Select the Single Replacement Reactions that WILL occurO NaCl + H2 -> HCI + NaO AgNO3 + Ca -> Ca(NO3)2 + AgO Fe + MgSO4 -> FeSO4 + MgO ZnCl2 + Cu -> CuCl2 + Zn Use the given reactions to answer question 4.Zn + Cu(NO3)2 → Zn(NO3)2 + CuZn + Pb(NO3)2 → Zn(NO3)2 + PbZn + NaNO3 → No ReactionPb + Cu(NO3)2 → Pb(NO3)2 + CuWhich of these ranks the metals from most reactive to least reactive?Na - Zn - Cu - PbNa - Zn - Pb - CuZn - Pb - Cu - NaNa - Pb - Zn - Cu

Answer : Option 2 is correct for the first question. Its a single replacment reaction. Since you…

Answered: Select the Single Replacement Reactions…

Select the Single Replacement Reactions that WILL occur NaCl + H2 -> HCI + Na AgNO3 + Ca -> Ca(NO3)2 + Ag Fe + MgSO4 -> FeSO4 + Mg ZnCl2 + Cu -> CuCl2 + Zn

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Cu²+ Ca Cu (s) Ca²+ +

A: Copper is getting reduced

Q: Use standard reduction potentials to calculate the standard free energy change in kJ for the…

A: The relation between the standard reaction free energy (and the standard electrode potential () is…

Q: Balance the redox reaction for this equation: K2Cr207+ H2C204 2H20 →_K[Cr(C204)2(H2O)2] ·…

A: In certain reactions, when a reactant reacts with other reactant and forms product, transfer of…

Q: What type of reaction is Cu + 2AgNO3 --> Cu(NO3)2 + 2Ag ? A) combustion B combination C) single…

Q: Now, Identify which products undergo oxidation or reduction. Solution Reduction Oxidation 2+ Fe + Cu…

Q: For each of the following reactions: Identify the element oxidized/reduced, the oxidizing agent and…

A: Oxidation :- The process of addition of oxygen or removal of hydrogen or increase in oxidation…

Q: The following chemical reaction takes place in aqueous solution: 2FeCl3 (aq) + 3Na2S (aq) → Fe2S3…

A: Molecular equation: 2FeCl3(aq) + 3Na2S(aq) → Fe2S3(s) + 6NaCl(aq)

Q: I Reactions please balance | Fe2+ MnO4!- Mn2+ Fe3+ oxidation, { el-s}: reduction, { el·'s}:

A: since you have posted a multiple question in a single session, we are entitiled to answer first…

Q: [Co(H,O)%]2+(aq) + 4CF(aq) → [CoCl,??-(aq) + 6H,O(I)

A: Given:- The given requilibrium reaction is [Co(H2O)6]2+(aq) + 4Cl-(aq) → [CoCl4]2-(aq) + 6H2O(l)…

Q: What is the oxidation number of Cu in Cu(s)?

A: Given a Cu(s) atom. Calculate the cu (s) oxidation state

Q: What will change the value of Ksp for MgCl₂? Add magnesium ions to the solution. Remove chloride…

Q: Balance the following oxidation - reduction reaction. Identify the oxidizing and the reducing agent.…

A: Oxidation/reducing agent means adding of oxygen and reduction /oxidising agent means removal of…

Q: b1assign oxidation numbers to each of the atoms in the equation and determine if the reaction is…

Q: What is the charge on copper ions in a solution of Cu(NO3)2? O Cu (0) O Cu (+1) O Cu (+2) O Cu (+3)

Q: Find n, the lowest common Cr+3+ Au multiple, for the reaction below. Cr+2+ Au+3

A: The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Q: Use standard reduction potentials to calculate the standard free energy change in kJ for the…

A: The objective of the question is to calculate the standard free energy change for the given reaction…

Q: d How many electrons must be added to the left side to balance charge? e 2+ Cu + e → Cu

A: The objective of this question is to determine the number of electrons needed to balance the charge…

Q: For a particular redox reaction Cr is oxidized to CrO4 and Fe is reduced to Fe Complete and balance…

Q: The following reaction is completely carried out in aqueous solution. Is it a redox reaction? Cu +…

A: Please find your solution below : The reaction between Cu and AgNO3 is redox reaction. Oxidation…

Q: In the following reaction, which only goes from left to right, which species is being oxidized?…

A: In the following reaction, which only goes from left to right, which species is being oxidized? 2K…

