Consider the reaction 2NO(g) + O2(g) >2NO2(g) Using the standard thermodynamic data in the tables linked above, calculate A Grxn for this reaction at 298.15K if the pressure of each gas is 38.65 mm Hg. ANSWER: kJ/mol

Q: H 6.) H CH3 1. Hg(OAc)2, H₂O FC 2. NaBH4 H a) HOCH2CH2CH3 b) CH3CH(OH)CH3 c) CH2=CHCH3 d)…

A:

Q: None

A: Step 1:   Reactant - 3-methyl cyclohexene            Reagent  - Cl2          Solvent - CCl4 OR CHCl3…

Q: Give detailed Solution with explanation needed. don't use Ai for answering this. Avoid handwritten…

A: Steps to Determine Hybridization1. Identify the Groups Attached to the Carbon Atom:  - Hydrogen: A…

Q: 14-33 Show the structure, including stereochemistry, of the product from the following Diels-Alder…

A: Dienes and Dienophiles:A diene is a molecule with two conjugated double bonds, which means there are…

Q: Does any element with Z ≤ 92 match the description? An element in period 6 and group 6A

A: The question is asking if there is an element with atomic number (Z) less than or equal to 92, that…

Q: In the final reaction of the copper cycle, which experimental error would NOT decrease the overall…

A: Step 1: in copper cycle copper compound is used and on further reaction with reagents copper…

Q: Define ore

A: An ore is defined as a natural rock or sediment that contains one or more valuable minerals or…

Q: A student sets up the following equation to convert a measurement. (The ? stands for a number the…

A: First, we need to understand the conversion from meters (M) to centimeters (CM). We know that 1…

Q: In the laboratory you dilute 3.53 mL of a concentrated 6.00 M hydrobromic acid solution to a total…

A: Answer :) To find the concentration of the diluted hydrobromic acid solution, we use the dilution…

Q: Giving the answer to two decimal places, determine the pH of a solution that has a hydroxide…

A: The first step in determining the pH of a solution when given the hydroxide concentration is to…

Q: Please show reaekson and don't use hend raiting

A: To determine the product formed in an E2 reaction with [(1S,2R)-1-bromo-2-phenylpropyl]benzene and…

Q: Determine the Ka of an acid whose 0.294 M solution has a pH of 2.80. 5.4 x 10-2 4.9 x 10-7 8.6 x…

A: We are given the pH of a 0.294 M solution of an acid and we are asked to find the Ka (acid…

Q: HO 1. CO₂H SnCl4 CO₂H Ph H₂O CH3O LOCH3 CH3O. OCH3 ZnCl2 H₂O + 2. HO CH3 a = Proton transfer b =…

A: 1) Step-by-Step Mechanism:The SnCl4 acts as a Lewis acid, which helps to activate the benzoic acid…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1:  Step 2: Step 3: Step 4:

Q: 2. Considere la reacción reversible AB Si A(0) = A0, B(0) = Bo, calcule la concentración A(t).

A:

Q: calculate the pH of a solution prepared by dissolving 1.75 g of sodium acetate in 60.5 ml of 0.10 M…

A: The solution is a buffer solution because it contains a weak acid (acetic acid) and its conjugate…

Q: A neutral solution at 25⁰C has a [H 3O +] = 1.0 x 10-7M. Which hydronium ion concentration…

A: The pH scale is a measure of the acidity or basicity of a solution. It is defined as the negative…

Q: Draw the structure of the major organic product of the reaction below. Zn(Cu) CHCH3 + CH212 • Use…

A:

Q: Complete the table below. Round each of your entries to 2 significant digits. You may assume the…

A: Step 1: The acid base pair which is differed by a single proton is called conjugate acid-base pair…

Q: I need help with this question please

A:

Q: Complete the organic mechanism

A: Step 1:The reaction involves the electrophilic phosphorous activated the alcohol oxygen following by…

Q: What are and AG of a redox reaction at 25.0 °C for which = 2 and K = 0.055? Part 1 of 2 Be sure your…

A: Step 1:The relationship between E° cell and K value E°cell = (0.0592/n) log(K) Here n= 2 , K=0.055…

Q: None

A: To determine the major product of the reaction between bromine (Br₂) and sodium ethoxide (NaOCH2CH3)…

