= Measurement and Matter Distinguishing solid, liquid and gas phases of a pure substance 0/5 Shay There are three sets of sketches below, showing the same pure molecular compound (carbon monoxide, molecular formula CO) at three different temperatures. The sketches are drawn as if a sample of carbon monoxide were under a microscope so powerful that individual atoms could be seen. Only one sketch in each set is correct. Use the slider to choose the correct sketch in each set. You may need the following information: melting point of CO: -205. °C boiling point of CO: -192. °C B (Choose one) (Choose one) (Choose one) -203. °C -172. °C -210. °C C 000

= Measurement and Matter Distinguishing solid, liquid and gas phases of a pure substance 0/5 Shay There are three sets of sketches below, showing the same pure molecular compound (carbon monoxide, molecular formula CO) at three different temperatures. The sketches are drawn as if a sample of carbon monoxide were under a microscope so powerful that individual atoms could be seen. Only one sketch in each set is correct. Use the slider to choose the correct sketch in each set. You may need the following information: melting point of CO: -205. °C boiling point of CO: -192. °C B (Choose one) (Choose one) (Choose one) -203. °C -172. °C -210. °C C 000

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter10: Liquids And Solids

Section: Chapter Questions

Problem 6E: Open the PhET States of Matter Simulation (http://openstaxcollege.org/l/16phetvisual) to answer the...

See similar textbooks

Similar questions

Open the PhET States of Matter Simulation (http://openstaxcollege.org/l/16phetvisual) to answer the following questions: (a) Select the Solid, Liquid, Gas tab. Explore by selecting different substances, heating and cooling the systems, and changing the state. What similarities do you notice between the four substances for each phase (solid, liquid, gas)? What differences do you notice? (b) For each substance, select each of the states and record the given temperatures. How do the given temperatures for each state correlate with the strengths of their intermolecular attractions? Explain. (c) Select the Interaction Potential tab, and use the default neon atoms. Move the Ne atom on the right and observe how the potential energy changes. Select the Total Force button, and move the Ne atom as before. When is the total force on each atom attractive and large enough to matter’? Then select the Component Forces button, and move the Ne atom. When do the attractive (van der Waals) and repulsive (electron overlap) forces balance? How does this relate to the potential energy versus the distance between atoms graph? Explain.
7.The word pour is commonly used in reference to liquids but not to solids or gases. Can you pour a solid or a gas? Why or why not? If either answer is yes, can you give an example?
Which characteristics of a solid, a liquid, and a gas are exhibited by each of the following substances? How would you classify each substance? a. a bowl of pudding b. a bucketful of sand
Do not give handwriting solution.
C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical equation. Identify all of the phases in your answer.
Write a balanced chemical equation for the photosynthesis reaction in which gaseous carbon dioxide and liquid water react in the presence of chlorophyll to produce aqueous glucose (C6H12O6) and oxygen gas. Express your answer as a chemical equation. Identify all of the phases in your answer.
H2(g)+P4(g)→PH3(g)H2(g)+P4(g)→PH3(g) Express your answer as a chemical equation. Identify all of the phases in your answer. Balance each chemical equation.
Al(s) + Cl2 (g)→AlCl3 (s) Express your answer as a chemical equation. Identify all of the phases in your answer.
Enter a balanced equation for the reaction between solid nickel(II) oxide and carbon monoxide gas that produces solid nickel and carbon dioxide gas. Express your answer as a chemical equation. Identify all of the phases in your answer. ΑΣΦ ? xª b b NiO + CO= CO, +Ni JA chemical reaction does not occur for this question. Submit Previous Answers Request Answer X Incorrect; Try Again; 4 attempts remaining 18
A gaseous system A, with an initial temperature T1, is set to interact with a gaseous system B at an initial temperature T2. The molecules of A and B, both monoatomic, can interact with each other through a wall without mixing. It is known that T2 > T1. Considering this situation, answer the following question. Consider the statements below and type the sum of the numbers associated with the correct ones (write only the number): (1) System B necessarily has a higher initial energy than A (2) System A may have a higher initial energy than B (4) the molecules of system B have a greater average kinetic energy than those of system A (8) From a microscopic point of view, there can never be a collision between molecules in which a molecule of system A loses energy to a molecule of system B (16) The system with more molecules necessarily has the lowest energy
Balance the equation N2H4(l)→NH3(g)+N2(g) Express your answer as a chemical equation. Identify all of the phases in your answer
Solve correctly please, with explanation also. Be sure