CH37 H2SO4 CH3 от .A) Provide a complete mechanism for the above Friedel-Crafts Reaction. Pay close attention to details, including lone pairs, formal charges and the use of curved arrows.
Q: Don't provide hand writing solution
A: To Draw The GraphConduction Band (CB) and Valence Band (VB) diagram:The CB will be higher in energy…
Q: Draw estrogen and testosterone. Number the positions of the core steroid nucleus NO AI
A: Step 1: Step 2: Step 3: Step 4:
Q: Calculate the numerical value of 2s for hydrogen at r = 0, r = a,, r = 2a,, r = 3a, and r = 00 1…
A:
Q: What is the mechanism and reagents for this reaction? with the circled molecule being attacked first…
A: Step 1: Step 2: Step 3: Step 4:
Q: Choose the definition of the equilibrium constant. K is a fixed value for a given chemical reaction…
A: The objective of the question is to identify the correct definition of the equilibrium constant (K)…
Q: . Write balanced nuclear equations for the following:A) Formation of 48Ti through positron…
A: The objective of the question is to write balanced nuclear equations for the formation of 48Ti…
Q: • A substance has a vapor pressure of 55.1 mmHg at 35 °C and a nor- mal boiling point of 116.9 °C.…
A: To find the enthalpy of vaporization (∆Hvap) for the substance described, we can use the…
Q: A sample of krypton gas at a pressure of 1.12 atm and a temperature of 28.5 °C, occupies a volume of…
A: The objective of the question is to find the pressure of the krypton gas after it is allowed to…
Q: Show work, thank you!
A: The molecular weight of the chromium (Cr) is 51.996 g/molGiven mass of Cr is 36.5 gNo of moles Cr =…
Q: Problems: 1. Predict the product of the following reaction and show the mechanism. O 0 1) KOiPr,…
A: Step 1:α− Alkylation of carbonyl (aldehyde or ketone) and ester:The α−H of the carbonyl/ester group…
Q: Draw the structure of the reduction products of the reaction of benzil with (drawing the mechanism…
A: Step 1:ethanol is a solvent the reacting species are NaBH4 and H2O in which NaBH4 gives H- which…
Q: Follow the Instructions to build the following ion that will satisfy octet rule : [NO2]- Hint: use…
A: There is a total of six lone pairs in the nitrite ion. Here's the breakdown:3 lone pairs on single-…
Q: Q2a: Design a titration experiment where 125 mL of a sodium hydroxide solution is titrated by 0.100…
A: The objective of this question is to design a titration experiment where a sodium hydroxide solution…
Q: None
A: Step 1:Step 2:Step 3:
Q: Do the reactions below proceed in good yield from left to right as shown? a) b) 1 equivalent c) NH₂…
A: Step 1: Step 2: Step 3: Step 4:
Q: 7) Propose a synthesis. H
A: Step 1: hybroration oxidation reaction. They form lest substitute side OH(alcohol). Step 2: use…
Q: CH3 CH3 CH3 O-H NaOH heat Drawing >
A:
Q: A sample of argon gas occupies a volume of 6.57 L at 53.0°C and 0.880 atm. If it is desired to…
A: The objective of this question is to find the temperature of a sample of argon gas when its volume…
Q: Phosgene decomposes to carbon monoxide and chlorine gas. COCl2 (g) CO (g) + Cl2 (g) If the reaction…
A: The question is asking about the effect of adding more phosgene gas (COCl2) to a reaction that has…
Q: Draw structures for the alkene (or alkenes) that gives the following reaction product. ? H₂/Pd CH3…
A: Given product: CH3CH(CH3)CH2CH(CH3)CH3This product suggests the addition of two moles of hydrogen…
Q: In the reaction of potassium metal with chlorine gas to produce potassium chloride, which chemical…
A: The objective of the question is to identify which chemical is reduced in the reaction of potassium…
Q: A sample of methane gas collected at a pressure of 450 mm Hg and a temperature of 285 K has a mass…
A: The objective of the question is to find the volume of a sample of methane gas under given…
Q: how to get 1-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone from…
A: To get 1-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethanone from…
Q: Fill in the missing product (R) а меона меон b* H*, H₂O CO₂Me CO₂Me a Na toluene bH, H₂O
A: Step 1: Step 2: Step 3: Step 4:
Q: 3. Cyclooctadienyllithium provides an example where electrocyclization of a pentadienyl fragment…
A: The objective of the question is to determine whether the electrocyclization of a pentadienyl…
Q: Show work, thank you!
A: Step 1:Step 2:Step 3:
Q: f 15.0 g S8 (molar mass = 256.56 g/mol) is made to react with 2.0 L O2 at 30 oC and 1.0 atm, what is…
A: Reaction involved is :-S8(s) + 12O2(g) -> 8SO3 (g) Given mass of S8 = 15.0 gMolar mass of S8 =…
Q: balance the equation in the photo
A: The objective of this question is to balance the given chemical equation. Balancing a chemical…
Q: Q1. The ring opening of the compound below under photochemical conditions will afford which of the…
A:
Q: Determine K for a reaction at 200 K if ∆G° =20.4 kJ/mol. (R = 8.314 J/mol ･ K)
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: For the reaction I2(s) = 12 (g) choose the TRUE statement. Decreasing pressure will shift the…
A: The question is asking us to identify the correct statement about how changes in pressure will…
Q: What is the calculated value of the cell potential at 298K for an electrochemical cell with the…
A: Step 1:(1)To calculate the cell potential for the given electrochemical cell reaction, we need to…
Q: A sample of Xe gas has a volume of 498 mL, has a pressure of 434 mm Hg, and is at a temperature of…
A: The objective of the question is to calculate the amount of Xe gas in moles given the volume,…
Q: Identify the reaction for this equilibrium expression. K = [H+]²[SO²-] [H2SO4] ○ H2SO4 (aq) = H+…
A: The objective of the question is to identify the correct chemical reaction that corresponds to the…
Q: 1. A sample of gold (Au) has a mass of 35.12 g. A. Calculate the number of moles of gold (Au) in the…
A: Mass of gold (Au) =35.12 g We know, Molar mass of Au = 196.96657 g/mole The number of moles of gold…
Q: 4
A: Step 1: Step 2: Step 3: Step 4:
Q: Which of the following molecules does not possess a complete octet ofelectrons around its central…
A: In determining which molecule has its central atom not possessing octet of electrons, we determine…
Q: Draw structural formulas for the two compounds you could use to prepare the amine shown by reductive…
A:
Q: 2. A sample of table sugar (sucrose, C12H22O11) has a mass of 1.202 g.
