CH37 H2SO4 CH3 от .A) Provide a complete mechanism for the above Friedel-Crafts Reaction. Pay close attention to details, including lone pairs, formal charges and the use of curved arrows.
Q: Don't provide hand writing solution
A: To Draw The GraphConduction Band (CB) and Valence Band (VB) diagram:The CB will be higher in energy…
Q: Draw estrogen and testosterone. Number the positions of the core steroid nucleus NO AI
A: Step 1: Step 2: Step 3: Step 4:
Q: Calculate the numerical value of 2s for hydrogen at r = 0, r = a,, r = 2a,, r = 3a, and r = 00 1…
A:
Q: What is the mechanism and reagents for this reaction? with the circled molecule being attacked first…
A: Step 1: Step 2: Step 3: Step 4:
Q: Choose the definition of the equilibrium constant. K is a fixed value for a given chemical reaction…
A: The objective of the question is to identify the correct definition of the equilibrium constant (K)…
Q: . Write balanced nuclear equations for the following:A) Formation of 48Ti through positron…
A: The objective of the question is to write balanced nuclear equations for the formation of 48Ti…
Q: • A substance has a vapor pressure of 55.1 mmHg at 35 °C and a nor- mal boiling point of 116.9 °C.…
A: To find the enthalpy of vaporization (∆Hvap) for the substance described, we can use the…
Q: A sample of krypton gas at a pressure of 1.12 atm and a temperature of 28.5 °C, occupies a volume of…
A: The objective of the question is to find the pressure of the krypton gas after it is allowed to…
Q: Show work, thank you!
A: The molecular weight of the chromium (Cr) is 51.996 g/molGiven mass of Cr is 36.5 gNo of moles Cr =…
Q: Problems: 1. Predict the product of the following reaction and show the mechanism. O 0 1) KOiPr,…
A: Step 1:α− Alkylation of carbonyl (aldehyde or ketone) and ester:The α−H of the carbonyl/ester group…
Q: Draw the structure of the reduction products of the reaction of benzil with (drawing the mechanism…
A: Step 1:ethanol is a solvent the reacting species are NaBH4 and H2O in which NaBH4 gives H- which…
Q: Follow the Instructions to build the following ion that will satisfy octet rule : [NO2]- Hint: use…
A: There is a total of six lone pairs in the nitrite ion. Here's the breakdown:3 lone pairs on single-…
Q: Q2a: Design a titration experiment where 125 mL of a sodium hydroxide solution is titrated by 0.100…
A: The objective of this question is to design a titration experiment where a sodium hydroxide solution…
Q: None
A: Step 1:Step 2:Step 3:
Q: Do the reactions below proceed in good yield from left to right as shown? a) b) 1 equivalent c) NH₂…
A: Step 1: Step 2: Step 3: Step 4:
Q: 7) Propose a synthesis. H
A: Step 1: hybroration oxidation reaction. They form lest substitute side OH(alcohol). Step 2: use…
Q: CH3 CH3 CH3 O-H NaOH heat Drawing >
A:
Q: A sample of argon gas occupies a volume of 6.57 L at 53.0°C and 0.880 atm. If it is desired to…
A: The objective of this question is to find the temperature of a sample of argon gas when its volume…
Q: Phosgene decomposes to carbon monoxide and chlorine gas. COCl2 (g) CO (g) + Cl2 (g) If the reaction…
A: The question is asking about the effect of adding more phosgene gas (COCl2) to a reaction that has…
Q: Draw structures for the alkene (or alkenes) that gives the following reaction product. ? H₂/Pd CH3…
A: Given product: CH3CH(CH3)CH2CH(CH3)CH3This product suggests the addition of two moles of hydrogen…
Q: In the reaction of potassium metal with chlorine gas to produce potassium chloride, which chemical…
A: The objective of the question is to identify which chemical is reduced in the reaction of potassium…
Q: A sample of methane gas collected at a pressure of 450 mm Hg and a temperature of 285 K has a mass…
A: The objective of the question is to find the volume of a sample of methane gas under given…
Q: how to get 1-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone from…
A: To get 1-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone from…
Q: Fill in the missing product (R) а меона меон b* H*, H₂O CO₂Me CO₂Me a Na toluene bH, H₂O
A: Step 1: Step 2: Step 3: Step 4:
Q: 3. Cyclooctadienyllithium provides an example where electrocyclization of a pentadienyl fragment…
A: The objective of the question is to determine whether the electrocyclization of a pentadienyl…
Q: Show work, thank you!
