The red color of ruby is due to the presence of Cr(III) ions at octahedral sites in the close-packed oxide lattice of Al2O3. Draw the crystal-field splitting diagram for Cr(III) in this environment. Suppose that the ruby crystal is subjected to high pressure. What do you predict for the variation in the wavelength of absorption of the ruby as a function of pressure? Explain.

Q: Using crystal field theory, draw an electron box energy level diagram for the valence d orbitals on…

A:

Q: (a) Consider the following two Fe complex ions: Complex A - [Fe(H2O)3(OH)3]  and  Complex B…

A: (i) The d-electronic configuration of A and B are given below: For    , the oxidation state of Iron…

Q: Name and draw the structure of the metal complex formed when using copper(II) chloride dihydrate…

A:

Q: Indicate which of the following Ti3+ compounds exhibits the wavelength absorption shortest wave in…

A:

Q: a) Is the coordination compound [Co(NH3)6]Cl2 diamagnetic or paramagnetic? Explain in detail…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Determine the charge of the metal center in tetraamminedichloroiron, [Fe(NH3)4Cl2] a. draw the…

A:

Q: Draw energy level diagrams of the crystal field and show the filling of d electrons for each of the…

A:

Q: In acidic aqueous solution, the purple complex ion Co(NH3)5Br2+  undergoes a slow reaction in which…

A: Given,Initial concentration of Co(NH3)5 Br2+ = 0.100 Mrate constant = 6.3×10−6 s-1the molarity of…

Q: Many transition metals and their compounds are used as catalysts. Given MnO2, FeCl3, Pt, and Ni,…

A: Catalyst are the compounds that lowers the activation energy of reaction to increase the rate of the…

Q: Using crystal field theory, draw an electron box energy level diagram for the valence d orbitals on…

A: Answer:Create an energy level diagram for the valence d orbitals on the manganese atom in  complex…

Q: The energies of the valence d orbitals on the iron atom in the octahedral [Fe(CN),] complex are…

A: Given,The coordination complex:[ Fe(CN)6 ] 4-

Q: Platinum(IV) is readily complexed by ethylenediamine. Draw the structuresof both enantiomers of the…

A: Ethylenediamine (en) is a bidentate chelating ligand in coordination compounds with the two donor…

Q: structure of chelate when the polydentate ligand, ethylenediaminetetraacetate ion (EDTA 4 ) is…

A:

Q: 3. Consider the blue-colored compound, [Cr(H₂O)]3³ and the yellow-colored compound, [Cr(CN)6]³.…

A: The given questions can be explained as:

Q: The energies of the valence d orbitals on the iron atom in the octahedral (Note: the d orbitals are…

A: l

Q: (a) Predict whether the glycinate ion, H2N-CH COO is a monodentate, bidentate, or tridentate ligand:…

A: a. Bidentate ligands are Lewis bases that donate two pairs of electrons to a metal atom.   It is a…

Q: Consider the coordination compound [Ni(OH₂)6] Br4. If you find, experimentally, that the compound is…

A: Strong field ligands are that produce large splittings between the d orbitals and form low spin…

Q: Determine the oxidation state of the metal ion in [Co(NH3)5Br]2+ Determine the coordination number…

A: To determine the oxidation state and coordination number of the given complexes. Answering the first…

Q: (a) Draw a Lewis dot and cross structure (including any lone pairs) for a NBr3 molecule and…

A:

Q: A manganese complex formed from a solution containing potassium bromide and oxalate ion is purified…

A:

Q: Which of the following statements best explains why the titanium complex, [Ti(H₂O)6]4+, is…

A: Given : We have to explain why [Ti(H2O)6]4+ is colorless.

Q: The crystal field splitting Δoct is equal to 3.50×10−19J. What is the wavelength of light that this…

A:

Q: Consider the following complexes: [FeCl6]3- and [Fe(CN)6]3-, which possess very different magnetic…

A:

Q: Consider the oxalate (ox) ligand and answer the following questions: (i) Draw the structure of the…

A: Denticity: The number of donor atoms of a ligand that bite the metal atom is called the denticity of…

Q: Draw a crystal field splitting diagram for each complex a. [Fe(ox)3] ^3–  b.  [Cu(ox)2] ^2– Hint…

A:

Q: A coordination compound has been determined to be composed of 18.4% Co, 26.6% NH3, 30.0% SO4 , and…

A: A co-ordination compound is a compound containing a central metal atom bound to ligands. The central…

Q: How many cubic feet of air at a pressure of 760 torr and 0 °C is required per ton of Fe2O3 to…

A:

Q: Given the compound: [Co(en)2(OH)2]OH, what is the denticity of the ligands (en) and OH,…

A: In a complex compound, the central metal atom or ion acts as a Lewis acid and the ligand acts as a…

Q: are present on each of the transition metal ions in the complexes shown

A: Given complex is, [Nb(NH3)2(H2O)4]+2 Here, both the ligands (NH3 & H2O) are neutral.  Atomic no.…

Q: The octahedral structure is not the only possible six-coordinate structure. Other possibilities…

A: There are only 2 isomer for this compound, [Co(NH3)4Cl2]+ ;cis and trans.

Q: Some octahedral complexes have distorted shapes. Insome, two metal-ligand bonds that are 180° apart…

A: The structure of CuNH362+ is as follows:

Q: You have mixed up two solutions. One is a solution of M(H₂O)62+ and the other is M(en)3²+. One is…

A: We know the complex which is having more splitting of d-orbital will absorbed more energy light. So…

Q: Write the formula and draw the structure of each of these two isomers for the…

A: Isomerism: Two chemical compounds are said to be isomers if they have same number and kind of atoms…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: In coordination compounds, metal shows different linkages, primary and secondary. The primary…