A bomb calorimeter, or constant volume calorimeter, is a device often used to determine the heat of combustion of fuels and the energy available from foods. Since the "bomb" itself can absorb energy, a separate experiment is needed to determine the heat capacity of the calorimeter. This is known as calibrating the calorimeter. In the laboratory a student burns a 0.508-g sample of benzil (C14H1002) in a bomb calorimeter containing 1060. g water. The temperature increases from 24.70 °C to 27.80 °C. The specific heat capacity of water is 4.184 J gl oc-1. The combustion enthalpy is -6784 k)/mol benzil. C14H1002(s) + 31/2 02(g) –14 CO2(g) + 5 H20(1) A,H° = -6784 kJ/mol Calculate the heat capacity of the calorimeter. heat capacity of calorimeter= J/'C

A bomb calorimeter, or constant volume calorimeter, is a device often used to determine the heat of combustion of fuels and the energy available from foods. Since the "bomb" itself can absorb energy, a separate experiment is needed to determine the heat capacity of the calorimeter. This is known as calibrating the calorimeter. In the laboratory a student burns a 0.508-g sample of benzil (C14H1002) in a bomb calorimeter containing 1060. g water. The temperature increases from 24.70 °C to 27.80 °C. The specific heat capacity of water is 4.184 J gl oc-1. The combustion enthalpy is -6784 k)/mol benzil. C14H1002(s) + 31/2 02(g) –14 CO2(g) + 5 H20(1) A,H° = -6784 kJ/mol Calculate the heat capacity of the calorimeter. heat capacity of calorimeter= J/'C

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 112AE: In a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each...

See similar textbooks

Similar questions

In a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?
A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.
What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.
In a calorimetric experiment, 6.48 g of lithium hydroxide, LiOH, was dissolved in water. The temperature of the calorimeter rose from 25.00C to 36.66C. What is H for the solution process? LiOH(s)Li(aq)+OH(aq) The heat capacity of the calorimeter and its contents is 547 J/C.
Explain the difference between heat capacity and specific heat of a substance.
When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
The combustion of 1.00 mol liquid methyl alcohol (CH3OH) in excess oxygen is exothermic, giving 727 kJ of heat. (a) Write the thermochemical equation for this reaction. (b) Calculate the enthalpy change that accompanies the burning 10.0 g methanol. (c) Compare this with the amount of heat produced by 10.0 g octane, C8H18, a component of gasoline (see Exercise 5.41).
9.41 Under what conditions does the enthalpy change equal the heat of a process?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?