Q: None
A: Convert electron mass to kilograms: The mass is given in grams, but we need it in kilograms for the…
Q: What would the potential of a standard hydrogen electrode (S.H.E.) be under the following…
A: Here's how to find the potential of the SHE under these conditions:Standard Hydrogen Electrode…
Q: What is the solubility of Ra(IO₃)₃ in water? (Ksp of Ra(IO₃)₃ is 1.2 × 10⁻⁹)
A:
Q: Determine the electron geometry, molecular geometry, and idealized bond angles for each molecule. In…
A: Molecular geometry refers to the 3D arrangement (spatial arrangement) of atoms in a molecule…
Q: fecl3+mgo>fe2o3+mgcl2 how many mol of fecl3 will i need to form 16.1g of fe2o3
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: What is the binding energy in kJ/mol nucleons for copper-63? 5.32845x10^10 kJ/mol nucleons 63 1 Cu…
A: Answer 2-)
Q: Help balance.
A:
Q: what products would you expect to obtain ?
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: STEM Workplace Practices
A: Upstream and downstream processing are two crucial steps in the creation of biopharmaceuticals,…
Q: Draw the product (constitutional isomer) that is formed when the reactant shown is treated with an…
A: **In-depth and Organized:** Step 1:Determine the functional group : The functional group in the…
Q: 3.15 mol of an unknown solid is placed into enough water to make 150.0 mL of solution. The…
A: Given: molunk=3.15mol;V=150.0mL;d=1.20g/mL;ΔT=12.41°C;C=4.18J/g°CStep 1: Write the equations we will…
Q: What reagent(s) would you use to effect the following transformation: OH ?
A: First reagent is the normal oxidation of ketone with alkaline KMnO4 to give the carboxylic…
Q: Complete the following reaction: CHO H- OH H H OH + Cu2+ OH CH₂OH
A: This is called Benedict's test which is used to detect reducing sugars.Reducing sugars are…
Q: I really need help on how to solve this problem ! I would appreciate any help :)
A: Step 1:Enthalpy change value for any reaction…
Q: Question 15 Predict the FINAL (?) product (or a mixture of products) for the following synthetic…
A: Step 1: Step 2: Step 3: Step 4:
Q: Draw the product of this reaction. Ignore inorganic byproducts. 1. NaNH2 H Q Problem 9 of 11 Atoms,…
A: Step 1: Step 2:The lone pair of electrons on the nitrogen atom of NaNH2 acts as a base and attacks…
Q: Help answer.
A: Step 1: We know that, ΔG=−RTlnKspThe Ksp for CaF2 is 3.9 × 10-11 at 25 °C. Step 2:…
Q: How many protons are present in Pb-206? How many neutrons are present in 17N? Give text symbol of…
A: Use a periodic table to see the values1. Atomic Number = ProtonsPb atomic number is 82Protons=822.…
Q: 2. A mass balance is being made for a proposed carbothermic reduction process for the zinc calcine.…
A: ZnO+C→Zn+CO ZnSO4+2C→SO2+2CO Fe2O3+C→2FeO+CO PbSO4+2C→Pb+SO2+2CO…
Q: Show the products of the following reactions
A:
Q: Identify the 24-Methylenecholesterol peak of the GC-MS of Burn Morel mushrooms (Tomentosa) and the M…
A: Which appears to be a graph of a mass spectrometry analysis, I cannot identify the…
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: Complete solutions need
A: Given: MnO4(aq)−+C2O4(aq)2−→MnO2(aq)+CO3(aq)2−Step 1: Write the…
Q: Chemistry
A:
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: Drawing Lewis Structures For each molecule, calculate the total number of valence electrons. Then,…
A: In general, we can count the total valence electrons of molecules by getting the summation of the…
Q: A bomb calorimeter, or constant volume calorimeter, is a device often used to determine the heat of…
A: Given:…
Q: is Fe2+(aq) + 2OH−(aq) → Fe(OH)2 (s) an oxidation reduction reaction
A: No, the reaction Fe2+(aq) + 2OH−(aq) → Fe(OH)2 (s) is not an oxidation-reduction reaction. In an…
Q: Please correct answer and don't use hend raiting
A:
Q: 2) Outline a synthesis for each the target molecule shown below given the starting material. Br ZI N…
A: Based on the image you sent, it appears to be a chemistry question about retrosynthesis. The…
Q: None
A:
Q: Determine the kinds of intermolecular forces that are present in each element or compound.A) PH3 B)…
A: Here's the breakdown of intermolecular forces for each molecule:A) PH3:Dispersion forces (London…
Q: Draw the products for the following reactions. Hint: I am asking for ALL products. Br MeOH heat H₂O…
A:
Q: The generic acid HA has a Ka = 3.5 x 10-5. Determine the pH of a solution that is 0.22 M in A- (the…
A: Given: [A−]=0.22M;Ka=3.5x10−5Step 1: Solve for pKb and Kb.…
Q: Question 6 Propose a chemical structure for the name below. Make sure to clearly define the…
A: Thank you.
