Consider the electrolysis reactionscathode Cu²+ (aq, 0.253 M) + 2e = Cu(s)anodeH₂O(1)whose standard reduction potentials can be found in this table.Calculate the voltage needed to drive the net reaction if the current is negligible.Ecell =-0.858Ecell =1O₂(g, 1 bar) + 2 H+ (aq, 0.202 M) + 2 e¯2The cell has a resistance of 57.0 2 and a current of 4.73 mA when the cathode overpotential is 0.232 V and the anodeoverpotential is 0.054 V. Calculate the voltage needed to overcome these effects and drive the net reaction.IncorrectVV

According to the reaction,The reaction at the cathode can be written as,The reaction at the anode…

Consider the electrolysis reactions cathode anode H₂O(1) whose standard reduction potentials can be found in this table. Calculate the voltage needed to drive the net reaction if the current is negligible. Ecell = Cu²+ (aq, 0.253 M) + 2e = Cu(s) 1 O₂(g, 1 bar) + 2 H+ (aq, 0.202 M) + 2 e¯ 2 -0.858 The cell has a resistance of 57.0 2 and a current of 4.73 mA when the cathode overpotential is 0.232 V and overpotential is 0.054 V. Calculate the voltage needed to overcome these effects and drive the net reaction.

Consider the electrolysis reactions cathode anode H₂O(1) whose standard reduction potentials can be found in this table. Calculate the voltage needed to drive the net reaction if the current is negligible. Ecell = Cu²+ (aq, 0.253 M) + 2e = Cu(s) 1 O₂(g, 1 bar) + 2 H+ (aq, 0.202 M) + 2 e¯ 2 -0.858 The cell has a resistance of 57.0 2 and a current of 4.73 mA when the cathode overpotential is 0.232 V and overpotential is 0.054 V. Calculate the voltage needed to overcome these effects and drive the net reaction.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 38QRT

See similar textbooks

Related questions

Q: Calculate the cell potential for the galvanic cell in which the reaction Al(s) + Au³+ (aq)= Al3+(aq)…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ 3+ 3 Cu²+…

A: we have to calculate the cell potential

Q: Calculate the standard free-energy change for the reaction at 25 °C. Refer to the list of standard…

Q: Calculate the standard potential, E°, for this reaction from its equilibrium constant at 298 K. X(s)…

Q: Calculate the cell potential for the galvanic cell in which the reaction Fe(s) + Au³*(aq) = Fe*(aq)…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: MnO, (s) +…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2 MnO4 (aq)…

Q: Silver can be electroplated at the cathode of an electrolysis cell according to the following…

A: Given information:Current (I) = 6.4 ATime (t) = 69 minutes

Q: 2(g) |H '(aq) || Pb<'(aq) | PBS04(s) | Pb(s) he following standard reduction potentials. q) + 2 e¯ ®…

A: Cell equation, Sn2+ + Cu2+ ---> Sn4+ + Cu Cell potential is affected by concentration. As the…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: [Co2+]=0.00190 M[Au3+]=0.896 MT=25oC=25+273=298K

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ 2103 (aq)…

Q: A certain half-reaction has a standard reduction potential Ered = +1.25 V. An engineer proposes…

A: Oxidation is defined as increase in oxidation state of the element.It can also be defined as…

Q: Select the pair of products formed in the electrolysis of a solution of ZrCl4(aq) using inert…

A: The objective of the question is to find the pair of products formed in the electrolysis of a…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2103 (aq)…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: Answer :----- Given :---- [Cd2+ ] = 0.00100 M[Au3+ ] = 0.784 MThe overall balanced reaction are…

Q: The equilibrium constant, K. for a redox reaction is related to the standard cell potential, E by…

A: Part (A) : Temperature , T =25°C=(25+273)K=298 K Given reaction is : Fe(s) + Ni2+ (aq) →Fe2+ (aq) +…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3+ 2+ 2 Cr³+…

A: In an electrochemical cell, the chemical energy due to the chemical reactions is converted into…

Q: Calculate the maximum work available (in kJ) from 52.3 g of aluminum in the following cell when the…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ 3 Cu²+…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3Cu**…

Q: Calculate the standard Gibbs free energy change, AGº, in kJ for the following reaction occurring in…

Q: The corrosion of iron is an electrochemical process that involves the standard reduction potentials…

A: given data are- Fe(s) ⟶ Fe2+(aq) + 2e-Eo = -0.44 V O2(g) + 4H+(aq) + 4e- ⟶ 2H2O(l) Eo = 1.23 V…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: Cu²+ (aq) +…

Q: The following galvanic cell has 8° = +1.887 V at 25°C: Co(s) | Co2+ (aq) || Ce4+ (aq), Ce3+ (aq) |…

A: The solution is as follows:

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2 Cr³+ (aq)…

A: The question is based on the concept of electrochemistry. we need to calculate cell potential of the…

Q: Calculate the cell potential for the reaction as written at 25.00 °C, given that [Cr²+] = 0.831 M…

Q: Calculate the cell potential for the reaction as written at 25.00 °C, given that [Mg² +] = 0.755 M…

A: Given,

Q: In the electrolysis of an acid solution, oxygen can be produced by the following half-reaction:…

Q: Calculate the cell potential for the galvanic cell in which the reaction Fe(s) + Au³+(aq) =…

Q: An electrochemical cell is made by placing an iron electrode in 1.00 L of 0.19 M FeSO4 solution and…

A: In the field of science, An electrochemical cell is a source of…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3+ 2Cr³+…

A: Answer:Galvanic cell is a type of electrochemical cell that converts chemical energy into electrical…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: Sn n²* (aq)…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

Consider the electrolysis reactions
cathode Cu²+ (aq, 0.253 M) + 2e = Cu(s)
anode
H₂O(1)
whose standard reduction potentials can be found in this table.
Calculate the voltage needed to drive the net reaction if the current is negligible.
Ecell =
-0.858
Ecell =
1
O₂(g, 1 bar) + 2 H+ (aq, 0.202 M) + 2 e¯
2
The cell has a resistance of 57.0 2 and a current of 4.73 mA when the cathode overpotential is 0.232 V and the anode
overpotential is 0.054 V. Calculate the voltage needed to overcome these effects and drive the net reaction.
Incorrect
V
V

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Introduction

Step 2: Calculation

Step 3: Calculation

Step 4: Calculation

Solution

Step by step

Solved in 5 steps with 9 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
Consider the following cell reaction at 25C. 2Cr(s)+3Fe2+(aq)2Cr3+(aq)+3Fe(s) Calculate the standard cell potential of this cell from the standard electrode potentials, and from this obtain G for the cell reaction. Use data in Appendix C to calculate H; note that Cr(H2O)63+(aq) equals Cr3+(aq). Use these values of H and G to obtain S for the cell reaction.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)