Q: Determine the Ksp for each solution. Cu(OH)2 Ba(OH)2 Mg(OH)2

Q: Why is this true? When water is added a solid forms: Ag(H2O)2^1+ +Cl^1- —>solid

A: The given reaction is- AgH2O21+ + Cl-1 → AgCls + H2O

Q: Complete the stepwise process of balancing the following reaction in acidic conditions. Cr20;²"(aq)…

A: The unbalanced equation is Cr2O7–2 (aq) + HNO2 (aq) -------> Cr+3 (aq) + NO3– (aq) In this…

Q: Mass of KxFe(C2O4)y · zH2O : 4.70 g Mass of sample : 0.175 g Mass of FeCl3 used in preparation :…

A: Mass of KxFe(C2O4)y · zH2O : 4.70 g Mass of sample : 0.175 g Mass of FeCl3 used in preparation :…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: In the following reaction, what is being reduced and what is being oxidized? CuO (s) + H₂(g) Cu(s) +…

A: Here we have to find out which undergoes oxidation (oxidised) and which undergoes reduction…

Q: 2. Which of these two will have a larger emf under standard conditions and why? CuSO (aq) + Pb(s) →…

A: Given , Reaction : Cu(SO)4(aq) +Pb(s) → PbSO4(s) +Cu(s) (I)Cu(NO3)2(aq)…

Q: Which of the following chemical reactions is an oxidation-reduction reaction? Fe2O3 + 3CO 2Fe +…

A: The given reactions are : Fe2O3 + 3CO 2Fe + 3CO2 MgSO4 + 2KI K2SO4 + MgI2 NaNO3 + KCl KNO3 + NaCl…

Q: Why does Ag+ ions reacts with Cl- ions

A: Le Chatelier's principle :- When a system at equilibrium is subjected to a chane in temperature or…

Q: The concentration of glucose in an aqueous solution can be determined by oxidation with…

A: The method of least squares is used to minimize the error that can occur while plotting a straight…

Q: Describe the reaction Cu(OH)2(s) ->

A: Different type of compounds on thermal decomposition give different products, depending on their…

Q: The substance to be analyzed is white, highly soluble in water salt. A barium chloride or silver…

A: According to the question, we need to identify the substance based on the datasheet.

Q: Use standard reduction potentials to calculate the standard free energy change in kJ for the…

A: The emf of a cell is calculated by subtracting the reduction potential of anode from the reduction…

Q: Balance the reaction of copper plus nitrate to yield copper (II) and nitrogen dioxide. This…

A: We can balance the reaction based on the oxidation states of individual species involved in the…

Q: In the following reaction, which only goes from left to right, which species is the oxidizing agent?…

Q: Identify the oxidized and reduced species, & the oxidizing agent and reducing agent in the following…

A: The three chemical reactions are: 2 Fe(s) + 3 Cl2(s) → 2 FeCl3(s) Mg(s) + 2 H2SO4(aq) → MgSO4(aq) +…

Q: Cu 5) Cu(NO3)2 AGNO, Ag + à +

A: _ AgNO3 + _ Cu -------> _ Cu(NO3)2 + _ Ag

Q: Complete the stepwise process of balancing the following reaction in acidic conditions. Cr₂O₇²⁻(aq)…

A: Steps for balancing redox reactions : 1. Write oxidation and reduction half reaction. 2. Balance…

Q: very useful in identifying unknowns. Unknowr solution #2 is bright blue. Once you have identified…

A: Cu in its +2 oxidation state exhibit blue color in aqueous solution. The reason for this bule color…

Q: what is the oxidation numbers of : cu (s) + hno3(aq) --> cu(no3)2(aq) + 2 no2 (g) in table format

Q: Assign oxidation state: * KMNO4 + Na2C204 + H2SO4 → K2SO4 + NazSO4 + MnSO4 + CO2 + H20

A: Given :- KMnO4 + Na2C2O4 + H2SO4 → K2SO4 + Na2SO4 + MnSO4 + CO2 + H2O To assign : oxidation state…

Q: Some standard electrode potentials include Cut + e- → Cu (s) E° = 0.520 V Cu2+ + e- → Cut Eº = 0.159…

A: Here, reduction potential different redox processes are given and we have to use to establish the…

Q: 2u Cl₂ + 3H₂O + PPh ₂ → Ru (PPh z)z Cz озна тос през balance ++++ + H₂O₁

A: The explanation is given below-

Q: Write balanced net ionic equations for the following reactions. Supply H+ and/or H2O as needed to…

A: The unbalanced chemical reaction given are Cr (s) + Ag+→ Cr3+ + Ag (s) UO22+ + Zn (s) → U4+ + Zn2+

Q: Provide the balanced net ionic equation for the oxidation reduction reaction between Fe2+ and the…

A: Dichromate anion is used for determination of iron in solution. It is a redox indicator and works as…

Q: NiO2 + 2 H2O+ Fe Ni(OH)2 + Fe(OH)2 in basic solution

A: Given, NiO2 + 2H20 + Fe ---------->Ni(OH)2 + Fe(OH)2 b in basic solution

Q: 2. Cu(s) + NO3 → Cu2+ + NO(g) in acidic solution

A: Since, In redox reaction, Oxidation and reduction reaction both takes place simultaneously.

