Given the compound: [Co(en)2(OH)2]OH, what is the denticity of the ligands (en) and OH, respectively? monodentate, bidentate bidentate, monodentate bidentate, bidentate monodentate, monodentate

Q: Co(OH2)4Cl2] Br  can exhibit both ion-ion isomerism and hydrate isomerism. True OR False

A: Given,  Co(OH2)4Cl2] Br  can exhibit both ion-ion isomerism and hydrate isomerism. The statement is:

Q: Suppose that the complex ion [Co(NH3)2(OH2)2Cl2]+ is synthesized with the two ammine ligands cis to…

A:

Q: The complex [Mn(H2O)6]2+ has five unpaired electrons, whereas [Mn(CN)6]4- has only one. Using the…

A: According crystal field theory, when transition metals are bonded to any ligand, their d orbitals…

Q: [Cu (NH3) 4] SO4.H2O Describe the geometric structure of the compound with VBT by writing the…

A: Using concept of VBT to determine the geometry of co ordination compounds.

Q: How many (valence) d orbital electrons are present on each of the transition metal ions in the…

A: d orbital's electron count can be evaluated by knowing the correct oxidation state of central atom…

Q: Give evidence that [Co(NH3)5Cl]SO4 and [Co(NH3)5SO4]Cl are ionization isomers. (ii). Calculate…

A: Isomers are those compounds which have same chemical formula but they are different from each other.…

Q: A d' octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

A:

Q: For the complex [Pd(NO)4]Br4, assume NO is a strong ligand, then which statement is true The complex…

A: According to the crystal field theory the ligand atom acts as point negative change and the metal…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which there is a metal ion that forms coordinate bonds with…

Q: The complex ion [Mo(SCN)4]2− is paramagnetic. Fill in the next question according to Crystal Field…

A: Crystal Field Theory (CFT) is a model used to explain the electronic structure and properties of…

Q: The octahedral complex ions [FeCl6]3- and [Fe(CN)6]3- are both paramagnetic, but the former is high…

A: Both the octahedral complex ions [FeCl6]3- and [Fe(CN)63- have Fe in +3 oxidation state. The number…

Q: For each of the following pairs of complex ions, identify which has a high spin or low spin. Explain…

A: 3)acomplex is high spin or low spin it determines by its ligend & chrage on metal ion

Q: How would you draw the isomer structure(s) for [Fe(C2O4)2(H2O)2] 0

A: Since, Isomer are those whose molecular formula same but structural formula is different. Thus,

Q: Which of the following pairs are not structural isomers? a) [Co(NO2)(NH3)5]2+     [Co(ONO)(NH3)5]2+…

A:

Q: complex [Fe(H2O)6]+2

A: The theory which shows the orbital arrangement, bonding and the characteristics of coordination…

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.