Use the following equilibria 2CH4(g) <----> C2H6(g) + H2(g) Kc1 = 9.5 × 10-13 CH4(g) + H2O(g)  CH3OH(g) + H2(g) Kc2 = 2.8 × 10-21 to calculate the value of Kc' for the following reaction: 2CH3OH(g) + H2(g) <---> C2H6(g) + 2H2O(g) Enter your response in scientific notation, e.g. enter 2E3 for 2000

Q: 03(g) 2S02(g) + O2(g) Kc = 2.3 x 10 O3(9) S 2NO2(g) + O2(g) Kc 1.4 x 10 Iculate the equilibrium…

A: Equilibrium constant is defined as ratio of concentration of products to the concentration of…

Q: (ii) What is the significance of Kp? Hence, arrange the three molecules in terms of decreasing…

A: Given:

Q: Calculate AHo for the reaction: 20;Hlg) + 70x(g) - 4 CO:g) + 6 HO(g) If. CHi(g) + 30:(9) -2 CO:(g) +…

A:

Q: 6. Given the following methanation reaction at 1000 K. CO (g) + 3 H2 (g) CH4 (g) + H₂0 (g) AH = -230…

A: According to Le - chatliers principle if in a thermodynamic equilibrium, the equilibrium is…

Q: At -119 °C, Keq = 0.472 for the reaction: (a) What is the value of Keq for the reaction NOBr(g)…

A:

Q: Carbonated beverages are produced by dissolving carbon dioxide in water to produce carbonic acid:…

A:

Q: Consider the following reaction: 2SO3 (9) 2SO2(g) + O2(g) If 0.275 moles of SO3(g), 0.686 moles of…

A: Given, 2SO3(g) ⇌ 2SO2(g) + O2(g) At equilibrium, moles of SO3 = 0.275 moles moles of SO2 = 0.686…

Q: 5.) Given the following reactions: NO(g) + ½ O2(g) = NO2(g) 1/2 N2(g) + 1/2O2(g) = NO(g) Calculate…

A:

Q: At a specific temperature, the reaction: 2 H20(g) +2 H2(9) + O2(g) has Keg = 1.40 x 10-4. At the…

A:

Q: Consider the following reaction where Kc = 9.52×10-2 at 350 K. CH4(g) + CCl4(g) 2CH2Cl2(g) A…

A:

Q: The chemical reaction below has a Kc value of about 49.7. How many moles of H2 (g) are there at…

A: Answer: the moles of H2 gas at equilibrium is 0.1335 moles.

Q: In which of the following equilibrium reactions will Kc be greater than Kp? O CH4(g) + 2O2(g) =…

A:

Q: 2. Consider the following equilibria: 2S0;(g) = 2S02(g) + O2(g) K.= 2.3 x 10-7 2NO;(g) = 2NO2(g) +…

A: Characteristics of equilibrium constant:  If reaction is reversed equilibrium constant is…

Q: Write a balanced chemical equation for each reaction. 11. NO(g) + O2(g) NO,(g) 14. C,H,(g) + O,(g)…

A:

Q: 13) Consider the following equilibria: SO2(g) + 0.502(g) SO3(g) 2NO3(g) 2NO2(g) + O2(g) Calculate…

A: Calculate equilibrium constant of the given reaction --

Q: For which reaction below are the values of Kc and K, the same? O 2 SO3 (g) + N2 (g) 2 SO2 (g) + 2 NO…

A: Answer of the question given below,

Q: , Kgoal = ?

A:

Q: If the system 2C0(g) + O2(g) 2 2C02lg) has come to equilibrium and then more CO(g) is added, O [CO2]…

A: We have to predict the effect of adding more of carbon monoxide on equilibrium.

Q: snip

A: The reaction quotient(Qc) measures the relative amount of product reactant present during a reaction…

Q: Consider the following system at equilibrium where AH° = 198 kJ, and Ke = 2.90 × 10-2, at 1150 K:…

A: Answer:When QC=KC, system is at equilibrium.When QC&lt;KC, system is not a equilibrium and in order…

Q: Select True or False: Equilibrium constants are known for the following reactions: S(s) + 3/2O2(g)…

A: The given reaction are: S(s)  +  32O2(g)  →  SO3(g)       Kc=9.2×1023    ......eq 1SO3(g)  →  SO2  +…

Q: On the basis of Kc for the following reaction, would you expect nearly complete reaction at…

A:

Q: What is the equilibrium constant?