A: Step 1:Step 2:Step 3:
Q: f 15.0 g S8 (molar mass = 256.56 g/mol) is made to react with 2.0 L O2 at 30 oC and 1.0 atm, what is…
A: Reaction involved is :-S8(s) + 12O2(g) -> 8SO3 (g) Given mass of S8 = 15.0 gMolar mass of S8 =…
Q: balance the equation in the photo
A: The objective of this question is to balance the given chemical equation. Balancing a chemical…
Q: Q1. The ring opening of the compound below under photochemical conditions will afford which of the…
A:
Q: Determine K for a reaction at 200 K if ∆G° =20.4 kJ/mol. (R = 8.314 J/mol ･ K)
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: For the reaction I2(s) = 12 (g) choose the TRUE statement. Decreasing pressure will shift the…
A: The question is asking us to identify the correct statement about how changes in pressure will…
Q: What is the calculated value of the cell potential at 298K for an electrochemical cell with the…
A: Step 1:(1)To calculate the cell potential for the given electrochemical cell reaction, we need to…
Q: A sample of Xe gas has a volume of 498 mL, has a pressure of 434 mm Hg, and is at a temperature of…
A: The objective of the question is to calculate the amount of Xe gas in moles given the volume,…
Q: Identify the reaction for this equilibrium expression. K = [H+]²[SO²-] [H2SO4] ○ H2SO4 (aq) = H+…
A: The objective of the question is to identify the correct chemical reaction that corresponds to the…
Q: 1. A sample of gold (Au) has a mass of 35.12 g. A. Calculate the number of moles of gold (Au) in the…
A: Mass of gold (Au) =35.12 g We know, Molar mass of Au = 196.96657 g/mole The number of moles of gold…
Q: 4
A: Step 1: Step 2: Step 3: Step 4:
Q: Which of the following molecules does not possess a complete octet ofelectrons around its central…
A: In determining which molecule has its central atom not possessing octet of electrons, we determine…
Q: Draw structural formulas for the two compounds you could use to prepare the amine shown by reductive…
A:
Q: 2. A sample of table sugar (sucrose, C12H22O11) has a mass of 1.202 g.
A:
Q: Zn + HgO → ZnO + Hg How many g of Hg (200.59 g/mol) will be produced in 30 days if the current…
A: Step 1: Calculating the amount of charge generated in 30days…
Q: Solubility of Ca(OH)2a) Give a balanced reaction equation for the reaction of Ca(OH)2 with…
A: The objective of the question is to understand the chemical reactions involving calcium hydroxide…
Q: how to sythesis this 1-chloro-2-(4-methylphenoxy)benzene from 1-methy-4-phenoxybenzene .
