Answered: An oxidation-reduction reaction will…

An oxidation-reduction reaction will proceed spontaneously toward products if the standard cell potential for the reaction is negative. True O False

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter19: Applications Of Standard Electrode Potentials

Section: Chapter Questions

Problem 19.8QAP

See similar textbooks

Related questions

Q: A certain half-reaction has a standard reduction potential Ered = +0.18 V. An engineer proposes…

A: Answer:The galvanic cell is a type of electrochemical cell that converts chemical energy into…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: [Co2+]=0.00190 M[Au3+]=0.896 MT=25oC=25+273=298K

Q: A certain half-reaction has a standard reduction potential Ed +1.01 v. Ar engineer proposes using…

A: E°red(at cathode ) =+1.01 V E°cell=1.30 V

Q: Predict the standard potential for the galvanic cell. Refer to the table of standard reduction…

Q: A certain half-reaction has a standard reduction potential Ered -0.01 V. An engineer proposes using…

A: Step 1:Galvanic cell is a type of electrochemical cell that converts chemical energy into electrical…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

Q: A certain half-reaction has a standard reduction potential Ered +0.97 V. An engineer proposes using…

A: Given Data:Certain half-reaction has standard reduction potential = 0.97 VThe above reaction is used…

Q: The cell notation for the Galvanic cell is A(s)/A2+//B2(s)/B- The Standard Reduction…

Q: Half-Reaction Standard Reduction Potential, E (V) Ag* (aq) +e- -→ Ag(s) +0.80 Cu?+ (aq) + 2 e- →…

A: The correct option is explained below.

Q: A galvanic (voltaic) cell consists of an electrode composed of zinc in a 1.0 M1.0 M zinc ion…

A: In the given galvanic cell, we have electrodes as 1) electrode composed of zinc in a 1.0 M zinc ion…

Q: Consider the following galvanic cell at 25°C:Pt|Cr2+(0.30M),Cr3+(2.0M)||Co2+(0.20M)|CoThe overall…

Q: Calculate the cell potential for the reaction as written at 25.00 °C, given that [Mg² +] = 0.755 M…

A: Given,

Q: The redox reaction is 2 SmCl3(aq) + 6 Li(aq) → 2 Sm(s) + 6 LiCl(aq) Calculate the following for…

A: Given, 2 SmCl3(aq) + 6 Li(aq) → 2 Sm(s) + 6 LiCl(aq) We need to Calculate the following for the…

Q: Calculate the cell potential for the galvanic cell in which the reaction Fe(s) + Au³+(aq) =…

Q: A certain half-reaction has a standard reduction potential E =+0.43 V. An engineer proposes using…

A: An electrochemical cell is one that converts chemical energy to electrical energy. The cell is…

Q: Use the standard reduction potentials in Appendix L Links to an external site.to find the standard…

A: Redox reaction involves the transfer of electron from one species to another species. Here we are…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: Data given: The concentration of [Sn2+] = 0.0595 M The concentration of [Co3+] = 0.0452 M The…

Q: For the galvanic cell 2Ag+ + Cr → 2Ag + Cr2+, which equation allows you to correctly calculate…

A: E°cell = 2.5122 V

Q: A certain half-reaction has a standard reduction potential En=+0.45 V. An engineer proposes using…

A: Given, Ered=0.45 VEcell=1.40 V

Q: A certain half-reaction has a standard reduction potential Ered=+0.90 V. An engineer proposes using…

A: It is given that E°cell ≥ 0.70 E°cat = 0.90 V

Q: A galvanic (voltaic) cell consists of an inert platinum clectrode in a solution containing 1.0 M…

Q: Calculate the cell potential for the galvanic cell in which the given reaction occurs at 25 °C,…

A: Answer: Cell potential for the given Galvanic cell can be calculated using Nernst equation as shown…

Q: A galvanic (voltaic) cell consists of an inert platinum electrode in a solution containing 1.0 M…

A: Cell made-up of two couples Cr(III)/Cr(II) and Co(III)/Co(II) The standard potential of cell can be…

Q: f the potential of a galvanic cell is +1.20 V, what is the Gibbs free-energy change when one mole of…

A: Given potential of a galvanic cell is +1.20 V when one mole of electrons is transferred in the…

Q: Calculate the standard cell potential, ?∘cellEcell°, for the reaction shown. Use these standard…

Q: Calculate the standard cell potential for the following galvanic cell.…

Q: A galvanic (voltaic) cell consists of an electrode composed of nickel in a 1.0 M nickel(II) ion…

A: Standard potential for this cell, E°cell = E°cathode-E°anode Now, E°(Ag+/Ag) = 0.80 V E°(Ni2+/Ni)…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

An oxidation-reduction reaction will proceed spontaneously toward products if the standard cell potential for the reaction is negative.
True
False

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step by step

Solved in 5 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
Use the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?