Calcium chloride 6-hydrate, CaCl2•6H2O, dehydrates according to the equation CaCl2-6H20(s)=CaCl2(s)+6H2O(g) Kp=5.09×10-44, at 25°C What is the pressure of water vapor at equilibrium with a mixture of CaCl2•6H2O and CaCI2 at 25 °C?

Calcium chloride 6-hydrate, CaCl2•6H2O, dehydrates according to the equation CaCl2-6H20(s)=CaCl2(s)+6H2O(g) Kp=5.09×10-44, at 25°C What is the pressure of water vapor at equilibrium with a mixture of CaCl2•6H2O and CaCI2 at 25 °C?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: A student ran the following reaction in the laboratory at 591 K: COCI₂(g) →CO(g) + Cl₂(g) When he…

A: Given, an equilibrium chemical reaction and the initial pressure of COCl2(g)into a volume of 1.00 L…

Q: atm

A: P(COCl2) = 0.868 - p = 0.868 - 0.426 = 0.442atm P(CO) = P(Cl2) = p = 0.426atm

Q: The equilibrium constant, Kp, for the following reaction is 55.6at 698 K: H2(g) + I2(g) 2HI(g)…

A: Given is, Kp= 55.6 Initial pressure= 1.33 atm H2 + I2 -----> 2HI Calculate pH2 =?…

Q: The equilibrium constant for the decomposition of COCl2 to form CO and Cl2 at 900ºC is 8.3 x 10-2.…

Q: The equilibrium constant, Kp, for the following reaction is 3.11×10-3 at 350 K: 2IBr(g) Br2(g) +…

Q: 1) The equation for the formation of hydrogen iodide from H; and I, is: Halg)+ 12(g) 2HI(g) The…

Q: Predict v ianges in the compositions the engineer should expect next time he measures the…

Q: At 100 ∘C∘C, Kc=0.078 SO2Cl2(g)⇌SO2(g)+Cl2(g) In an equilibrium mixture of three gases, the…

Q: The equilibrium constant, Kc, for the following reaction is 1.29x10-2 at 600 K. CoCl₂(g) =CO(g) +…

Q: A chemical engineer is studying the following reaction: CH (9)+2H,S(9) CS,(9)+4H,(9) At the…

A: Answer:- This question is answered by using the simple concept of reaction quotient and equilibrium…

Q: The equilibrium constant, Kp, for the following reaction is 10.5 at 350 K: 2CH,Cl,(g)=CH4(g) +…

A: We have to calculate the equilibrium partial pressure of all species.

Q: the reaction 2NOCl(g) 2NO(g) + Cl2(g) is Kc = 3.6 × 10–4. An equilibrium mixture was found to have…

A: KC is equilibrium constant

Q: The equilibrium constant Kp = (8.71x10^-1) for the following reaction in the gas phase at a given…

A: Given,

Q: reaction vessel compound pressure expected change in pressure CH4 3.50 atm ○ ↑ increase ○ ↓ decrease…

A: The direction in which the reaction proceeds to reach equilibrium can be predicted by determining…

Q: Use the References to access important values if needed for this question. The equilibrium constant,…

Q: F2 ⇌ 2 F(g) If the equilibrium constant for this reaction is Kc = 1.2 x 10-4 at 1000 degrees C,…

A: Given :- F2 ⇌ 2 F(g) Kc = 1.2 x 10-4 T = 1000 °C R = 0.08206 L atm/mol.K To calculate:- :…

Q: A student ran the following reaction in the laboratory at 691 K: 2HI(g) =H₂(g) + I₂(g) When she…

A: The given reaction is 2HI(g) ⇔H2(g) +I2(g)

Q: Bromine monochloride is synthesized using the reaction Br₂(g) + Cl₂ (g) 2 BrCl(g) Kp = 1.1 x 104 at…

A: The objective of this question is to calculate the mass of Bromine monochloride (BrCl) that is…

Q: Consider the equilibrium system described by the chemical reaction below. The decomposition of NOBr…

Q: A student ran the following reaction in the laboratory at 326 K: CH4(9) + CCl4(9)=2CH₂Cl₂(9) When…

Q: A student ran the following reaction in the laboratory at 480 K: PCI 5(9) =PC13(g) + Cl₂(g) When he…

Q: 2. The equilibrium constant Kp for the decomposition of phosphorus pentachloride to phosphorus…

Q: A quantity of liquid methanol, CH3OH, is introduced into a rigid 3.00-L vessel, the vessel is…

A: First we need to calculate the initial molarity of methanol using the Kc value and equilibrium…

Q: Calculate the equilibrium constant, Kp, he obtained for this reaction.

