The reaction8 CO2(g) + 10 H20(g)2 C4H10(g) + 13 O2(g) –has AG° = -5407 kJ. Determine the value of AG°f for C4H10(g).Standard Free Energies of Formation of Typical SubstancesTABLE 18.2 at 298.15 KSubstanceSubstanceSubstanceAG?AG?(kJ mol-1)AG?(kJ mol-1)(kJ mol-1)Ag(e)CaO()-604.2K,SO,G)-1316.4Ca(OH),()-896.76 N,(g)NH3(g)NH,CI()AgCI()-109.7Al()0.00CaSO,)-1320.3-16.7Al,O,6)CASO, H,0G)CaSO,2H,06)-1576.4-1435.2- 203.9C() (graphite)CO()NO(g)NO,(g)-1795.7+ 86.69-137.3+51.84CO,(g)CH()-394.4Fe(s)N,0()+103.6Fe,O,6)H,(g)H,0(g)-50.79-741.0+98.28CH,A)CH,OH(/)-58.6Na(s)-166.2-228.6Na,CO,()-1048CO(NH)2()-197.2H,O(1)-237.2NaHCO,()-851.9CO(NH,),(aq)-203.8-95.27NaCI()-384.0HNO,()CH,(gCH.(gCH(+209-79.91NaOH()-382+68.12H,SO,(!)-689.9Na,SO,(s)-1266.8-32.9HC,H,O,(/)-392.5CH,OH(/)PbO()Hg(/)Hg(g)-174.8-189.3CH1,(/)+17.3+31.8S()Cal)SO.)-300.4

Answered: Image /qna-images/answer/ba86369b-31aa-4d36-8b0e-8c4323a064b2.jpg

Answered: The reaction 2 C4H10(g) + 13 O2(g) has…

Science

Chemistry

The reaction 2 C4H10(g) + 13 O2(g) has AG° = -5407 kJ. Determine the value of AG°; for C4H10(g). 8 CO2(g) + 10 H20(g)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Without doing any calculations, match the following thermodynamic properties with their appropriate numerical sign for the following exothermic reaction. C,H4(g) + H20(g) →CH3CH,OH(g) Clear All > 0 AHrxn 0 low T, 0 high T Previous Next
Consider the reaction: N2(g) + 3 F2(g) –→ 2 NF3(g) AH° = -249 kJ and AS° = -278 J/K at 25°C Calculate AG° and state whether the reaction is reactant favored or product favored at standard conditions. AG° = -166 kJ; the equilibrium composition should favor reactants. AG° = -332 kJ; the equilibrium composition should favor reactants. AG° = -332 kJ; the equilibrium composition should favor products. None of these AG° = -166 kJ; the equilibrium composition should favor products.
For a particular reaction at 150.5 °C, AG = –392.62 kJ/mol, and AS = 692.39 J/(mol · K). Calculate AG for this reaction at -0.4 °C. - AG = kJ/mol 80 DII DD F3 F4 F7 FB F9 F10 F12 %24 & 4. 5 6 7 8 Y U H K F.
Given the following equation, N20(g) + NO28) → 3 NO(g) AG°rxn = -23.0 kJ Calculate AG° rxn for the following reaction. 3N20(g) + 3NO2(g) 9 NO(g) -23.0 kJ 69.0 kJ -69.0 kJ -7.67 kJ 23.0 kJ
please answer all the questions given in the picture.
18,19 plz
A chemical engineer is studying the two reactions shown in the table below. In each case, he fills a reaction vessel with some mixture of the reactants and products at a constant temperature of 74.0 °C and constant total pressure. Then, he measures the reaction enthalpy AH and reaction entropy AS of the first reaction, and the reaction enthalpy AH and reaction free energy AG of the second reaction. The results of his measurements are shown in the table. Complete the table. That is, calculate AG for the first reaction and AS for the second. (Round your answer to zero decimal places.) Then, decide whether, under the conditions the engineer has set up, the reaction is spontaneous, the reverse reaction is spontaneous, or neither forward nor reverse reaction is spontaneous because the system is at equilibrium. AH = 181. kJ AS = -499. K ? 2NO(g) N, (g) + 0, (g) AG = kJ Which is spontaneous? this reaction the reverse reaction neither
Given the information below: 3M(g) = K.=6.88 × 10~3 27(g) 2Z(g) = 3Q(g)+6X(g) K,=3.12 × 102
2. For the following reaction at 25°C, AG° is -118.4 kJ. At what pressure of O2 gas does AG = 0 at 25°C? 2 KCIO3 (s) + 2 KCI (s) + 3 O2 (g)
The value of AH° for the reaction below is -336 kJ. Calculate the heat (kJ) released to the surroundings when 23.0 g of HCl is formed. 26. CH4 (g) + 3Cl, (g) → CHC1; (1) + 3HC1 (g) A) B) C) 211 177 70.7 D) -336