Answered: Predict the standard potential for the…

Predict the standard potential for the galvanic cell. Refer to the table of standard reduction potentials. Pt(s)|Fe³ +(aq), Fe² +(aq)||Ag+(aq)|Ag(s) E cell V

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 61QAP

See similar textbooks

Related questions

Q: Mg(s) + Fe2+(aq) – Mg2+(aq) + Fe(s) The galvanic cell described above has a standard cell potential…

A: Galvanic cell is electrochemical cell where, current is supplied to carry out some chemical…

Q: The standard reduction potential of the Pb2+/Pb electrode is -0.13 V and the standard cell potential…

Q: Using the provided standard reduction potentials, which of the following cells is an example of a…

A: Galvanic cell converts chemical energy into electric energy . It has zinc metal as anode and copper…

Q: Consider an electrochemical cell based on the following cell diagram: Pt | Pu3+(aq), Pu4+(aq) ||…

Q: Cr3+(aq) + 3e- = Cr(s) -0.763 V Au+(aq) + e- = Au(s)…

A: GIVEN:- Cr3+(aq) + 3e- = Cr(s) -0.763 V Au+(aq) + e- = Au(s)…

Q: Given the following notation for an electrochemical cell Pt(s) | Sn²+(aq), Sn 4+ (aq) || Cl2(g) |…

A: The electrochemical cell notation represents, The oxidation half cell reaction on the left and the…

Q: A constant current flows for 3.75 h through an electrolytic cell containing aqueous AgNO3(aq).…

A: According to the first law of Faraday, the mass of a metal deposited on the anode during…

Q: What is the copper(II)-ion concentration at 25°C in the cell Zn(s) | Zn2+(aq, 1.0 M) || Cu2+(aq) |…

Q: An electrochemical cell Bi(s) | Bi2S3(s) | Bi2S3(aq) | Bi(s) the standard potential is 0.96 V at 25…

A: we have to calculate the equilibrium constant for the cell

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

Q: The cell potential of the following electrochemical cell is determined by using an unspecified…

A: We have find out the answer.

Q: The galvanic cell described by Zn( s)| Zn <*( aq) | Cu<*( aq)| Cu( s) has a standard cell potential…

A: Cell notation : Zn(s) | Zn2+(aq) || Cu2+(aq) | Cu(s) The standard cell potential = 1.101 Volts…

Q: 1. Write the electrode reactions and the cell reactions for the following galvanic cells, and…

A: 1) Cu CuCl2(aq) | Cl2(g), Pt The electrode reactions for this galvanic cell are as follows: At…

Q: The standard cell potential for the reaction Zn + 2 Ag+(aq) → Zn2+(aq) + 2 Ag is 1.56 V. Given that…

A: In the given reaction the Zn is getting oxidized to Zn2+ while the Ag+ is getting reduced to Ag. So…

Q: Write the two half-reactions of the following redox reaction. Calculates the difference between the…

Q: Consider the following galvanic cell at 25°C:Pt|Cr2+(0.30M),Cr3+(2.0M)||Co2+(0.20M)|CoThe overall…

Q: The measured voltage of a cell in which the following reaction Occurs is 1.06 V. Pt(s) | H2 (0.5…

A: pH is equal to the negative logarithm of hydronium ion concentration. pH=-log(H3O+) Nernst…

Q: Consider the cell diagram for an electrochemical cell: Pt | Ti2+(aq), Ti3+(aq) || Br2(g), Br-(aq) |…

A: For the electrochemical cell: Pt | Ti2+(aq), Ti3+(aq) || Br2(g), Br-(aq) | Pt having E = 1.40 V , we…

Q: ) Consider the galvanic cell, Zn(s) | Zn2+(aq) || Pb2+(aq) | Pb(s). Which one of the following…

A: Galvanic cell : The notation in galvanic cell is written as : So , the reaction for given cell…

Q: What is the standard reduction potential for the galvanic cell described by the cell notation: Fe(s)…

A: A galvanic cell is composed of a cathode and anode. The cathode involves the reduction reaction,…

Q: For the following redox reaction calculate the standard cell potential of the reaction. Redox…

A: We should know the oxidation reaction and the reduction reaction. In Oxidation reaction we have loss…

Q: Use the standard reduction potentials in Appendix L Links to an external site.to find the standard…

A: Redox reaction involves the transfer of electron from one species to another species. Here we are…

Q: What is the balanced chemical equation for this galvanic cell reaction? Cr(s) | Cr3*(aq), 1M || CI-…

Q: Write the overall cell reaction for the galvanic cell given below. Pt(s) | Sn2+(aq), Sn4+(aq) ||…

Q: The cell potential of the following cell at 25°C is 0.475 V: Zn|Zn^2+(0.20 M)|| H+ (test solution)|…

A: Given, Cell potential = 0.475 V Temperature = 25°C =(25+273)K=298 K

Q: The cell notation for a galvanic cell is shown below. What is the oxidizing agent?…

A: The species undergoing an increase in oxidation state is oxidation or reducing agent whereas species…

Q: Using values from the tables of standard reduction potentials, calculate the cell potential of the…

A: Given, Ga(s)|Ga3+(aq)||Ag+(aq)|Ag(s) Anode reaction; Ga(s) ⟶ Ga3+ + 3e_ E° = 0.567 V…

Q: Consider the galvanic cell: Pt(s) | H2(1 atm)|H*(1 M) || CI'(1 M) | Hg2Cl2(s)|Hg(l) Which of the…

A: Nernst equation: The Nernst equation relates to the reduction potential of an electrochemical…

Q: 12 The standard cell potential for the following galvanic cell is 0.71 V.…

A: Given- Standard cell potential of galvanic cell =0.71V Mg(s)|Mg2+(aq)||Al3+(aq)|Al Equilibrium…

Q: Calculate the standard cell potential, ?∘cellEcell°, for the reaction shown. Use these standard…

Q: Calculate the standard cell potential for the following galvanic cell.…

Q: State Zaitseff's rule and use it to predict the structure and systematic name for the major product…

Q: Write a balanced equation for the overall cell reaction in the following galvanic cell and tell why…

A: Answer:Galvanic cell is a type of electrochemical cell that converts chemical energy into electrical…

Q: he standard cell potential of the silver-copper galvanic cell has a value of 0.46 V. The cell…

A: Electrochemical cell is a cell in which chemical energy is converted to electrical energy. The given…

Q: What is the balanced equation for the galvanic cell reaction expressed using the following shorthand…

A: The cell given is Mg (s) | Mg2+ (aq) || Cl2 (g) | Cl– (aq) | C (s).

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

100%

Predict the standard potential for the galvanic cell. Refer to the table of standard reduction potentials.
Pt(s)|Fe³ +(aq), Fe² +(aq)||Ag+ (aq)|Ag(s)
E
cell
||
=
V

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Cell notation

VIEW

Step 2: Standard potential calculation

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.