b Calculate PSCN if a cell consisting of a saturated calomel reference electrode ( E = 0.244 V) and a silver indicator electrode has a potential of 0.131 V ( E %3D 30.799 V, EeSCN/Ag = 0.091 V, Kp (A£SCN) = 1.1 × 10-12). %3D Ag" /Ag PSCN =

b Calculate PSCN if a cell consisting of a saturated calomel reference electrode ( E = 0.244 V) and a silver indicator electrode has a potential of 0.131 V ( E %3D 30.799 V, EeSCN/Ag = 0.091 V, Kp (A£SCN) = 1.1 × 10-12). %3D Ag" /Ag PSCN =

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter21: Potentiometry

Section: Chapter Questions

Problem 21.23QAP

See similar textbooks

Similar questions

What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt
2
The II, III, and IV oxidation states of Mn are related thermodynamically by these equilibria in acid solution: Mn(III) + e- = Mn(II) log K = 25 Mn(IV) + 2e-= Mn(II) log K = 40 (a) What is the standard electrode potential of the couple? Mn(IV) + e-= Mn(III) (b) Is Mn(III) stable respect to the simultaneous oxidation and reduction of Mn(II) and Mn(IV)? Explain
Gg.136.
At 25ºC, you conduct a titration of 20.00 mL of a 0.0400 M AgNo3 solution with a 0.050 M NaI soution within the following cell: saturated calomel electrode | Titration solution | Ag (s) For the cell as written, what is the voltage after the addition of 40.00 mL of NaI solution? The reduction potential for the saturated calomel electrode is E= 0.241 V. The standard reduction potential for the reaction: Ag++e- ® Ag (s) E0= 0.79993 V. The solubility constant of AgI is Ksp=8.3x10^-17 Note: the cell potential could be negative since the conditions are non-standard ones. a) -0.146 b) -0.292 c) 0.146 d) 0.360 e) 0.180
3 . For cell schematic notation Zn(s) | ZnCl2 (1.0 M )| | CuSO4 ( 2.0 M ) | Cu(s) (standard reduction potential E˚Zn(II)/Zn = -1.3 V E˚Cu(II)/Cu = 0.80 V T=25 ˚C R = 8.314 J ) (a ) Calculate Ecell of the above cell in volts. (b) Is this cell being used as a battery or electrolytic cell ? Is the overall cell reaction a spontaneous one ? (c ) Write the reactions at the anode and cathode respectively. ( d) Calculate the equilibrium constant K for the reaction Zn 2+ (aq) + Cu (s ) = Cu 2+ ( aq ) + Zn (s) ( e ) What is the purpose to construct the following cell in Quant Analysis ? Please explain. Ag(s) | AgCl(s), KCl (1.0 M ) | | Cu 2+ ( aqueous ) | Cu(s)
An electrochemical cell similar to the cell in Experiment 3 is constructed, but instead of using Cu electrodes and a Cu²+ solution, this cell uses Pb electrodes and a Pb²+ solution. Pb|Pb+²(1 M)||AsO(~ 1 M)|Pb₂ (AsO₂)₂(s) Pb(s) The measured potential, Ecell of this cell is -0.349 V. Calculate Ksp for Pb, (ASO₂)₂. Ksp = 1.479 x10¹2 Incorrect
The cell Ag|AgCl(sat'd)||H+(a=x)glass electrode has a potential of -0.2094V when tne solution in the right hand compartment is a buffer of pH 4.006. The following potential are obtained when the buffer is replaced with unknowns:(a)-0.2806V and (b)-0.2132V. Calculate the pH and the hydrogen ion activity of each unknown.(c)Assuming an uncertainty of 0.001V in the junction potential,what is range of hydrogen ion activities within which the true value might be expected to lie?