Kindly complete the following reactions and use IUPAC method to name the products.

Q: Draw structural formulas for the hemiacetal and acetal formed from the  reagents. The stoichiometry…

A: Hemiacetal: Addition of an alcohol to an aldehyde or a ketone which forms hemiacetal.

Q: Which of the following have the correct IUPAC names?

A:

Q: Show reagents and experimental conditions you might use to convert propyne into each product. (Some…

A: Propyne reacts with two moles of hydrogen bromide to form 2,2-dibromopropane. The reaction complete…

Q: What's the IUPAC name for this?

A: The structure given is Hence the longest carbon chain possible in the molecule is 5 member cycle as…

Q: What's the IUPAC for this compound

A: The above projection can be written in structural format as

Q: Provide the proper IUPAC or common name for the following compound.

A: Welcome to bartleby !

Q: What is the systematic IUPAC name for:

A: The IUPAC name of the bicyclic compounds is a little complex and needs to take care of a few things.…

Q: 1. Write in the correct reagents to accomplish these reactions. a) 2-methylcyclohexanol b) benzyl…

A: We have to find out the reagent

Q: N-methylcyclopentylamine 1-cyano-2-isobutylcycloheptane 7-ethyl-5-isopropyl-3-methyldecanoic acid

A:

Q: Write IUPAC name of the major product formed as a result of the reaction indicated .CH3 Pd + H2 ?

A: In this given reaction,  The 1-methylcyclopent-1ene reactant is a starting material or reactant is…

Q: What is the IUPAC name of the ether that has the structure shown?

A: The given compound is,

Q: what is the IUPAC name for this? step by step pls

A: IUPAC stands for International Union of Pure and Applied Chemistry. The IUPAC name for any compound…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Phenol + Br2/H2O

A:

Q: Br2 hv

A: the reactant is . It reacts with bromine in the presence of sunlight to give a brominated product.

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry…

A:

Q: Draw the structure of the major organic product for the following reaction. CH3OH Cl H2SO4

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: How many products including stereoisomers are formed when 2,4-dimethylpentane undergoes…

A: Monochlorination of alkane is the reaction in which one hydrogen atom is substituted by one chlorine…

Q: What are the steps and reagents needed to synthesize this molecule?

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: Give the iupac name for the followings compounds

A: The given compound is numbered as follows, Thu IUPAC name for the given compound is…

Q: 4. C=C 5. C-C-C-C ا ہے آپ c-c-t-c C-C

A: The question is based on the concept of organic synthesis.  we need to synthesize the product using…

Q: Complete the following reaction and write the IUPAC names of the two products. H₂O + NaOH…

A: The alkaline hydrolysis of ethyl acetate is represented by the equation: CH3COOC2H5 + NaOH →…

Q: Provide the proper IUPAC or common name for the following compound.

A: Some basic steps you should follow when writing IUPAC name -  First count number of carbons present…

Q: What is IUPAC name of the given compound? OH

A: The given compound is a cyclic 5-membered compound. The functional group present in the given…

Q: Write the IUPAC name for each unsaturated hydrocarbon.

A: Note: Assigne the numbering starting from the functional group on parent chain. Then write the…