Please correct answer and don't use hand rating and don't use Ai solution Which of the following amines is most soluble in water?O PhNH2O ethylamineO pyrrolidineO(CH3)3NO(CH3CH2CH2)2NH

Hydrogen bond is formed between the Hydrogen attached to highly electronegative atom and highly…

Answered: Which of the following amines is most…

Science

Chemistry

Which of the following amines is most soluble in water? O PhNH2 O ethylamine O pyrrolidine O(CH3)3N O(CH3CH2CH2)2NH

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter1: Covalent Bonding And Shapes Of Molecules

Section: Chapter Questions

Problem 1.44P: What is the meaning of the term tertiary (3) when it is used to classify amines? Draw a structural...

See similar textbooks

Related questions

Q: Determine the configuration of each stereogenic center in the compound below, highlight the carbon…

A: --------I m sure this will help you I hope you will appreciate my efforts Thank you!!!!!!Happy…

Q: Classify the following substituents according to whether they are electron donors or electron…

Q: What pH would you raise a water sample to, to decrease the concentration of dissolved Mg2+ from 100…

A: Step 1: Convert Mg²⁺ Concentrations to MolarityInitial concentration of Mg²⁺ is 100 mg/L = 0.100…

Q: Classify the following substitutes according to whether they are electron donors or electron…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: Step 1: Let's go through each part of this question for a 5th-order reaction (A→B):(a) Write down…

Q: Please answer accuratly and dont use AI to get answer like the other person who did this when i…

Q: Provide the balanced molecular, total ionic, and net ionic equation for the reaction between tin(IV)…

A: To provide the balanced molecular, total ionic, and net ionic equations for the reaction between…

Q: Please correct answer and don't use hand rating

A: To plot the variation of the composition of aqueous solutions of glycine and tyrosine with pH, we…

Q: Balance this chemical equation.

A: Step 1 Normal equation is N2H4 =NH3 + N2Step 2By balancing 3N2H4=4NH3+N2

Q: Don't use AI.

A: A)In elimination reactions, regioselectivity and stereoselectivity refer to different aspects of the…

Q: Show work with explanation needed..don't give Ai generated solution

A: If you didn't get the point ,you can ask, I can explain it further.

Q: Show work. don't give Ai generated solution

A: Approach to solving the question:To write the IUPAC name of the given structure, we use the…

Q: None

A: The molarity of Ag(NO3)=0.600MThe volume of Ag(NO3)=30mLThe number of moles of…

Q: Why shouldn’t a buffer with a pH of 10.0 be used as a mobile phase in an HPLC separation? Group of…

A: High-performance liquid chromatography (HPLC) is a technique in analytical chemistry used to…

Q: : This Lewis structure may be incomplete. Formal charges and bonds are shown, but lone pairs are…

A: No lone pairs need to be added, and no further adjustments are required since the Lewis structure is…

Q: 1. Calculation for conversion of Maleic to Fumaric acid (2 points) Mass of Maleic acid Molar mass of…

Q: Please correct answer and don't use hand rating

A: Step 1:To calculate the molar concentration of the nitric acid solution, we need to use the concept…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Oxalic acid (H₂C₂O₄) is a diprotic acid, this means that it can donate two protons. Here are the two…

Q: Consider this organic reaction: Br HO Draw the major products of the reaction in the drawing area…

A: Step 1: Step 2: Step 3: Step 4:

Q: Which compounds contain stereocenters? CH3 -CH-CH3 о OH OH -CH-CH2 || CH3 OH CH-CH-CH3 CH3 C-CH2-CH3…

A: Step 1:Chiral center ( chiral carbon) Step 2: Step 3: Step 4:

Q: Which of the following Newman projections is the lowest energy conformation of n-pentane? H3C H H A…

A: n-pentane is an alkane with a continuous chain of five carbons; the lowest energy Newman projection…

Q: Please correct answer and don't use hand rating

A: According to the given chemical equation: A(s) +…

Q: Assign an oxidation number to carbon in the following compound: CH4O2

A: Step 1: Explanation The oxidation number of hydrogen(H) is generally +1 in the combined stateThe…

Q: need help on how to find limiting reagent in tamoxifen and % yeild? 1-Bromo-1-phenylpropyl = 2.62g…

A: Tamoxifen synthesis 1-phenylpropylmagnesium bromideMass (M) = mass of 1-Bromo-1-phenylpropyl + mass…

Q: Name these organic compounds

A: Step 1: Guidelines for IUPAC nomenclature of organic compounds:Consider the carbon chain with the…

Q: 19

A: Step 1: Reduction utilizing Zn(Hg) and HClThis process is a Clemmensen reduction, converting…

Q: Calculate the mixing ratio of O3 in surface air (z=0 km; P = 1000 hPa; T = 300 K). Is it in…

A: Approach to solving the question:.Detailed explanation:.Examples: Key references:

Q: Give the geometry, number of d e-, draw the CF splitting diagram, number of unpaired e-, and…

A: Thank you for taking the time to go through this explanation! If you have any doubts regarding this…

Q: 15

Q: Balance the following reaction equation: HNO3+ NaHCO3→ NaNO3+ H₂O+ CO2

A: The unbalanced chemical equation is given as: HNO3 + NaHCO3 → NaNO3 + H2O + CO2. In this equation,…

Q: PLs help ASAP, pls show all work and steps.

A: Step 1:Step 2: Step 3: Step 4:

Q: 22

A: The reaction in question is a Friedel-Crafts chlorination reaction. In this type of reaction, a…

Q: Please correct answer and don't use hand raiting

A: Approach to solving the question: To write the full name of the given ball stick models, we use the…

Q: Please correct answer and don't use hand rating

A: Step 1:Given data,Balanced reaction,C6H12O6 + 6O2 —> 6CO2 + 6H2OMass of C6H12O6, w1 = 15.0 gMolar…

Q: Classify the following substitutes according to whether they are electron donors or electron…

A: 1.The carbonyl group (-C=O) is electron-withdrawing through the inductive effect due to the high…

Q: What are wrong with the reagent and how can it be fixed.

