7 How would you expect the molecule 1,10-phenanthroline (shown below) to function as a ligand? H H H H 33847 ㅋ H It would be expected to be a ambidentate ligand. It would be expected to be a bidentate ligand. It would not be expected to function as a ligand. It would be expected to be a monodentate ligand. O

7 How would you expect the molecule 1,10-phenanthroline (shown below) to function as a ligand? H H H H 33847 ㅋ H It would be expected to be a ambidentate ligand. It would be expected to be a bidentate ligand. It would not be expected to function as a ligand. It would be expected to be a monodentate ligand. O

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 105QRT

See similar textbooks

Similar questions

Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
One of the following nitrogen compounds or ions is not capable of serving as a ligand: NH4+, NH3, NH2. Identify this species, and explain your answer.
The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Platinum(II) forms many complexes, among them those with the following ligands. Give the formula and charge of each complex. (a) two ammonia molecules and one oxalate ion (C2O42-) (b) two ammonia molecules, one thiocyanate ion (SCN-), and one bromide ion (c) one ethylenediamine molecule and two nitrite ions
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O
An aqueous solution of [Rh(C2O4)3]3− is yellow. Predict the approximate wavelength and predominant color of light absorbed by the complex.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.