Clearly label all atomic and molecular orbitals and put the correct number of electrons into the molecular orbitals. Provide correct >LGO reducible representation for ligand group orbitals. 1.Consider the transition metal complex [NIC14]2- (square planar geometry). 1a. Construct a plausible Molecular Orbital (MO) energy diagram for [NiCl4]2-. Consider\ sigma - bonding only and disregard Cl s-orbitals. Calculate total number of electrons and predict whether [NiC14]2- is diamagnetic or paramagnetic. 1b. Determine the symmetry irreducible representations for p-orbitals of chlorine which may participate in >-bonding (two extra p-orbitals per Cl which are perpendicular to Ni-Cl bond). Which of those orbitals will remain non-bonding?

Clearly label all atomic and molecular orbitals and put the correct number of electrons into the molecular orbitals. Provide correct >LGO reducible representation for ligand group orbitals. 1.Consider the transition metal complex [NIC14]2- (square planar geometry). 1a. Construct a plausible Molecular Orbital (MO) energy diagram for [NiCl4]2-. Consider\ sigma - bonding only and disregard Cl s-orbitals. Calculate total number of electrons and predict whether [NiC14]2- is diamagnetic or paramagnetic. 1b. Determine the symmetry irreducible representations for p-orbitals of chlorine which may participate in >-bonding (two extra p-orbitals per Cl which are perpendicular to Ni-Cl bond). Which of those orbitals will remain non-bonding?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 2RQ

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
oving to another question will save this response. complex [Co(NH3)6l absorbs light at a wavelength of 465 nm. What is the ligand field aplitting energy for the cormplez in Jlaole? 275 x 10 to negative x AMoving to another question will save this response.
Solve correctly please.
????
. Show how the glycinate ion (H2N-CH2-COO-) can actas a bidentate ligand. (Draw a Lewis diagram if necessary.)Which atoms in the glycinate ion will bind to a metal ion?
A Moving to the next question prevents changes to th Question 1 Which sentence is not correct about ligand? OA. It is electron donor group. OB. It acts like lewis acid O c. It forms complex with metals OD. NH3 is example of unidentate. OE. EDTA is example of hexadentate. A Moving to the next question prevents changes to this answ
Predicting color and magnetic properties from a crystal field theory ener... When a certain weak-field ligand forms an octahedral complex with Zn this electron box diagram: energy in kJ/mol -350 -400 -450 NN 2 2 2 x-y -500 -550 -600 -650 xy yz XZ -700 Using this diagram, answer the following questions. How many unpaired d electron spins does the zinc atom have? Is the complex paramagnetic or diamagnetic? Predict the color of the complex. 2+ cation, the energies of the valence d orbitals on the zinc atom are split according to paramagnetic diamagnetic blue or green red or violet orange or yellow white or transparent ☑
Predicting color and magnetic properties from a crystal field theory ener... 2+ When a certain weak-field ligand forms an octahedral complex with Zn cation, the energies of the valence d orbitals on the zinc atom are split according to this electron box diagram: energy in kJ/mol -350 -400 -450 -500 2 2 2 Z x-y -550 -600 -650 -700 -750 xy yz XZ -800 Using this diagram, answer the following questions. How many unpaired d electron spins does the zinc atom have? Is the complex paramagnetic or diamagnetic? Predict the color of the complex. ☐ paramagnetic diamagnetic blue or green red or violet orange or yellow white or transparent OL E 9
Use the valence bond theory approach to explain why the Co(NH:)* ion is a diamagnetic, low-spin complex, whereas the CoFe ion is a paramagnetic, high-spin complex. (Hint: Explain the type of hybridized orbitals of each complex. i.e., outer or inner-orbital complex? and the number of unpaired electrons for each complex).
Q16. Draw all isomers, if any, for each of these complexes. Assume all compounds are in an octahedral geometry. a. [Pt(NH3)3Cl3]* b. [Co(H₂O)2 (NH3)2Cl2]* c. [Cr(H₂O) IBrCl]
Match the orbitals below to the higher and lower energy levels when an octahedral complex undergoes ligand field splitting. dx2-y2 Orbital 1 Orbital 1 Orbital 2 Orbital 3 Orbital 4 Orbital 5 L d₂2 Orbital 2 L dyz Orbital 3 dxz Orbital 4 [Choose] ◊ [Choose] ↑ [Choose] ◊ [Choose] [Choose] ↑ L dxy Orbital 5