7 please

Q: In a museum gift shop, a miniature dinosaur, the Acrocanthosaurus, is 22.8 centimeters long and 15.9…

A: Given Data: The length of the miniature dinosaur is: l=22.8 cm The height of the miniature dinosaur…

Q: 2. Using AABC, identify the ratio for tangent of ZB. 17 cm -C B- 15 cm 8 cm A.

A:

Q: If the range of X is the set (0,1,2,3,4,5,6,7,8) and P(X= x) is defined in the following table: 0 1…

A:

Q: Determine the partial fraction expansion for the rational function below (S-1) (²-1)

A:

Q: Source Between treatments Within treatments Between subjects Error T= 12.59 SS = 2.0539 Total The…

A: We are given the results of the study concerning the defiance score of 6 children across 3 time…

Q: 4. Slow country tunes Here are the lengths, in minutes, of the 50 most popular mp3 downloads of…

A: Given information: The 50 observations are given related to the length of the songs in minutes.…

Q: An electronic office product contains 5100 electronic components. Assume that the probability that…

A: Answer: From the given data, Number of electrical components (n) = 5100 Probability of failure = 1 -…

Q: Evaluate the integral (use exact values): -4 22³-5x²+1 dx

A:

Q: Wate an expression (a) (b) (c) Let y be the depth, in feet, of the water in the cylindrical tank. At…

A:

Q: Suppose that P(A|B)=0.3, P(A|B')=0.3, and P(B)=0.9. What is the P(A)? Round your answer to two…

A: It is given that  P(A/B) = 0.3 P(A/B’) = 0.3 P(B) = 0.9

Q: Verify that the following function is a probability mass function, and determine the requested…

A:

Q: Verify that the following function is a probability mass function, and determine the requested…

A: Note: According to Bartleby guidelines expert solve only one question and maximum three subpart of…

Q: Determine ¹{F}. F(s) = 4s²-15s+8 s(s-3)(s-4) Click here to view the table of Laplace transforms.…

A: Given:  F(s)=4s2-15s+8s(s-3)(s-4)To Find L-1(F)

Q: 3. Using logic to compare samples with different sources of variation Two hypothetical outcomes for…

A:

Q: minor axis at (4,1). 2. Elliptical arches: In some situations, bridges are built using uniform…

A:

Q: 2. Suppose SAT scores roughly follows a normal distribution in the U.S. population of college-bound…

A: It is given that the score is normally distributed with mean μ=525 and standard deviation σ=60. It…

Q: Suppose f(x) = 0.50 for 0 < x < 2. Determine the mean and variance of X. Mean = i (Round the answer…

A: It is given that  f(x) = 0.50,    0 &lt; x &lt; 2

Q: 2. Use reduction of order 2X (D²-2D+1) y = e²x (ex + 1)^² е

A:

Q: 4. d dt X(t): = 13] 4 X(t), X(0) = 4 2 4

A:

Q: Consider the endothermic reactions given below. Let A denote the event that a reaction's final…

A: Given: A is the event that a reaction's final temperature is 271K or less. B is the event that the…

Q: Find the first four nonzero terms in a power series expansion about x = 0 for a general solution to…

A: