Q: Calculate the mixing ratio of O3 in surface air (z=0 km; P = 1000 hPa; T = 300 K). Is it in…
A: Approach to solving the question:.Detailed explanation:.Examples: Key references:
Q: QUESTION 9 Name the functional group based upon the result of each test. A positive Silver Nitrate…
A: 1. Silver Nitrate Test (AgNO₃ Test)Purpose: This test is used to detect alkyl halides, which are…
Q: Energy Electric discharge 546 nm- 436 nm- 404 nm- 579 nm- 366 nm 254 nm- 185 nm- 579 nm 546 nm 436…
A: Mercury is to emit all excess energy at once.This is incorrect because mercury does not emit all…
Q: 7. Structures of benzene and benzyne are shown below. Benzene is highly stable and unreactive.…
A: 7. Benzyne is unstable primarily because it features a triple bond between two carbon atoms, which…
Q: 3. Show the steps necessary, in order, to make each of the following compounds, starting with…
A: Step 1: Step 2:3)c) Step 3: Step 4:
Q: Question 10
A: To find the Ka of the weak acid, we can use the information from the titration. Here's the…
Q: Complete and balance the following precipitation reaction: ___ Fe(NO3)2 (aq) + ___ Na3PO4 (aq)…
A: In a precipitation reaction, two soluble ionic compounds react to form an insoluble compound, which…
Q: The vapor pressure of liquid NH3 is 226.1 mmHg at a temperature of 217.3 K. The enthalpy of…
A: The problem is asking for the vapor pressure of NH3 at a different temperature. We are given the…
Q: 4. Complete the following equations. CH3CH2-NH2 + HCI → CH3COOH + NaOH → CH3CH2Br + AgNO3 →…
A: Step 1: Step 2: Step 3: Step 4:
Q: None
A: Approach to solving the question: Detailed explanation:The average rate of reaction (disappearance…
Q: For each of the species below, identify any cyclic conjugated system, then: A. Determine the number…
A: Step 1: Huckel's Rule states that a compound will display aromaticity if it has the following…
Q: Select all the benzene rings that have deactivating substituents
A: Benzene ring activating and deactivating groups:The rate of electrophilic aromatic substitution…
Q: 3. Predict which test or tests will be positive for each of the compounds listed in the left-hand…
A: Bromination: this test typically detects alkenes and aromatic compounds Tollen: this test is used…
Q: y Bookmarks Window Help achieve.macmillanlearning.com Macmillan Learning +1271 pts /1800 ŕtv Q -> O…
A: This reaction is based on acid - catalyzed hydration of alkene in which water added across the…
Q: We can draw three inequivalent Lewis structures for the tellurite ion, TeO3²- . The concepts of…
A: Assign formal charges to the elements in each of the structures below : ExplanationFormal charge…
Q: Make sure to explain each step and show stoicheomtry if needed
A: Step 1:
Q: We can draw three inequivalent Lewis structures for the selenite ion, SeO3². The concepts of formal…
A: Answer 1- Answer 2
Q: Write the symbol for every chemical element that has atomic number less than 74 and atomic mass…
A: Step 1:
Q: Question 7: 50.0 mL of 0.050 M KOH(aq) is titrated with 0.10 M HCI (aq). Calculate the pH at each…
A: You got your answer wrong because you have provided answer only till 1 decimal place. But in…
Q: Name the organic compounds
A:
Q: 5. Sugar molecules exist in equilibrium between an open chain form and a cyclic hemiacetal form.…
A: Step 1:The some structures of the sugars are provided and these are termed as the Carbohydrates. The…
Q: For each chemical reaction in the table below, decide whether the highlighted reactant is a…
A: Bronsted -Lowry acid is the compound which can donate proton (H+ ion) to another compound. Bronsted…
Q: Write a balanced equation for the reaction of H2SO4 with excess NaOH.
A: This is a neutralization reactionsulfuric acid (H₂SO₄) reacts with sodium hydroxide (NaOH) to…
Q: Macmillan Learning A coulometer's sensitivity is limited by its minimum current being delivered for…
A: For question 1st To determine the number of moles of electrons delivered by the coulometer in 0.18…
Q: Show work with explanation needed. Don't give Ai generated solution
A: Step 1: Step 2: Step 3: Step 4:
Q: 12.31 Draw the condensed structural formulas for the aldehyde and carboxylic acid produced when each…
A: Mild oxidation of primary alcohols gives aldehydes. But aldehydes on further oxidation gives…
Q: PLs help ASAP, pls show all work and steps.