Q: What is the equilibrium constant for the following redox reaction? Cu2+ + 2Li Cu + 2Lit Litte Cu²+ +…

A: Given, Cu2+ + 2 Li ------> Cu + 2Li+ Standard reduction potential are given, Li+ + e- ---> Li…

Question

Select the Single Replacement Reactions that WILL occur
O NaCl + H2 -> HCI + Na
O AgNO3 + Ca -> Ca(NO3)2 + Ag
O Fe + MgSO4 -> FeSO4 + Mg
O ZnCl2 + Cu -> CuCl2 + Zn

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

In each of the following reactions, identify the oxidizing agent and the reducing agent. Mg (s) + 2HCl (aq) ------- H2 (g) + MgCl2 (aq) 2Na (s) + 2H2O (l) --------- 2NaOH (aq) + H2 (g)
Hii! I am having trouble solving this problem: Balance the equation in acidic conditions. Phases are optional. equation: Cu +H^{+} +NO^{3-} Cu^{2+} + NO +H_{2}O
Cu(IO3)2 (s) + 2e- → Cu(s) + 2 IO3-(aq) give the semi-reactions
A quantitative analysis for ethanol, C2H60, is accomplished by a redox back titration. Ethanol is oxidized to acetic acid, C2H402, using excess dichromate, 3+ Cr207 2-, which is reduced to Cr3*. The excess dichromate is titrated with Fe2*, giving C and Fe+ as products. In a typical analysis, a 5.00-mL sample of a brandy is diluted to 500 mL in a volumetric flask. A 10.00-mL sample is taken and the ethanol is removed by distillation and collected in 50.00 mL of an 2- acidified solution of 0.0200 M K2Cr207. Titration of the unreacted Cr207 requires 21.48 mL of 0.1014 M Fe2*. Calculate the %w/v ethanol in the brandy. Which is the titrant in this problem? C2H402 Fe2+ C2H60 O Cr207 2-
Iron was reacted with a solution containing 400 g of copper) sulfate. The reaction was stopped after 1 hourand 151 g of copper was obtained. Calculate the percent yield of copper obtained: Fe(s)+CuSO 4 (aq) ——> Cu(s)+FeSO 4 (aq)
Could you solve this ?
What is the equilibrium constant for the dissolution of copper (II) hydroxide: Cu(OH)₂ (s) Given the standard reduction potentials Cu(OH)₂ (aq) + e- → Cu (s) + OH¯ (aq) Cu²+ (aq) + e¯ →→ Cu (s) O 5.16 x 10^-9 O 1.63 x 10^3 O 1.93 x 10^8 O 6.12 x 10^-4 Cu²+ (aq) + OH¯ (aq) O 2.20 x 10^-20 EO = -0.15 V Eº = +0.34 V
(buffer )Find a buffer to maintain a laboratory system for coagulation at a pH of 5.5. The system uses a ferric chloride coagulant and generates acidity as defined by the reaction in equation (1). If the coagulant dose is 10 mg/L Fe+3 calculate the concentration of the buffer to maintain the pH at a level within 0.2 pH units. FeCl3 + 3 H2O ↔ Fe(OH)3 (s) + 3H+ + 3Cl-
For each of the following reactions, identify: oxidized species reduced species oxidizing agent reducing agent 2 Fe (s) + 3 Cl2 (g) -- 2 FeCl3(s) Mg (s) +2 H2SO4 (aq) -- MgSO4 (aq) + SO2 (g) + 2 H2O (l) 2 Mg (s) + O2 (g) -- 2 MgO (s)
Write short hand notation for each reaction: (a) Fe + Ag+ → Fe2+ + Ag (b) VO2+ + O2 + H2O(l) → VO2+ + H+
MnO4-(aq)>MnO2(s)
What does Mn++ mean in the equation? Is it a typographical error? Kindly explain and balance the equation. Thank you!