Question 17 of 25 Submit Consider the equilibrium system described by the chemical reaction below. A 1.00 L reaction vessel was filled 0.0560 mol Oz and 0.200 mol N2O and allowed to react at 298 K. At equilibrium, there were 0.0200 mol of NO2 present. Determine the concentrations of all species and then calculate the value of Kc for this reaction. 2 N20(g) + 3 O2(g) =4 NO2(g) 1 2 Based on the given values, fill in the ICE table to determine concentrations of all reactants and products. 2 N20(g) + 3 O2(g) = 4 NO2(g) Initial (M) Change (M)

Question 17 of 25 Submit Consider the equilibrium system described by the chemical reaction below. A 1.00 L reaction vessel was filled 0.0560 mol Oz and 0.200 mol N2O and allowed to react at 298 K. At equilibrium, there were 0.0200 mol of NO2 present. Determine the concentrations of all species and then calculate the value of Kc for this reaction. 2 N20(g) + 3 O2(g) =4 NO2(g) 1 2 Based on the given values, fill in the ICE table to determine concentrations of all reactants and products. 2 N20(g) + 3 O2(g) = 4 NO2(g) Initial (M) Change (M)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 112CP: Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were...

See similar textbooks

Similar questions

Consider the decomposition equilibrium for dinitrogen pentoxide: 2N2O5(g)4NO2(g)+O2(g) At a certain temperature and a total pressure of 1.00 atm, the N2O5 is 0.50% decomposed (by moles) at equilibrium. a. If the volume is increased by a factor of 10.0. will the mole percent of N2O5 decomposed at equilibrium be greater than, less than. or equal to 0.50%? Explain your answer. b. Calculate the mole percent of N2O5 that will be decomposed at equilibrium if the volume is increased by a factor of 10.0.
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
A student studies the equilibrium I2(g)2I(g)at a high temperature. She finds that the total pressure at equilibrium is 40% greater than it was originally, when only I2 was present. What is K for this reaction at that temperature?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
The following reaction has KP=4.50105 at 720 K. N2(g)+3H2(g)2NH3 If a reaction vessel is filled with each gas to the partial pressures listed, in which direction will it shift to reach equilibrium? P(NH3)=93atm,P(N2)=48atm, and P(H2)=52
At 2000 K, experiments show that the equilibrium constant for the formation of water is 1.6 1010. 2H2(g) + O2(g) 2H2O(g) Calculate the equilibrium constant at the same temperature for H2(g)+12O2(g) H2O(g)
. Ammonia. a very important industrial chemical. is produced by the direct combination of the following elements under carefully controlled conditions: N2(g)+3H2(g)2NH3(g)Suppose. in an experiment, that the reaction mixture is analyzed after equilibrium is reached, and it is found, at a particular temperature. that [NH3]=0.25M,[H2]=3.4103M, and [N2]=5.3105M. Calculate the value of K at this temperature.
Consider the decomposition of ammonium hydrogen sulfide: NH4HS(s)NH3(g)+H2S(g) In a sealed flask at 25C are 10.0 g of NH4HS, ammonia with a partial pressure of 0.692 atm, and H2S with a partial pressure of 0.0532 atm. When equilibrium is established, it is found that the partial pressure of ammonia has increased by 12.4%. Calculate K for the decomposition of NH4HS at 25C.