Consider the cell Pt(s)/ H2(g, 1 bar)/NaOH (aq, 0.01m), NaCl (aq, 0.01125m)/ AgCl(s) / Ag(s) 2H₂O + 2e → H₂ + 2OH- AgCl + e → Ag + Cl The cell potential has been measured over a range of temperature and the results were found to fit the expression: E = 0.999+1.68x10 4T (E in volts and T in Kelvin) What is entropy change at 30°C?

Consider the cell Pt(s)/ H2(g, 1 bar)/NaOH (aq, 0.01m), NaCl (aq, 0.01125m)/ AgCl(s) / Ag(s) 2H₂O + 2e → H₂ + 2OH- AgCl + e → Ag + Cl The cell potential has been measured over a range of temperature and the results were found to fit the expression: E = 0.999+1.68x10 4T (E in volts and T in Kelvin) What is entropy change at 30°C?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 153CP: Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment...

See similar textbooks

Similar questions

Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V