Q: A student ran the following reaction in the laboratory at 317 K:2NO(g) + Br2(g) 2NOBr(g)When she…

A: The objective of the question is to calculate the equilibrium constant, Kp, for the given reaction.…

Q: A student ran the following reaction in the laboratory at 1080 K: 2SO3(9) ? 2SO2(g) + O₂(g) When she…

A: Answer:- This question is answered by using the simple concept of calculation of equilibrium…

Q: 2 NO2CI (g) = 2 NO2 (g) + Cl2 (g) K = 7.81 x 10-5 NO2CI is placed into an evacuated container to an…

Q: The equilibrium constant, Kc, for the following reaction is 1.20×10-2 at 500 K. PCl5(g) PCl3(g) +…

A: Given: Kc = 1.20×10-2 At t= 0 Moles of PCl5 : 0.259moles

Q: The equilibrium constant, Kp, for the following reaction is 1.80x10-2 at 698 K: 2HI(g) = H2(g) +…

Q: The equilibrium constant, Kp, for the following reaction is 1.04x102 at 548 K. NH4CI(S) NH3(9) +…

Q: Consider the reaction: 2 NO(g) + Br2(g) ↔ 2 NOBr(g) Kp = 28.4 atm-1 at 298 K In a reaction…

A: Data

Q: A student ran the following reaction in the laboratory at 675 K: H2(g) + I(g)=2HI(g) When she…

Q: For the reaction 2 AB(g) ↔ A2(g) + B2(g) Kp = 1.81 × 10−6 at 699 K. If the reaction is started only…

A: Kp = 1.8110-6P(AB) = 0.20 atmP(B2) at equilibrium =?

Q: The equilibrium constant, Kc, for the following reaction is 83.3 at 500 K. PC13(g) + Cl₂(g) ⇒PCI5(g)…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Write the expression for the equilibrium constant K, for the following reaction. Enclose pressures…

Q: Elemental Bromine and Chlorine are combined at 150 K: Br2(g) + Cl2(g) 2 BrCl(g) Kp = 1.11 x 10-4 If…

A: The objective of the question is to calculate the equilibrium partial pressure of .

Q: Cl2 ? Nitric oxide reacts with chlorine gas according to the following reaction: 2 NO (g) + Cl2 (g)…

A: Reaction:- 2NO(g) + Cl2(g) <-------> 2NOCl(g)

Q: The equilibrium constant, Kp, for the following reaction is 1.04x10-² at 548 K. NH4Cl(s) NH3(g) +…

Q: The equilibrium constant, Kp, for the following reaction is 9.52×10-2 at 350 K: CH4(g) + CCl4(g)…

A: Given, CH4(g) + CCl4(g) <---> 2CH2Cl2(g) Equilibrium constant (kp) = 9.52 × 10-2 Initial…

Question

Calcium chloride 6-hydrate, CaCl2•6H2O, dehydrates according to the equation
CaCl2-6H20(s)=CaCl2(s)+6H2O(g)
Kp=5.09×10-44,
at 25°C
What is the pressure of water vapor at equilibrium with a mixture of CaCl2•6H2O and CaCI2 at 25 °C?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The equilibrium constant, Kc, for the following reaction is 1.29×10-2 at 600 K. COCl2(g) CO(g) + Cl2(g) Calculate the equilibrium concentrations of reactant and products when 0.366 moles of COCl2(g) are introduced into a 1.00 L vessel at 600 K
CO2 and H, are allowed to react until an equilibrium is established as follows: CO2 (g) + H, (g)H,0 (g) + CO (g) What will be the effect on the equilibriumn of removing CO from the equilibrium mixture?
Consider the equilibrium system described by the chemical reaction below. If the partial pressures at equilibrium of NO, Cl2, and NOCI are 0.095 atm, 0.171 atm, and 0.28 atm, respectively, in a reaction vessel of 7.00 L at 500 K, what is the value of Kp for this reaction? 2 NO(g) + Cl2(g) = 2 NOCI(g)
Consider the reaction: 2 H2S (g) ⇋ 2 H2 (g) + S2 (g) Kp = 2.4 x 10 -4 at 1073 K If the initial pressure of hydrogen sulfide is 755 torr, what will be the equilibrium partial pressure of each gas?
For the equilibrium N2O4(g) <----> 2 NO2(g), at 298 K, Kp = 0.15. For this reaction system, it is found that the partial pressure of N2O4 is 3.7 × 10^–2 atm at equilibrium. What is the partial pressure of NO2 at equilibrium?
12.) A sample of ammonia gas was allowed to come to equilibrium at 400 K.2NH3(g) = N2(g) + 3H2(g) At equilibrium, the mixture contained to following concentrations: [H2] = 0.0283 M, [N2] = 0.00944 M,[NH3] = 0.101 M. What is Kp at this temperature?
A student ran the following reaction in the laboratory at 591 K:COCl2(g) CO(g) + Cl2(g)When she introduced COCl2(g) at a pressure of 0.380 atm into a 1.00 L evacuated container, she found the equilibrium partial pressure of Cl2(g) to be 0.247 atm.Calculate the equilibrium constant, Kp, she obtained for this reaction.
Write equilibrium-constant expressions K, for each of the following reactions. PC|3(g) + 3NH3(g) D P(NH2)3g) + 3HC((g) 4NH3(g) + 502E)D 4NO(g) + 6H20(g) NazCO3(s) + SO23) + ½ O2(g) D Naz504(s) + CO2(g)
What is the value of the equilibrium constant Kc of the reaction at the temperature of the vessel?