7.50 g of a certain Compound X, known to be made of carbon, hydrogen and perhaps oxygen, and to have a molecular molar mass of 176. g/mol, is burned completely in excess oxygen, and the mass of the products carefully measured: product mass carbon dioxide 11.25 g water 3.07 g Use this information to find the molecular formula of X. ☐ ☑

4.17 Phosgene is a highly toxic gas that has been used as a chemical weapon at times in the past. It is now used in the manufacture of polycarbonates, which are used to make phone cases and plastic eyeglass lenses. Phosgene is produced by the reaction, CO+Cl2COCl2 . Given an excess of carbon monoxide, what mass of chlorine gas must be reacted to form 4.5 g of phosgene?

A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.

onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?

4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.

Write a balanced equation for the reaction between (a) dihydrogen sulfide and sulfur dioxide gases to form sulfur solid and steam. (b) methane, ammonia, and oxygen gases to form hydrogen cyanide gas and steam. (c) iron(lll) oxide and hydrogen gas to form molten iron and steam. (d) uranium(IV) oxide and hydrogen fluoride gas to form uranium(IV) fluoride and steam. (e) the combustion of ethyl alcohol (C2H5OH) to give carbon dioxide and water.

The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.

The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.

or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)

Consider the hypothetical reaction between A2 and AB pictured below. What is the balanced equation? lf 2.50 moles of A2 are reacted with excess AB, what amount (moles) of product will form? If the mass of AB is 30.0 u and the mass of A2 are 40.0 u, what is the mass of the product? If 15.0 g of AB is reacted, what mass of A2 is required to react with all of the AB, and what mass of product is formed?