The following problem requires TWO reaction steps in a row. 1. Starting with the given substrate and conducting the first reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the MAJOR substrate product of the first reaction. 2. THEN, use the major substrate product of reaction step 1 as the substrate of reaction step 2. Conducting the second reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the FINAL MAJOR substrate product after reaction step 2 is complete. Start with the condensed structural formula CH2=CH-CH2-CH(CH3)-C(CH3)3
The following problem requires TWO reaction steps in a row.
1. Starting with the given substrate and conducting the first reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the MAJOR substrate product of the first reaction.
2. THEN, use the major substrate product of reaction step 1 as the substrate of reaction step 2. Conducting the second reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the FINAL MAJOR substrate product after reaction step 2 is complete.
Start with the condensed structural formula
CH2=CH-CH2-CH(CH3)-C(CH3)3
and react it first with H2O in the presence of H2SO4 (as the catalyst), to produce a major substrate product. Then, take that major substrate product, and use it as the substrate of the next reaction, by reacting it with K2Cr2O7 and H2SO4, to produce the FINAL MAJOR substrate product.
The complete correct condensed structural formula for the major substrate product (after reaction step 1) is ________.
The complete correct condensed structural formula for the final major substrate product (after reaction step 2) is ________.

Step by step
Solved in 3 steps with 3 images









