For the following chemical equilibrium: Zn2*(aq) + 4NH3(aq)Zn(NH3)42*(aq), the equilibrium constant (Kf) was experimentallydetermined to be 2.9 x 10°. If the initial concelèrations of Zn(NO3)2(aq)and NH3(aq) are 0.0125 M and 0.600 M, respectively, what is theequilibrium concentration of Zn2*(aq)?O 7.8 x 10 12 MO 4.7 x 10-11 MO 1.5 x 10-8 MO 2.5 x 109 MO 2.9 x 10° M

Based on the question we have given data as follows -

For the following chemical equilibrium: Zn2*(aq) + 4NH3(aq) Zn(NH3)42*(aq), the equilibrium constant (Kf) was experimentally determined to be 2.9 x 10°. If the initial concelerations of Zn(NO3)2(aq) and NH3(aq) are 0.0125 M and 0.600 M, respectively, what is the equilibrium concentration of Zn2*(aq)? O 7.8 x 10 12 M O 4.7 x 10-11M O 1.5 x 10-8 M O 2.5 x 109 M O 2.9 x 10° M

For the following chemical equilibrium: Zn2(aq) + 4NH3(aq) Zn(NH3)42(aq), the equilibrium constant (Kf) was experimentally determined to be 2.9 x 10°. If the initial concelerations of Zn(NO3)2(aq) and NH3(aq) are 0.0125 M and 0.600 M, respectively, what is the equilibrium concentration of Zn2*(aq)? O 7.8 x 10 12 M O 4.7 x 10-11M O 1.5 x 10-8 M O 2.5 x 109 M O 2.9 x 10° M

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter9: Chemical Reactions

Section: Chapter Questions

Problem 9.76EP: Calculate the value of the equilibrium constant for the reaction N2(g)+2O2(g)2NO2(g) if the...

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Calculate the value of the equilibrium constant for the reaction N2(g)+2O2(g)2NO2(g) if the concentrations of the species at equilibrium are [N2] = 0.0013, [O2] = 0.0024, and [NO2] = 0.00065.
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
Describe a nonchemical system that is not in equilibrium, and explain why equilibrium has not been achieved.
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Write an equation for an equilibrium system that would lead to the following expressions (ac) for K. (a) K=(Pco)2 (PH2)5(PC2H6)(PH2O)2 (b) K=(PNH3)4 (PO2)5(PNO)4 (PH2O)6 (c) K=[ ClO3 ]2 [ Mn2+ ]2(Pcl2)[ MNO4 ]2 [ H+ ]4 ; liquid water is a product
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Use the solubility product constant from Appendix F to determine whether a precipitate will form if 10.0 mL of 1.0 106 M iron(II) chloride is added to 20.0 mL of 3.0 104 M barium hydroxide.
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
Write the expression of the reaction quotient for the ionization of HOCN in water.