A:
Q: Zn + HgO → ZnO + Hg How many g of Hg (200.59 g/mol) will be produced in 30 days if the current…
A: Step 1: Calculating the amount of charge generated in 30days…
Q: Solubility of Ca(OH)2a) Give a balanced reaction equation for the reaction of Ca(OH)2 with…
A: The objective of the question is to understand the chemical reactions involving calcium hydroxide…
Q: how to sythesis this 1-chloro-2-(4-methylphenoxy)benzene from 1-methy-4-phenoxybenzene .
A: Step 1:Nitration: Start by nitrating 1-methyl-4-phenoxybenzene. This involves introducing a nitro…
Q: Questions 1) Consider the two reactions below. 1) NaOH 2) Reaction A H 요요 H 3) H3O+ Reaction B H 1)…
A: Step 1:a) To draw the major products of each reaction:Reaction A:NaOH is a strong base and would…
Q: A student conducts a laboratory investigation of anaerobic respiration. The student places 10.0 g of…
A: The objective of this question is to determine whether all the glucose reacted during the…
Q: No hand writing pleaseMechanism
A: Step 1:The oxidation of benzoin to benzil by sodium hypochlorite (NaOCl). This type of reaction…
Q: Consider a semiconductor with a bandgap of 1.42 eV with a uniform electric field of 1 × 106 V/m…
A: Based on the image you sent and the information provided, here's how to solve the problems related…
Q: 3 a) State Zaitsev's rule and show the structures elimination product(s) of the following compounds…
A: The objective of the question is to explain Zaitsev's rule and apply it to predict the elimination…
Q: Question 18
A: We can determine the volume of concentrated hydrochloric acid needed to prepare the diluted solution…
Q: Consider a 1mg sample of cobalt- 60(). What is the expected exposure rate 1m away from the source…
A: the problem appears to be about calculating the expected exposure rate from a 1 mg sample of…
Q: dont provide handwritinhg solutiin...............
A: Step 1: An organic substance called methyl cyano acrylate has three different functional groups: an…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- 2) Provide a detailed mechanism for the addition reaction shown below. State the regiochemistry and explain why it's unusual. SCH3 HBr Br SCH3 EN Please be sure to include all structures (use line angle notation or perspective diagrams as appropriate to illustrate the stereochemistry of the process), resonance forms, intermediates, transition states, curved arrows, formal charges, or lone pairs as necessary. Please redraw the substrateremember endo product is kinetically-controlledGive correct detailed Solution with explanation needed..don't give Handwritten answer....??
- provide the detailed mechanismWhen piperidine undergoes the series of reactions shown here, 1,4-pentadiene is obtained as the product. When the four different methyl- substituted piperidines undergo the same series of reactions, each forms a different diene: 1,5-hexadiene; 1,4-pentadiene; 2-methyl-1,4-pentadiene; and 3-methyl-1,4-pentadiene. Which methyl-substituted piperidine forms which diene?Provide mechanism. Thanks.
- 2) Provide a detailed mechanism for the addition reaction shown below. State the regiochemistry and explain why it's unusual. Please be sure to include all structures (use line angle notation or perspective diagrams as appropriate to illustrate the stereochemistry of the process), resonance forms, intermkediates, transition states, curved arrows, formal charges, or lone pairs as necessary. Please don't cheat. Br HBr SCH3 SCH + ENThe following reaction is Friedel-Crafts alkylation. Considering the mechanism for Friedel-Crafts alkylation, how would you explain the formation of this particular product? Either describe or upload image of the mechanism. AICI,)a) The radical chlorination of pentane is a poor way to prepare 1-chloropentane but radical chlorination of neopentane, (CH).C, is a good way to prepare neopentyl chloride, (CH) CCH;CI. Explain. b) Show the mechanism for the radical chlorination of neopentane. Illustrate homolytic bond cleavage and bond formation.
- Give a full curved arrow mechanism for the ring-opening reaction of an epoxide in aqueousacid shown below. Show ALL non-bonded electron pairs and all non-zero formal chargeswhere applicable. (Note: you will need to redraw the structures provided in order to showthe mechanism correctly; non-bonded electron pairs have not been shown, although nonzero formal charges are included.) Be sure to show any stereochemical elements in theproduct(s) correctly.a) The radical chlorination of pentane is a poor way to prepare 1-chloropentane but radical chlorination of neopentane, (CH3;)4C, is a good way to prepare neopentyl chloride, (CH:);CCH;Cl. Explain. b) Show the mechanism for the radical chlorination of neopentane. Illustrate homolytic bond cleavage and bond formation.Give detailed Solution with explanation needed...predict the reactant/ product..give the mechanism....