The reaction of carbon monoxide(g) with nitrogen monoxide(g) to form carbondioxide(g) and nitrogen(g) proceeds as follows:2CO(g) + 2NO(g) 2CO2(g) + N2(g)When 8.52 g CO(g) reacts with sufficient NO(g), 114 kJ is evolved.Calculate the value of A,H (kJ/mol) for the chemical equation given.

Answered: Image /qna-images/answer/5fd8c25b-d2b4-424b-8d06-9a37d7aef2dc.jpg

The reaction of carbon monoxide(g) with nitrogen monoxide(g) to form carbon dioxide(g) and nitrogen(g) proceeds as follows: 2C0(g) + 2NO(g) 2CO2(g) + N2(g) When 8.52 g CO(g) reacts with sufficient NO(g), 114 kJ is evolved. Çalculate the value of A,H (kJ/mol) for the chemical equation given.

The reaction of carbon monoxide(g) with nitrogen monoxide(g) to form carbon dioxide(g) and nitrogen(g) proceeds as follows: 2C0(g) + 2NO(g) 2CO2(g) + N2(g) When 8.52 g CO(g) reacts with sufficient NO(g), 114 kJ is evolved. Çalculate the value of A,H (kJ/mol) for the chemical equation given.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: The reaction of hydrogen chloride (g) with oxygen (g) to form water(g) and chlorine(g) proceeds as…

A: The given chemical reaction is- 4HCl(g)+O2(g)→2H2O(g)+2Cl2(g) The heat evolved is 10.4 kJ The mass…

Q: The compound, diborane is used as rocket fuel. The equation for the combustion of diborane is shown…

A: B2H6(g) + 3O2(g) ---> B2O3(s) + 3H2O(l) ∆H = ?Calculate the enthalpy of combustion of diborane…

Q: Find the molar enthalpy in kJ per mol of H2 of the reaction: H2(g) + Cl2(g) → 2 HCl(g) given that…

A: Given reaction; H2(g) + Cl2(g) → 2 HCl(g) Given amount of water m = 481 g Heat capacity of water c =…

Q: VI. VII. Use the standard reaction enthalpies given below to determine AH°rxn for the following…

Q: The reaction of hydrogen chloride (g) with oxygen (g) to form water (g) and chlorine(g) proceeds as…

Q: Calculate the AH for the reaction: C2H4 (g) + H2 (g) - --> C2H6 (g), from the following data: C2H4…

Q: What is the change in enthalpy in kilojoules when 3.24 g of CH:OH gas is completely reacted…

A: We have to find change in Enthapy. Chemical Reaction equation :- 2 CH3OH (g) ----> 2 CH3OH (g) +…

Q: Using the provided table, determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO₂ (g)→…

A: Determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO₂ (g)→ 2 CO (g)

Q: The reaction of hydrogen sulfide(g) with oxygen(g) to form water(g) and sulfur dioxide(g) proceeds…

A: Answer: In this question enthalpy of the given balanced reaction in which combustion of 2 mole H2S…

Q: A scientist measures the standard enthalpy change for the following reaction to be -29.5 kJ: I2(g)…

Q: 1) Use the standard reaction enthalpies given below to determine AH'rxn for the following reaction 4…

Q: The reaction of hydrogen(g) with oxygen(g) to form water(g) proceeds as follows: 2H2(g) +…

Q: When glucose is metabolized in the body, the reaction it undergoes is represented by the following…

Q: Consider the balanced reaction 3 A + 7 B -→ 8 C + 6 D and the enthalpies of formation provided in…

Q: How much heat is produced by the complete reaction of 3.43 kg of nitromethane? Express your answer…

Q: C8H18 (l) + 25 O2 (g) à 16 CO2 (g) + 18 H2O (l) ΔHo = -10,992 kJ Write a…

A: The question is based on the concept of chemical thermodynamics. we have to write thermochemical…

Q: The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate…

A: Here we are required to find the Enthalpy change for the reaction.

Q: Consider the combustion of liquid CsHs in oxygen gas to produce carbon dioxide gas and water vapor.…

A: Balanced chemical equation :C5H8l + 7O2g → 5CO2g + 4H2Og∆H = -3068 kJmolCompound ∆H°f…

Q: Using the provided table, determine the enthalpy (in kJ/mol) for the reaction C:H³ (g) + 5 O2 (g) →…

A: The standard enthalpy of a reaction (ΔrHo) is the enthalpy change accompanying a given reaction when…

Q: An electron in an abm is hnow n to be in a stale m, -0. What 1s the with magnetic quantum number m,…

A: Dear student, There are more than one question are asked with are independent of each other. Since…

Q: 3) Given the reactions: CO2(g) → C + O2(g) AH =393 KJ S(s) + O2(g) → SO2(g) AH =-296.4 KJ CS2 (1) +…

Q: What is the standard enthalpy (in KJ) of formation for this reaction: Hint: balance the reaction…

A: Standard enthalpy of reaction is calculated as follows:

Q: The reaction of nitrogen monoxide(g) with oxygen(g) to form nitrogen dioxide(g) proceeds as follows:…

Q: The combustion of pentane, C; H12, occurs via the reaction C;H12 (g) + 802 (g)→5CO2(g) + 6H20(g)…

A: Heat of reaction or enthalpy of reaction is the heat content of the reaction. It is calculated as…

Q: When 1 mole of H₂CO(g) reacts with O₂(g) to form CO₂(g) and H₂O(1) according to the following…

A: Given, Number of moles of H2CO = 1 mole Amount of heat evolved = 563 KJ Equation is : H2CO (g)…

Q: The reaction of sodium(s) with water(1) to form sodium hydroxide(aq) and hydrogen(g) proceeds as…

Q: Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is…

A: In order to determine the final temperature of the calorimeter, the concept of the bomb calorimeter…

Q: The enthalpy of reaction is -11.7 kJ/mol for the following reaction: HCN(aq) + NaOH(aq) -->…

Q: How much heat is produced by the complete reaction of 3.46 kgkg of nitromethane?

