Based on the standard reduction potentials in Table 2, which of the following metals could provide cathodic protection to iron: Al, Cu, Ni, Zn? Table 2. Standard Reduction Potentials at 25 °C.Half-ReactionE'(V)Ftg) + 2eO,(g) + 2H"(aq) + 2eCo"(ag) +eH,O,(aq) + 2H' (aq) + 2ePhO,(8) + 4H'(aq) - so; (aq) + 2eCe**(aq) + e Ce*tag)MnO, (aq) + 8H (aq) + SeAu"(ag) + 3e Au(x)Cl:(g) + 2eCr,0, (aq) + 14H (aq) + 6eMnO,(s) + 4H'(aq) + 2e0,(g) + 4H'(aq) + 4eBry(l)→ 2F (aq)+2.87Og) + H,0+ Co "(aq)+2.07+1.82+ 2H,0+1.77PHSO,(s) 2H,0+1.70+1.61Mn"(aq) + 4H,0+1.51+1.502CI (aq)+1.362Cr* (aq) + 7H,0Mn (aq) + 2H,02H,0+1.33+1.23+1.23+ 2e 2Br (ag)+1.07+ 4H (ag) + 3e→ Hg"(aq)NO, (aq)2Hg (aq) + 2eHg" (aq) + 2e - 2Hg(l)Ag (aq) + eFe" (aq) + e Fe* (aq)Og) + 2H (ag) - 2eMnO, (aq)L(s) + 2eO(g) + 2H,0 + 4e 40H (ag)Cu" (aq) + 2eAgCs) + eso, (aq) + 4H (aq) + 2e SO:(g) + 2H,0Cu"(aq)So" (aq) + 2e → Sn taq)21*(aq)Ph" (aq) + 2eSn"(aq) + 2eNi" (aq) + 2eCo"(aq) + 2e Cols)PHSO,(s) + 2eCơ (aq)Fe" (aq)C*taq)Zn" (aq)2H,0 + 2eMn* (aq) + 2eAP (aq) + 3eBe" (ag) + 2eMg"(aq) + 2e Mg(s)Na (aq) + eCa" (aq)Sr*(aq) + 2e Sris)Ba"(ag)K'(aq) +eLi"(ag) +e - Lits)NO(g) + 2H,0+0.96+0.92+0.85+ Ag(s)+0.80+0,77- H,O,(aq)+0.68+ 2H,0 + 3e MnO,fs) + 40H (aq)21 lag)+0.59+0.53+0.40+ Cu(s)+0.34- Agts) + CI (aq)+0.22+0.20+e Cu (aq)+0.15+0.132e0.00+ Ph(s)+ Sn(s)- Nits)-0,13-0.14-0.25-0.28Ph(s) + so (aq)- Cd(s)+ Fels)-0.31+ 2e+ 2e-0.40--0.44+ 3eCris)-0,74+ Znts)(bv) HOT + (8FH-+ Mn(s)+ Als)+ Be(s)+ 2e-0.76-0,83-1.18-1.66-1.85-2.37-2.71-2.87+ Na(s)+ 2eCa(s)-2,892eBa(s)-2.90-2.93Kis)-3.05

A question based on electrochemistry, which is to be accomplished.

Answered: Based on the standard reduction…

Based on the standard reduction potentials in Table 2, which of the following metals could provide cathodic protection to iron: Al, Cu, Ni, Zn?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 37QRT

See similar textbooks

Similar questions

An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.