. H3C- CH2-CH2 CH2- H3C H3C d. H3C H3C- -CH2 CH2-CH2 CH2- CH2- H2C H2C CH2 CH3 H3C H3C CH3 f. CH-HC HÇ CH2-CH-CH2-CH3 H3C CH2- `CH H2C CH2 H3C h. HCOOCH,CH,CH,CH; CH,CH,COOCH;
2. What type of chemical reaction is illustrated by the following reaction? CH3OOCH3 + H2O ⎯→ CH3OOH + CH3OH a. oxidation/reduction b. substitution c. neutralization d. hydrolysis e. dehydration synthesis (condensation)
What is the major neutral Organic product for the following reaction?
es/ 2021 / 2021/SPRING / CHEM 1001/LEC/001X-2021/SPRING/SEM / Chapter 4 ups What is the functional group found in the following molecule? H H. H-C-C-C- - C-C-H H H H Select one: a. carboxylic acid O b. ether O c. amide O d. ketone e. ester age Next page OO O 0O
Question 10: Draw the organic products in each of the following reactions. fo a. OH PCC 6