Q: Give detailed Solution with explanation needed with structure

A: Note that hemiacetal only prossesses one alkoxy (-OR) group. The said compound must be an acetal…

Q: None

A: Step 1:Alkyl halides ( bromides Or chlorides) undergoes elimination reaction to form alkenes  The…

Q: Please don't use hend raiting

A: (a)(b)(c)(d)

Q: acmillan Learning Draw the Lewis structure for butanal, which has the condensed formula CH, CH, CH,…

A: The Lewis dot structure is given below. In carbons as they are forming four bonds, there will be no…

Q: What is the limiting reactant when 0.200 mol of P4 and 0.800 mol of O2 react according to…

A: Step 1: Solution Given, moles of P4 = 0.200 mol moles of O2 = 0.800 mol The given balanced chemical…

Q: 16-46 Identify each of the following groups as an activator or deactivator and as an o,p-director or…

A: In the context of organic chemistry, activators and deactivators are functional groups that either…

Q: ☐ 5:41 PM Sat Jun 29 kennesaw.view.usg.edu Name: Lab Section (Day & Time): 3361L Molecular Modeling…

A: The properties of a molecule may be due to its shape in space. Molecules can have various…

Q: Complete the table below. Round each of your entries to 2 significant digits. You may assume the…

A: 1. ROW conjugate base: CH3CO2- Kb = 10-14/Ka = (10-14)/(1.8*10-5) = 5.6*10-10  2.ROWIf HF is…

Q: Explain makovnikov rule

A: According to Markonikov's rule, during the addition reaction of alkene, the negative part is added…

Q: Calculate the equilibrium constant for the following reaction at 25°C: x 10 Ni²+(aq) + 2Ag(s) =…

A:

Q: Draw the least stable resonance form for the intermediate in the following electrophilic…

A: Step 1:Step 2: Step 3: Step 4:

Q: Provide the IUPAC name for the following compound: CH3CH2CH2CH2CH(CH3)CH2CH2CH(CH2CH3)2

A: Step 1:Long chain has 10 carbons So called dec   Step 2: Step 3: Step 4:

Q: None

A: To distinguish the identity of the three Newman projections in relation to molecule A. We must first…

Q: Which of the two compounds would you expect to be more soluble in H2O? Explain briefly. A B

A: Step 1: Step 2: Step 3: Step 4:

Q: What is the maximum mass, in kilograms, of scandium metal that can be made from 1230.2kilograms of…

A: First, we need to determine the mass of Sc2O3 in the thortveitite. Given that the thortveitite is…

Q: Give answer asap.

A: A hemiacetal is a functional group in organic chemistry formed by the reaction of an aldehyde or…

Q: Chemistry

A: a) First, protonation occurs on the double bond and the H attached to the less substituted carbon of…

Q: Give me detailed Solution with explanation needed....don't use Ai for answering this. Avoid…

A: Alkenes (carbon-chain containing double bonds) are generally considered as non-polar. And in this…

Q: Chemistry

A: Step 1:   Step 2: Step 3: Step 4:

Q: 1 M 21. What is the product of the following reaction? Син mild acid heat A) I B) II C) III D) IV =…

A:

Q: Describe the structure, bonding, and properties of this organic functional group. What is the…

A: The structure shown in the image is 2-Methyl-2-hexene, which is an alkene with the chemical formula…

Q: Complete the organic mechanism

A: Step 1: Step 2: Step 3: Step 4:

Q: Please don't use hend raiting and step by step solutions

A: Step 1:Ionization energy is an group of energy required to remove an a outer electron from the…

Q: Predict the expected major product(s) of the following reaction sequence. O only I ○ only II O III…

A: Step 1: Answer I and II  Step 2: Step 3: Step 4:

Q: None

A: (b) Reaction:Cyclohexanone derivative (with a hydroxyl group) in the presence of excess water and…

Q: A given acid is 35.59 % by mass sulfuric acid, H2SO4, and the rest water. Its specific gravity is…

A:

Q: Internal Rate of Return IRR), Modified IRR (MIRR) and Profitability Index (PI): Calculate the IRR,…

A: Solar Power Plant InvestmentStep 1: Calculate the IRRInput Cash Flows into IRR FormulaCash Flows:…