Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). If 4.18 g of water is produced from the reaction of 14.6 g of hydrochloric acid and 28.5 g of sodium hydroxide, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it. % X 3

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). If 4.18 g of water is produced from the reaction of 14.6 g of hydrochloric acid and 28.5 g of sodium hydroxide, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it. % X 3

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 50A

See similar textbooks

Related questions

Q: The chemical formula for calcium hydroxide is: Ca(ОН), Calculate the molar mass of calcium…

A: Given :- chemical formula of calcium hydroxide = Ca(OH)2 To calculate :- its molar mass (g.mol-1)

Q: The chemical formula for calcium hydroxide is: Ca(OH)2 Calculate the molar mass of calcium…

A: The answer to the following question is given as:

Q: Liquid octane (CH₂(CH₂) CH3) will react with gaseous oxygen (O₂) to produce gaseous carbon dioxide…

A: Limiting reactant - Reactant species which react completely or present in less amount in reaction.…

Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…

A: The balanced equation for the given reaction can be shown as follows-The reaction suggests that 1…

Q: Part A. Calculate the total masses of the reactants for the following Equation…

A: Given reaction 4HCl(g)+O2(g)→2Cl2(g)+2H2O(g) Total mass of reactant and products =?

Q: Combustion reactions are a notable source of carbon dioxide in the environmentUsing the following…

A: The balanced chemical equation given is- C3H8 + 5 O2 → 3 CO2 + 4 H2O The molar mass of…

Q: Silane, SiH4, is prepared according to the following equations: Si(s) + 3 HCl(g) → HSiCl3(l) +…

A: 1 mole of any substance have 1 Avagadro number molecules 1 Avagadro number molecules = 6.023*1023…

Q: Aqueous sulfuric acid (H,SO4) will react with solid sodium hydroxide (NaOH) to produce aqueous…

A: Given : mass of H2SO4 = 42.2 g mass of NaOH = 17.0 g The reaction taking place is NaOH (aq) + H2SO4…

Q: The reaction 2 H2 (g) + O2 (g) → 2 H2O (g) is used to produce electricity in a hydrogen fuel cell.…

A: Limiting reagent: It is defined as the reactant in a chemical reaction which is present in lesser…

Q: Citric acid (C6 H3 O7), named for its natural occurrence in citrus fruits, is produced in large…

A: Applying concept of limiting reagent and percentage.

Q: 2 Fe,03 (s) + 3 CO (g) → 3 CO2 (g) + 2 Fe (s) How many grams of carbon monoxide are needed to react…

A: In the given reaction we know that iron oxide is in excess and we have to determine the amount of CO…

Q: Aqueous hydrochloric acid (HC1) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: What is the mass of 3.5 x 10^-3 molecules of copper (II) carbonate? Use correct significant figures…

A: Mole concept: The number of molecules or atoms present in the one mole of the substance is equal to…

Q: A chemist prepares a solution of potassium bromide (KBr) by measuring out 31. mg of KBr into a 100.…

Q: What is the volume (in mL) of isopropanol that contains 7.23 × 1022 molecules of isopropanol? The…

Q: An amount (in grams) of nitrogen gas is reacted with excess hydrogen, according to the balanced…

A: Ammonia gas is produced from the reaction of nitrogen and hydrogen. Balanced Reaction N2 (g) + 3 H2…

Q: Part A A mixture of N2(g) and H2(g) reacts in a closed container to form ammonia, NH3(g). The…

A: Reaction: A mixture of N2(g) and H2(g) reacts in a closed container to form ammonia, NH3(g).The…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Aqueous hydrochloric acid (HC1) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water
of water is produced from the reaction of 14.6 g of hydrochloric acid and 28.5 g of sodium hydroxide, calculate the percent yield of water.
Be sure your answer has the correct number of significant digits in it.
п%
X
(H₂O). If 4.18 g

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
3.105 Nitric acid is often sold and transported as a concentrated 16 M aqueous solution. How many gallons of such a solution would be needed to contain the roughly 2.1109 pounds of HNO3 produced annually in the United States?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
3.75 The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A atoms are shown in blue and B atoms in white). The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reac- tion has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Consider a reaction represented by the following balanced equation :math>2A+3BC+4D u find that it requires equal masses of A and B so that there are no reactants left over. Which of the following is true? Justify your choice. l type='a'> The molar mass of A must be greater than the molar mass of B. i>The molar mass of A must be less than the molar mass of B. i>The molar mass of A must be the same as the molar mass of B.
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?