ted Use the References to access important values if needed for this question. When the Ag+ concentration is 3.35×104 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 1.770V. What is the Mn2+ concentration 2Ag+(aq) + Mn(s) >2Ag(s) + Mn2+(aq) Answer: M Submit Answer Retry Entire Group 2 more group attempts remaining

ted Use the References to access important values if needed for this question. When the Ag+ concentration is 3.35×104 M, the observed cell potential at 298K for an electrochemical cell with the following reaction is 1.770V. What is the Mn2+ concentration 2Ag+(aq) + Mn(s) >2Ag(s) + Mn2+(aq) Answer: M Submit Answer Retry Entire Group 2 more group attempts remaining

Principles of Instrumental Analysis

7th Edition

ISBN:9781305577213

Author:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Publisher:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Chapter24: Coulometry

Section: Chapter Questions

Problem 24.4QAP: Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose...

See similar textbooks

Similar questions

The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)