The selectivity coefficient, Kg+ µ+, for a K* ion-selective electrode is 0.00378. When the electrode is placed into a 1.80 x 10- M K* solution at pH 6.59, the potential is –0.159 V vs. SCE. If the pH of the solution is lowered to 1.25 and the ionic strength is kept constant, what is the potential of the electrode? Assume ß = 1 for the electrode.

The selectivity coefficient, Kg+ µ+, for a K* ion-selective electrode is 0.00378. When the electrode is placed into a 1.80 x 10- M K* solution at pH 6.59, the potential is –0.159 V vs. SCE. If the pH of the solution is lowered to 1.25 and the ionic strength is kept constant, what is the potential of the electrode? Assume ß = 1 for the electrode.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 50QRT

See similar textbooks

Similar questions

Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
Assume the following electrochemical cell simulates the galvanic cell formed by copper and zinc in seawater at pH 7.90 and 25 C. Zn | Zn(OH)2(s) | OH(aq) || Cu(OH)2(s) | Cu(s) a. Write a balanced equation for the reaction that occurs at the cathode. b. Write a balanced equation for the reaction that occurs at the anode. c. Write a balanced chemical equation for the overall reaction. d. Determine the potential (in volts) of the cell.
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.