A: Step 1:Nitration: Start by nitrating 1-methyl-4-phenoxybenzene. This involves introducing a nitro…
Q: Questions 1) Consider the two reactions below. 1) NaOH 2) Reaction A H 요요 H 3) H3O+ Reaction B H 1)…
A: Step 1:a) To draw the major products of each reaction:Reaction A:NaOH is a strong base and would…
Q: A student conducts a laboratory investigation of anaerobic respiration. The student places 10.0 g of…
A: The objective of this question is to determine whether all the glucose reacted during the…
Q: No hand writing pleaseMechanism
A: Step 1:The oxidation of benzoin to benzil by sodium hypochlorite (NaOCl). This type of reaction…
Q: Consider a semiconductor with a bandgap of 1.42 eV with a uniform electric field of 1 × 106 V/m…
A: Based on the image you sent and the information provided, here's how to solve the problems related…
Q: 3 a) State Zaitsev's rule and show the structures elimination product(s) of the following compounds…
A: The objective of the question is to explain Zaitsev's rule and apply it to predict the elimination…
Q: Question 18
A: We can determine the volume of concentrated hydrochloric acid needed to prepare the diluted solution…
Q: Consider a 1mg sample of cobalt- 60(). What is the expected exposure rate 1m away from the source…
A: the problem appears to be about calculating the expected exposure rate from a 1 mg sample of…
Q: dont provide handwritinhg solutiin...............
A: Step 1: An organic substance called methyl cyano acrylate has three different functional groups: an…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- Provide mechanism. Thanks.I understand that the diradical dioxygen attacks a hydrogen on the carbon adjacent to the double bond but can I be shown the resonance mechanism and why we can't use a hydrogen directly from the double bond?The following reaction is Friedel-Crafts alkylation. Considering the mechanism for Friedel-Crafts alkylation, how would you explain the formation of this particular product? Either describe or upload image of the mechanism. AICI,
- Draw the structure of each of the following molecules. (a) (R)-1-chloro-1-fluorobutane; (b) (S)-2-chloropentane; (c) (R)-2-chloro-2-methoxypentane;(d) (R)-2,2,3-trichlorobutane; (e) (S)-3-methylhexane; (f) (S)-2-bromo-1-nitropentanea) The radical chlorination of pentane is a poor way to prepare 1-chloropentane but radical chlorination of neopentane, (CH3;)4C, is a good way to prepare neopentyl chloride, (CH:);CCH;Cl. Explain. b) Show the mechanism for the radical chlorination of neopentane. Illustrate homolytic bond cleavage and bond formation.Given each of the following names, draw the corresponding structure. (a) (Z)-2-methoxypent-2-ene; (b) (E)-3-methylpent-2-ene; (c) (Z)-1-chloro-2-methylpent-1-ene; (d) (E)-2-chloro-3-methoxybut-2-ene; (e) (Z)-1-bromo-1-chloropent-1-ene; (f) (Z)-3-methylpent-2-ene
- Please help me with the organic chemistry problem below: Consider the reaction below: (Check the attached image) (it is between Furan and maleic anhydride, a DIels-Alder reaction) a) Will this reaction for an endo product (with a melting point of 80-81 degrees) or the exo product (with a melitng point of 114 degrees)? b) Carefully explain why the product must have been formed the way it did (exo or endo). c) Provide a mechanism for this reaction.When benzene is treated with sulfur dichloride (SCI2) in the presence of a Friedel-Crafts catalyst like AICI3, diphenyl sulfide is produced, as shown here. Propose SC, AICI3 a mechanism for this reaction. Diphenyl sulfidei,ii,iii please.
- Predict the product of the reaction between m-ethylbenzoyl chloride and each of the following compounds. Draw the complete, detailed mechanism for each reaction. If no reaction is expected to occur, write “no reaction." (a) H2O; (b) CH3NH2; (c) (S)-butan-2-ol; (d) diethyl ether TCI m-Ethylbenzoyl chlorideSolvent of reaction is methylene chloride. Part a) Draw arrow-pushing mechanim. Show ALL resonance structures in it also.Deuterium (D) is an isotope of H. Both D and H have one proton and one electron; H has no neutrons and D has one. Consequently, D and H have nearly identical behavior, but they can be distinguished from each other experimentally due to their different masses. Therefore, replacing an H with a D in a molecule-deuterium isotope labeling-can provide valuable information about a mechanism. With this in mind, how would you synthesize each of the following deuterium-labeled compounds from the analogous unlabeled compound, using D,0 as your only source of deuterium? Hint: You will have to use two separate proton transfer reactions to synthesize each one. (a) (b) (c) OD D.