Q: What is the background on the chemistry of electrophilic aromatic substitution reactions, what is…
A: Electrophilic aromatic substitution (EAS) reactions are a fundamental class of reactions in organic…
Q: Chemistry
A: Step 1: Step 2:Curved arrows in organic chemistry are a visual tool used to depict the movement of…
Q: Please provide a mechanism for both the semicarbazones, and 2,4 dinitrophenylhydrazones reaction.…
A: if any doubt regarding mechanism please let me know I will send again
Q: ;$;$;;$$;;$;$$;$
A: Step 1: Step 2: Step 3: Step 4:
Q: Question 3 Which set of Newman projections represents correct the most stable and the least stable…
A: Step 1: Step 2: Step 3: Step 4:
Q: Part a and b please
A: Step 1: Step 2: Step 3: Step 4:
Q: Consider the following system at equilibrium where AH = 182 kJ and K = 7.00 x 10-5, at 673 K.…
A: First Question.) a.) FALSE. The enthalpy change (ΔH) of the reaction is positive, which indicates…
Q: Use the following information and data to answer the next a through c questions. A student is…
A: Part a) In the above experiment what component of the system is referred to as the stationary…
Q: 3. Predict the types of electronic transitions you would expect in the UV-Vis spectra for the…
A:
Q: How many asymmetric centers are present in the compound shown below? a. 4 Ob 5 Oc 2 d 6 3 (CH3)2 N.…
A:
Q: Consider the following reaction: H₂O: OH + HCI What is the rate-determining step in this reaction?…
A:
Q: 3. Which of the following compounds can exist as cis-trans isomers? Draw each cis-trans pair. a)…
A: In chemistry, alkenes can exist as cis and trans isomers. Shown below are the structures of the…
Q: H₂O N(CH3)2 H₂SO a. Draw the structure of the tetrahedral intermediate INITIALLY-FORMED in the…
A: In case of any doubt please feel free to ask.
Q: Chemistry
A: Step 1:Step 2: Step 3: Step 4:
Q: Draw the major product of this reaction. Ignore inorganic byproducts.
A: Step 1: Step 2: Step 3: Step 4:
Step by step
Solved in 2 steps with 1 images
- Give an IUPAC name for the compound shown below:Provide the IUPAC names for each compound.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Give IUPAC names for the following substances:
- Phenylethanol can be oxidised to phenylethanal or phenylethanoic acid, depending on the reagents used (both the alcohol and the aldehyde are of interest for their antimicrobial properties, while the acid is used to treat type II hyperammonemia): A (a) (b) (c) CoH,CH,CHO phenylethanal B C6H5CH₂CH₂OHC₂H₂CH₂CO₂H phenylethanol Suggest reagents (shown as A and B in the scheme above) that could be used to carry out the oxidation of the alcohol to the aldehyde and the acid, respectively. C6H5CH₂- Suggest two other syntheses of phenylethanoic acid, in each case indicating the starting materials and other reagents required, but not giving details of mechanism. One of your proposed syntheses must start with a compound which only contains seven carbon atoms (the acid product contains eight carbon atoms). phenylethanoic acid Phenylethanal can be converted to a hydrate in the presence of aqueous acid, though the position of equilibrium is very far to the left: H H+/H₂O OH C6H5CH₂-C-H OH Explain why…Give the IUPAC name for the following compound. Be sure to indicate stereochemistry where necessary.Please don't provide handwritten solution
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Name the following ether eithers using IUPAC or common names:
