Consider the following electrochemical cell in, for which E - 0.18 V at 80°C: cell Pt | H2(g) | HCI(aq) || AgCI(s) | Ag(s) H2(g) + 2A9CI(s) = 2H*(aq) + 2C1 (aq) + 2Ag(s) If pH = 1.33 in the anode compartment, and [CI]-2.5 M in the cathode compartment, determine the partial pressure of H, necessary in the anode compartment for the cell to be 0.27 V at 80°C

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?

The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V

Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.

An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?

Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.

An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?