Q: 3. Hemiacetals are the product of a reaction between an aldehyde and one equivalent of alcohol.…

A: Step 1: Step 2: Step 3: Step 4:

Q: A 50.0 mL solution of Ca(OH)2 with an unknown concentration was titrated with 0.340 M HNO3. To reach…

A: Step 1:Calcium hydroxide react with nitric acid to form calcium nitrate and water Ca(OH)2(aq)…

Q: Br H H H3C CH3 3. Draw the corresponding dash-wedge structure for each of the following Newman…

Q: Need experts solution only Don't use AI.

Q: Equation 10-12: pH = ½ (pKa₁ + pKa2) is applicable for which of the following solutions? I. 1.0 x…

A: Q1:pH = 1 / 2 (pKa1 + pKa2), is applicable for solutions that are at their second equivalence…

Q: .) 5.00 moles of He ( assumed to be an ideal gas) initially at 300 K and 1.00 bar is compressed…

A: Steps to Solve the Problem:

Q: The reaction you will be doing in Experiment 2 is very similar to a reaction you may already have…

Q: None

A: To solve this problem, we first set up the equilibrium expression for the…

Q: With explanation don't use AI.

A: Steps for Drawing Major Resonance Form of S2O2 :1. Skeleton Structure:S atoms are bonded to each…

Q: Draw the least stable resonance form the intermediate in the following electophilic substitution…

A: The least stable resonance structure of the intermediate is the SECOND.The substituent O=CR is meta…

Q: If 65.0 g of AgNO3 (FW 169.87 g/mol ) is added to a solution containing 45.0 g of CaBr2 (FW 199.89…

A: Step 1: Given2 AgNO₃(aq) + CaBr₂(aq) → 2 AgBr(s) + Ca(NO₃)₂(aq)Mass of AgNO₃ = 65.0 gMolar Mass of…

Q: Name the following organic compounds

A: Step 1: IUPAC RuleFind the highest priority functional group.Determine and name the longest…

Q: a) Will 50.00 g of NaCl completely dissolve in 100 g of 80°C water? b) Will 0.40 g of benzoic acid…

A: Solubility is the maximum amount of a solute that can be dissolved in a solvent at a given…

Q: For the Kinetics – The Iodine Clock Reaction experiment, list out the glassware, tools, equipment…

A: Glassware, Tools, Equipment, and Materials Used for the Iodine Clock Reaction…

Question

Please correct answer and don't use hand rating and don't use Ai solution

Which of the following amines is most soluble in water?
O PhNH2
O ethylamine
O pyrrolidine
O(CH3)3N
O(CH3CH2CH2)2NH

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Complete this table for different amine compounds. Chemical propylamine quaternary ammonium ion methylphenylamine Molecular formula C3H9N C₂H7N C5H13N C4H10N Structural formula (CH3)3N (CH3)2NH CH 3 I (CH₂) 11 | H3C(CH2) 11 -N-(CH₂)11CH3 NHCH3 (CH₂)11 CH3 CH3CH2CH2-NH-CH3 + Classification Tertiary Quaternary Tertiary Secondary
Which of the following amines will not show intermolecular hydrogen bonding? a) CH3NH2 b) (CH3)2NH c) (CH3)3N d) all of these
< app.101edu.co Classify and describe the properties of the following nitrogen containing compound. O CI O + Question 13.a of 25 CH3 N Classify the following amine. H CH3 A) primary amine B) secondary amine C) tertiary amine @=J D) tertiary amine salt E) quaternary ammonium salt
Which of the following is a primary amine? CH,CHCH, OH CH3 CH CH3 H3C. H. CH,CHCH, 1. NH2 NH2
Which of the following compounds is a tertiary amine? NH2 CH-CH-CH CH3 CH-C-CH3 NH2 CH3 CH-N-CH CH, O NH CH-NH-CH NH2
Below is the structure of Clemastine and its functional groups. Which of the following statements regarding Clemastine and its functional groups is NOT true? * Ether Tertiary amines CH CH3 Halogenated aromatic hydrocarbon Aromatic hydrocarbon Aliphatic hydrocarbons Clemastine (Tavist) Aromatic hydrocarbon is lipophilic Halogenated aromatic hydrocarbon is lipophilic. Tertiary amine is hydrophobic. Ether is hydrophilic.
Name (by the common system of nomenclature) the amine (or ammonia) that is formed by the basic hydrolysis of the following acid amide: 01C NH₂
N-Methylpyrrolidine has a boiling point of 81 °C, and piperidine has a boiling point of 106 °C. Tetrahydropyran has a boiling point of 88 °C, and cyclopentanone has a boiling point of 141 °C. These two isomershave a boiling point difference of 53 °C. Explain why the two oxygen-containing isomers have a much larger boilingpoint difference than the two amine isomers
Write the common name for each amine. HỌC—N—CH,CH3 H₂C-CH₂-CH₂-CH₂ Ethylbutylamine common name: Incorrect HC—CH,—N—CH,—CHy CH₂ CH3 diethylethylamine common name: Incorrect These compounds are tertiary amines.
The amine is a
Following amines can be classified as -- and ---, respectively. HN-CH3 H3C-CH3 'N' H primary amine, secondary amine secondary amine, ammonium salt secondary amine, primary amine secondary amine, tertiary amine
Which compound is a primary amine with the formula C5H13N? * H2N H2N II III NH2 IV V IV O II O III and V d、飞