A: Step 1: Step 2: Step 3: Step 4:
Q: Draw the simplest mechanism possible for the reaction below. You may need to re-draw structures to…
A: It is evident from the diagram that the bond between Al and N is broken as AlCl3 is removed. The N…
Q: Consider the molecule SiCl4. The electronegativity values for Si and Cl are 1.8 and 3.0,…
A: The polarity of a bond is determined by the difference in electronegativity between the two atoms…
Q: A metal x is so soft that it can be easily cut with a knife its oxide soluble in water forms…
A: X metal is sodium.Sodium is a soft metal which can be easily cut with a knife.It's oxide which is…
Q: Which of the following pairs of ions represent isoelectronic species? A. Na⁺ and N²⁻ B.…
A: Isoelectronic species are the species which have equal number of electrons. Now to calculate the…
Q: Show work..Give IUPAC name of the given compound. Don't give Ai generated solution
A: Compound Part 2 of 3:Select the longest continuous carbon chain: The longest continuous chain has…
Q: Please correct answer and don't use hand rating
A: Grignard reaction: An alkoxide intermediate is created when the carbonyl group of the aldehyde…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Steps to Solve the Problem:
Q: If Kc = 0.00880 for the reaction below at 298.0 K, then what is the value of Kp? (R = 0.08314…
A: In chemical equilibrium, Kp and Kc are the equilibrium constants in terms of pressure and…
Q: None
A: Given,Let the solubility of ZnC₂O₄ be S, then [Zn2+]=S and [C₂O₄2−]=S. Now,Thus,The solubility of…
Q: 15
A:
Q: You are also given that for the reaction -O 2FeS2 (s) + 1102 (g) → Fe₂O₂ ($) +4502 (g), -> 2 3 P4.22…
A: Step 1:Step 2: Step 3: Step 4:
Q: V [References] Classify the following substituents according to whether they are electron donors or…
A:
Q: None
A: The formula to calculate the ΔH° is: ΔH∘reaction=∑ΔH∘f(products)−∑ΔH∘f(reactants) (a)…
Q: For each of the molecules below, identify whether the alkene has E or Z configuration. Molecule E or…
A: Approach to solving the question: To determine the E/Z configuration of alkenes, we use the rule of…
Q: Show work with explanation needed. don't give Ai generated solution
A: Step 1: ( If you have any questions please feel free to ask me)
Q: help please answer in text form with proper workings and explanation for each and every part and…
A:
Q: Rank the following structures in the order of their acidity (1=most acidic, 4=least cidic) SH OH SH…
A: CH3-CH2-CH2-SH (with three fluorine atoms)The introduction of three fluorine atoms increases the…
Q: Show work. Don't give Ai generated solution
A:
Q: Predict the products of the reaction below. That is, complete the right-hand side of the chemical…
A: The given reaction is between a strong acid (HNO3, nitric acid) and a strong base (NaOH, sodium…
Q: Examine the reaction below. u + OCH3 нь + CH₂OH In the table below, identify the bonds broken and…
A: Step 1:In the above reaction, CH3O- acts as a base that abstracts the proton from the diketone, thus…
Q: Classify the following substitutes according to whether they are electron donors or electron…
A: Step 1: Step 2: Step 3: Step 4:
Q: Copy the kinetic data below (concentration vs time) into a spreadsheet program (Excel or…
A: To determine the order of the reaction based on the data in the table, we can plot the data in…
Q: Please correct answer and don't use hand rating
A: (a) From the graph given, At time t = 0 second, Initial Concentration of [NH4OH] = C1 = 0.14 M For…
Step by step
Solved in 2 steps with 1 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…what are the strcutures for the follwoing a) butyrate reacts with methyl butyrate reacts wuth ethyl butyrate reacts with 1-propyl butyrate reacts with 2-propyl b) hexonoate reacts with methyl hexonate reacts with ethyl hexonante reacts with 1-propyl hexonate reacts with 2-propyl c) benzoate reacts with methyl benzoate reacts with ethyl benzoate reacts with 1-propyl benzoate reacts with 2-propyl d) cinnamate reacts with methyl cinnamate reacts with ethyl cinnamate reacts with 1-propyl cinnamate reacts with 2-propyl
- By simple chemical test, how can you distinguish between: Cyclohexanol and methoxybenzeneDraw the following organic compounds: a) N-ethyl-N-propylhexanamide b) 2,3,6-trichloroheptanol c) 2-methyl-1,4-butanedioic acid d) 1,3-cyclopentadiene e) 2-propoxybutane f) 4-ethyl-3-octanone g) 2,2-dimethylpropanal h) ethyl 2-butylhexanoate i) N-methyl ethanamine j) 4-bromo-2-pentyne k) ethyl phenyl methanoate l) 1-chloro-3-ethyl-2,4-dimethylbenzeneDRAW THE COMPOUNDS WITH THE FOLLOWING IUPAC NAMES...
- what is the product form when 2-pentanone react with CrO3The name of this organic compound. H- CH-COOH O 3,4-diketobutanoic acid 3-oxobutanal 3,4-dioxobutanoic acid 3-oxobutanoic acid The IUPAC name of this compound. OCH, CHO 2-methoxycyclohexanecarbaldehyde cis-6-methoxycyclohexanecarbaldehyde trans-6-methoxycyclohexanecarbaldehyde trans-2-methoxycyclohexanecarbaldehydeThe acid-catalyzed dehydration of 2,3-dimethyl-3-pentanol yields three alkene products. What are the names of the three alkenes? Which of the three alkenes is the major product?
