Nitrogen monoxide and water react to form ammonia and oxygen, like this: 4 NO(g) + 6 H,O(g) → 4 NH3(g) + 50,(g) Also, a chemist finds that at a certain temperature the equilibrium mixture of nitrogen monoxide, water, ammonia, and oxygen has the following composition: compound concentration at equilibrium NO 0.94 M H,O 1.5 M NH3 1.2 M 02 0.90 M Calculate the value of the equilibrium constant K, for this reaction. Round your answer to 2 significant digits.

Nitrogen monoxide and water react to form ammonia and oxygen, like this: 4 NO(g) + 6 H,O(g) → 4 NH3(g) + 50,(g) Also, a chemist finds that at a certain temperature the equilibrium mixture of nitrogen monoxide, water, ammonia, and oxygen has the following composition: compound concentration at equilibrium NO 0.94 M H,O 1.5 M NH3 1.2 M 02 0.90 M Calculate the value of the equilibrium constant K, for this reaction. Round your answer to 2 significant digits.

Introductory Chemistry: A Foundation

8th Edition

ISBN:9781285199030

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter17: Equilibrium

Section: Chapter Questions

Problem 20QAP

See similar textbooks

Similar questions

At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
Methanol, a common laboratory solvent, poses a threat of blindness or death if consumed in sufficient amounts. Once in the body, the substance is oxidized to produce formaldehyde (embalming fluid) and eventually formic acid. Both of these substances are also toxic in varying levels. The equilibrium between methanol and formaldehyde can be described as follows: CH3OH(aq)H2CO(aq)+H2(aq) Assuming the value of K for this reaction is 3.7 1010, what are the equilibrium concentrations of each species if you start with a 1.24 M solution of methanol? What will happen to the concentration of methanol as the formaldehyde is further converted to formic acid?
The equilibrium between nitrogen monoxide, oxygen, and nitrogen dioxide may be expressed in the equation 2NO(g)+O2(g)2NO(g). Write the equilibrium constant expression for this equation. Then express the same equilibrium in at least two other ways, and write the equilibrium constant expression for each. Are the constants numerically equal? Cite some evidence to support your answer. Nitrogen monoxide and oxygen, both colorless gases, react to form reddish-brown nitrogen dioxide.
Equilibrium exists between butane and isobutane when [butane] = 0.020 M and [isobutane] = 0.050 M. An additional 0.0200 mol/L of isobutane is added to the mixture. What are the concentrations of butane and isobutane after equilibrium has again been attained?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?