Nitrogen oxide and bromine combine to form nitrosyl bromide, NOBr. 2NO(g) + Br2(g) = 2NOBr(g) In a 5.0 liter reactor at equilibrium at a constant temperature, it was determined there was 0.45 mol NO, 0.17 mol Br and 1.32 mol NOBr. What is the value of K c at this temperature? O a. 0.00395 O b. 0.0116 C. 22.7 O d. 86.2 Oe. e. 253

Nitrogen oxide and bromine combine to form nitrosyl bromide, NOBr. 2NO(g) + Br2(g) = 2NOBr(g) In a 5.0 liter reactor at equilibrium at a constant temperature, it was determined there was 0.45 mol NO, 0.17 mol Br and 1.32 mol NOBr. What is the value of K c at this temperature? O a. 0.00395 O b. 0.0116 C. 22.7 O d. 86.2 Oe. e. 253

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 102CP: Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were...

See similar textbooks

Similar questions

Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
Phosgene, COCl2, used in the manufacture of polyurethane plastics, is prepared from CO and Cl2. CO(g)+Cl2(g)COCl2(g) An equilibrium mixture at 395C contains 0.012 mol CO and 0.025 mol Cl2 per liter, as well as COCl2 If Kc at 395C is 1.23 103, what is the concentration of COCl2?
For the reactionH2(g)+I2(g)2HI(g), consider two possibilities: (a) you mix 0.5 mole of each reactant. allow the system to come to equilibrium, and then add another mole of H2 and allow the system to reach equilibrium again. or (b) you mix 1.5 moles of H2 and 0.5 mole of I2 and allow the system to reach equilibrium. Will the final equilibrium mixture be different for the two procedures? Explain.
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?