A voltaic cell using Pb2+/Pb and Ni²+/Ni half-cells is set up at standard conditions, and each compartment has a volume of 355 mL. What is the cell potential, in V, after it has delivered 0.150 A for 21.0 hours at 25.0°C? (E° for Pb2+/Pb = -0.130 V and E° for Ni2+/Ni = -0.250 V.)

A voltaic cell using Pb2+/Pb and Ni²+/Ni half-cells is set up at standard conditions, and each compartment has a volume of 355 mL. What is the cell potential, in V, after it has delivered 0.150 A for 21.0 hours at 25.0°C? (E° for Pb2+/Pb = -0.130 V and E° for Ni2+/Ni = -0.250 V.)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 135CWP: Consider a galvanic cell based on the following half-reactions: a. What is the standard potential...

See similar textbooks

Related questions

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ Sn" (ag)…

A: Given: [Sn2+]=4.70 M[Ba2+]=6.41 MTemperature=25oC =(25+273) K…

Q: A galvanic cell is made of a Ni2+/Ni half cell with [Ni2+] = 1.00 × 10–3 M and a Ag+/Ag half cell…

Q: Vrite a balanced =quation for the alf-reaction that appens at the athode. Vrite a balanced equation…

A: Zn (s) ----> Zn+2(aq) + 2e HNO2(aq) + H+ + e- ----> NO(g) + H2O(l)

Q: A certain half-reaction has a standard reduction potential Ed=+1.18 V. An engineer proposes using…

A: Standard reduction potential:

Q: • Part D Hg (1) + HgCl, (aq) → Hg,Cl2 (s) Express your answer using ftwo significant figures. ΑΣφ ?…

A: The given reaction, Hg(l)+HgCl2(aq) → Hg2Cl2(s)

Q: Consider the following electrochemical cell in which the volume of solution in each half-cell is 100…

A: The Nernst equation is shown below: Ecell = electrode potential at any condition E0cell = standard…

Q: A galvanic cell is based on the following half-reactions. Fe2+ (aq) +…

A: The standard reduction potentials of half- cell reactions are, The most positive standard reduction…

Q: A voltaic cell employs the redox reaction: 2Fe+3(aq) + 3Mg(s) --- 2Fe(s) + 3Mg2+(aq) Calculate the…

Q: Cr³*(aq) + 3 e¯ → Cr(s) E°red = -0.744 V Zn**(aq) + 2 e → Zn(s) E°red = -0.763 V Given that the…

Q: Write the cell notation for a galvanic cell with the following half-reactions. (a) Ni(s) → Ni2+(aq)…

A: The solutions are given below -

Q: The cell notation for the Galvanic cell is Cd(syCd2+/l/½(syI" The Standard Reduction Potential are…

A: The Gibb's free energy determines the spontaneity of a reaction. If the Gibb's free energy is…

Q: A galvanic cell is made of a Ni2+/Ni half cell with [Ni²*] = 6.00 × 10-² M and an Ag*/Ag hal cell…

Q: A particular galvanic cell has a standard cell potential of Eocell = 0.62 V. If the Eo of the…

A: Eocell = Eored (cathode) - Eored (anode) where - red = reduction

Q: The cell notation for the Galvanic cell is A(s)/A2+//B2(s)/B- The Standard Reduction…

Q: = 2.26 A voltaio cell employs the following redox reaction: 2 Fe (aq)+3 Mg (s)2 Fe (s) +3 Mg²+ (aq)…

A: Given, 2Fe3+(aq) + 3Mg(s) ➝ 2Fe(s) + 3Mg2+(aq) Temperature (T) = 25°C [Fe3+] = 2.85 M; [Mg2+] = 2.1…

Q: If the following half-cells are the right-hand electrode in a galvanic cell with a standard hydrogen…

A: Given information: a) Ag |AgI(sat’d), KI(0.0898 M) b) Pt |Sn2+(0.0893 M), Sn4+(0.215 M) c)…

Q: A galvanic cell based on the reaction between Br2 and vanadium (III) ion has E°cell= 1.39 V: Br2(1)…

A: Given: Ecell ° = 1.39 V ; Ebromine ° = 1.09 V (from the literature)

Q: 2. (a) A voltaic cell is constructed as follows: Zn | Zn²+ | H*|H₂ The half-cell reactions are: Zn →…

A: The objective of the question is to find the concentration of H+ ions, the pH of the cathodic…

Q: A particular galvanic cell has a standard cell potential of Eocell = 0.62 V. If the Eo of the…

A: A galvanic cell is a type of electrochemical cell. It is also known as voltaic cell. It convert…

Q: A galvanic cell at a temperature of 25.0°C is powered by the following redox reaction:…

A: T = 25oC=25+273=298K[Ca2+] = 6.08M[Cr3+] = 1.96 Mn=6 as 6 electrons are involved in the reaction

Q: temperature is 38°C and the operating pressure is 0.04 atm. Cd2*(aq) + 2 e- → Cd(s); [Cd²*] = 0.50 M…

Q: The emf of a standard X-Y galvanic cell is -2.763V. If the standard half-cell emf for the oxidation…

A: The overall cell reaction is the sum of the two half-reactions, but the cell potential is the…

Q: The cell notation for the Galvanic cell is Cd(s)/Cd2+//I2(s)/I- The Standard…

A: Cell notation for the Galvanic cell is :- Cd(s)/Cd2+//I2(s)/I-

Q: The cell potential of the following cell at 25°C is 0.475 V: Zn|Zn^2+(0.20 M)|| H+ (test solution)|…

A: Given, Cell potential = 0.475 V Temperature = 25°C =(25+273)K=298 K

Q: A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard…

A: Oxidation - It is the removal of an electron from an atom or ion. It takes place at the anode…

Q: For a galvanic cell for the following reaction, the cell potential was measured to be 1.56 V. If the…

A: The Standard electrode potential of the redox reaction is given as the difference between the…

Q: Fe+ (ag) + Zn(s) Fe(s) + Zn?+(aq) E cell = +0.32 V A galvanic cell generates a cell potential of…

Q: The cell notation for the Galvanic cell is Cd(s)Ca2*/12(s)/" The Standard Reduction Potential are as…

Q: A voltaic cell is made by placing an iron electrode in a compartment in which the Fe2+ concentration…

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 3+ 2 Cr…

Q: A particular galvanic cell has a standard cell potential of Eocell = 0.62 V. If the Eo of the…

Question

100%

A voltaic cell using Pb2+/Pb and Ni2+/Ni half-cells is set up at
standard conditions, and each compartment has a volume of
355 mL. What is the cell potential, in V, after it has delivered
0.150 A for 21.0 hours at 25.0°C? (E° for Pb2+/Pb = -0.130 V
and E° for Ni2+/Ni = -0.250 V.)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Defining volatic cell!

VIEW

Step 2: Finding out the charge that is passed through the solution!

VIEW

Step 3: Finding out the initial moles of each ion!

VIEW

Step 4: Finding out the moles of nickel ion after the current passed!

VIEW

Step 5: Finding out the moles of lead ion after the current passed!

VIEW

Step 6: Finding out the value of standard cell potential!

VIEW

Step 7: Finding out the value of cell potential!

VIEW

Solution

VIEW

Step by step

Solved in 8 steps with 19 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.