Calculating standard reaction free energy from standard reduction... Try Again Your answer is wrong. In addition to checking your math, check that you used the right data and DID NOT round any intermediate calculations. Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy AG° for the following redox reaction. Round your answer to 3 significant digits. 6CÃ¯(aq)+2CrO¾¼¯(aq) +8H2O (l) → 3C₁₂ (g)+2Cr(OH)3 (s) + 10OH¯(aq) 1.74 × 10 4 kJ x10 0/5

Calculating standard reaction free energy from standard reduction... Try Again Your answer is wrong. In addition to checking your math, check that you used the right data and DID NOT round any intermediate calculations. Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy AG° for the following redox reaction. Round your answer to 3 significant digits. 6CÃ¯(aq)+2CrO¾¼¯(aq) +8H2O (l) → 3C₁₂ (g)+2Cr(OH)3 (s) + 10OH¯(aq) 1.74 × 10 4 kJ x10 0/5

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 150CP: Given the following two standard reduction potentials, solve for the standard reduction potential of...

See similar textbooks

Similar questions

A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
1. If you wish to convert 0.0100 mol of Au3+ (aq) ions into Au(s) in a “gold-plating” process, how long must you electrolyze a solution if the current passing through the circuit is 2.00 amps? 483 seconds 4.83 104 seconds 965 seconds 1450 seconds
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).