A: The equilibrium constant, Kc for a reaction is given as :

Q: Consider the following reaction.                           2 SO2(g) + 02(g)  ---> 2 SO3(g)…

A: According to Le-Chateliar principle--&gt; Changing concentration affect the equilibrium. When…

Q: 6. Determine the Keq value for the reaction of 12(g) + (g) → 13(g) At equilibrium [12(g)] = 6.61 x…

A: Calculate Keq for the given reaction--

Q: Calculate the value of the equilibrium constant, Kc, for the reaction Q(g) + X(g) 2 M(g) + N(g)…

A:

Q: Consider this equilibrium N₂(g) +3 H₂(g) 2 NH3(g) + 94 kJ The equilibrium law expression for the…

A: For the reaction : N2(g) + 3H2(g) &lt;==&gt; 2NH3(g) We have to write the equilibrium law…

Q: What is the equilibrium constant expression for the reaction? CH3COOH + C2H5OH  CH3COOC2H5  + H2O

A: Equilibrium constant expression is the ratio of concentration of product over the concentration of…

Q: Equilibrium. (2) Write the Ke expression for the following balanced equilibrium reaction. N2 (g) + 3…

A: The reaction given is hence the equilibrium constant expression is where [H2 ] = equilibrium…

Q: At-179 °C, Keq 28.7 for the reaction: a) What is the value of Keq for the reaction NOBr(g) NO(g) +…

A: Some important characteristics of equilibrium constant are :  If the reaction is reversed, the value…

Q: reaction quotient expression

A:

Q: Carbonic anhydrase of erythrocytes (?r 30,00030,000) has one of the highest turnover numbers known.…

A: Given, Reverse hydration of CO2

Q: At a given temperature Kc=7.46x10^-2 for reaction 1. What is the value of Kc for reaction 2?…

A:

Q: Fe2O3(s)+3H2(g)→2Fe(s)+3H2O(1) H2(g) Substance: Fe2Оз(s) Fe(s) H2O(1) H° (kJ/mol) Solutions: Final…

A:

Q: Consider the reaction: 1/2N₂ (g) + O₂(g) ⇒ NO₂(g) Write the equilibrium constant for this reaction…

A:

Q: [References] Use the References to access important values if needed for this question. Consider the…

A: Answer:- This question is answered by using the simple concept of Le Chatelier principle and the…

Q: In the following reaction, Kc = 4.0. C2H5OH + CH3COOH ⇄ CH3COOC2H5 + H2O A reaction was allowed to…

A:

Q: (a) 2C(s) + O2(s) → 2C0(g) (b) 2NAHSO3(s) Naz503(s) + 502(s) + H2O(g) (c) 2C(s) + 2H20g) CO23) +…

A: Equilibrium constant kc is the ratio of equilibrium concentration of products over the equilibrium…

Q: Consider the reaction: N2(g)  +   H2(g)  -------   NH3(g)     Kc = 16.5  at 25 oC. In a 1.0-L vessel…

A: The direction of the reaction depends on the reaction quotient of the reaction  1) If reaction…

Q: for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate Kc

A:

Q: Determine if the following system is at equilibrium. If not, in which direction will the system need…

A: For the given reaction: SO2Cl2 (g)⇌ SO2 (g) + O2 (g) Kc=0.048 [SO2Cl2 ]=0.11 M [SO2]= 0.16 M  [ O2]=…

Q: Given K, = 7.2 Kp = 7.1 x 101 C2H6O(g) + 302(g)= 2cO2(g) + 3H20(g) 2C2H,O(g) + 502(g)= 4CO2(g) +…

A:

Q: The equilibrium constant is given for two of the reactions below. Determine the value of the missing…

A: The equilibrium constant for the first reaction is written below.

Q: At -29086 °C, Keq = 6.46 for the reaction: 1/2 N2(9) +1/2 02(9)NO2(g) (a) What is the value of Keg…

A: Given, Temperature = -29086◦c keq = 6.46

Q: Consider the following system at equilibrium where AH° = 108 kJ/mol, and Ke = 1.29x10-2, at 600 K.…

A: This whole process problem is based on the concept of Le Chatelier's principle. Le Chatelier's…

Q: O 1 yeast, ethanol is produced from gruesse under anderable haitions. A cell-free yeast extract is…

A: Moles of glucose = 3.00x 10 2 m mol