Q: The reaction of carbon monoxide(g) with oxygen(g) to form carbon dioxide(g) proceeds as follows:…

A: The balanced reaction taking place is given as, => 2 CO (g) + O2 (g) ----> 2 CO2 (g)…

Q: The combustion of butane is shown by the following equation: 2C,H10(1) + 130½(g) → 8CO2(g) +…

A: Consider the given equation for which we have to calculate the value of heat of combustion is as…

Q: You mix 125 mL of 0.270 M CsOH with 50.0 mL of 0.675 M HF in a coffee-cup calorimeter, and the…

A: Given: 125 ml of 0.270 M CsOH 50 ml of 0.675 M HF Temperature T1 = 22.30 +273 = 295.3 K T2 = 25.42 +…

Q: The enthalpy of reaction is -11.7 kJ/mol for the following reaction: HCN(aq) + NaOH(aq) -->…

A: Given : Mass of HCN = 0.899 g Enthalpy of reaction = -11.7 KJ/mol Total Mass in the calorimeter =…

Q: A scientist measures the standard enthalpy change for the following reaction to be 36.8 kJ: CO₂(g) +…

Q: Canada is the world's eighth largest producer of iron ore. The smelting of iron ore involves many…

Q: Calculate the quantity of energy transferred (q), in kJ, by the combustion of 177 mL of acetone…

Q: A scientist measures the standard enthalpy change for the following reaction to be -57.0 kJ:…

A: Given balanced chemical equation, Ca(OH)2(aq) + 2 HCl(aq) → CaCl2(s) + 2 H2O(l) The enthalpy change…

Question

The reaction of carbon monoxide(g) with nitrogen monoxide(g) to form carbon
dioxide(g) and nitrogen(g) proceeds as follows:
2CO(g) + 2NO(g) 2CO2(g) + N2(g)
When 8.52 g CO(g) reacts with sufficient NO(g), 114 kJ is evolved.
Calculate the value of A,H (kJ/mol) for the chemical equation given.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A scientist measures the standard enthalpy change for the following reaction to be 6.7 kJ : CO(g) + H,O(1)–CO;{g) + H2(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of CO(g) is kJ/mol.
[References] The reusable booster rockets of the space shuttle use a mixture of aluminum and ammonium perchlorate as fuel. A possible reaction is 3A1(s) +3NH,CIo,(s) → Al,0,(s) + AlCls (s) + 3NO(g) + 6H2O(g) Calculate AH for this reaction. Substance and State AH; (kJ/mol) Al(s) Al2O3 (s) AICI3 (s) H20(g) NO(g) NH CIO.(s) -1676 -704 -242 90. -295 AH: kJ Submit Answer Try Another Version 1 item attempt remaining Prev
Use the standard reaction enthalpies given below to determine Hᵒrxn for the following reaction: Given: 2 NO(g) + O2(g) → 2 NO2(g) N2(g) + O2(g) → 2 NO(g) 1/2N2(g) + O2(g) → NO2(g) -150. KJ -117 kJ -333 kJ +115 kJ +238 kJ AH°, rxn AHᵒr = ? rxn +183 kJ AH°rxn = +33 kJ
A scientist measures the standard enthalpy change for the following reaction to be -572.6 kJ:H2CO(g) + O2(g)CO2(g) + H2O(l)Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of H2O(l) is?
Hydrogen cyanide is used in the manufacture of clear plastic such as plexiglas. it is prepared from ammonia and methane according to the following reaction. calculate the value of q(KJ) if 9.436 g of ammonia react with excess oxygen and methane.
THERMODYNAMICS: A 1.09 g sample of acetic acid (HC2H2O2) was burned in excess oxygen in a bomb calorimeter. The calorimeter, which alone had a heat capacity of 2.67 KJ°C. contained 7g of water. The temperature of the calorimeter and its contents increased from 24.13°C to 27.95°C. What is AH (in kJ) for the combustion per 1.00 mol of acetic acid? MW of acetic acid is 60 gimol. (Round off the final answer to ONE decimal place. Do not include the unit.)
Using the provided table, determine the enthalpy for the reaction C3H8 (g) + 5 O2 (g) → 3 CO2 (g) + 4 H2O (g) Substance AH¡ (kJ/mol) C3H® (g) -108.4 O2 (g) CO2 (g) -393.5 H2O (g) -241.8
A bomb calorimeter can be used to measure the enthalpy of reaction for combustions, such as the combustion of diborane represented by the following balanced equation: B2H6(g)+3O2(g)=B2O3(s)+3H2O(g)ΔHcombustion for this process is –1958 kJ/mol. Assume that 0.411 g of diborane is combusted in a calorimeter whose heat capacity (Ccalorimeter) is 7.854 kJ/°C at 22.61°C. What is the final temperature of the calorimeter?
According to the reaction below what is the value of KKJ for the complete combustion of 1.00 g of CH4g?
A scientist measures the standard enthalpy change for the following reaction to be -679.7 kJ : 2NH3(g) + 2 02(g)N20(g) + 3 H2O(1) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of N20(g) is |kJ/mol.