5. For a particular chemical reaction AH = 5.5 kJ and AS = -25 J/K. Under what temperature condition is the reaction spontaneous? a. When T < -220 K. b. When T< 220 K. c. The reaction is spontaneous at all temperatures. d. The reaction is not spontaneous at any temperature. e. When T > 220 K.

5. For a particular chemical reaction AH = 5.5 kJ and AS = -25 J/K. Under what temperature condition is the reaction spontaneous? a. When T < -220 K. b. When T< 220 K. c. The reaction is spontaneous at all temperatures. d. The reaction is not spontaneous at any temperature. e. When T > 220 K.

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 10.84PAE: Methane can be produced from CO and H2.The process might be done in two steps, as shown below, with...

See similar textbooks

Related questions

Q: What reagent(s) would be necessary to carry out the following conversion? OH CN NaCN, DMSO 1) TsCl,…

A: Analysis of the ReactionIn this reaction, we're converting an alcohol (−OH) group on a secondary…

Q: Please correct answer and don't use hand raiting

A: Step 1: Step 2: Step 3: Step 4:

Q: 1. R/S, E/Z, and Chirality (a) Assign the priorities (#1 through #4) for the groups of the…

A: Step 1: Step 2: Step 3: Step 4:

Q: Homework Consider the gas-phase reaction between nitric oxide and oxygen showing the initial…

A: 1. Determine the Order with Respect to NOTo find the order with respect to NO, we can compare…

Q: 44 > Draw the structures of the carboxylic acid and the alcohol that produce the ester shown in an…

A: Esterification is a chemical reaction that occurs between a carboxylic acid and an alcohol,…

Q: Please correct answer and don't use hand raiting

A: Step 1: Given data,NH3(g) + HCl(g) —> NH4Cl(s)Volume of one flask = 2.00LNumber of flask = 2, one…

Q: ← Compound A, MW 160, shows an IR absorption at 1735 cm-1 and a 'H NMR spectrum with peaks at 4.20 8…

A: Step 1: Step 2: Step 3: Step 4:

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. BH 3-THF 2. H2O2, NaOH…

A: The reaction is Hydroboration oxidation which converts alkene to alcohol. It follows the…

Q: Please correct answer and don't use hand raiting

Q: J °C.g and Show each step in your calculations for AH 5. (Assume the specific heat of the solution…

A: Here are the corrected calculations for the given reaction:16. Concentration of CH₃COOH (50.0 mL…

Q: Show work with explanation needed. Don't give Ai generated solution

Q: 2.) Predict the one major organic product (not side-products) for each of the following reactions.…

A: 1. Reaction in Cold DMSO (SN2 Mechanism) Conditions: DMSO is a polar aprotic solvent, which favors…

Q: Please correct answer and don't use hand rating

A: If you have any confusion related to any step of this assigning configuration ,you can ask!

Q: Η Draw the starting structure that would lead to these products under these conditions. Ill +…

A: Step 1:The reagents given are CH2I2 and Zn/Cu while the products are enantiomers of a cyclopropane.…

Q: write the mechanism of the reaction

A: Step-by-step mechanism: Step1. Formation of Nitrous Acid (HNO₂): Sodium nitrite (NaNO2) reacts with…

Q: Please help, thanks

Q: 5. For the cyclohexane structure shown, draw the chair equilibrium showing both chair conformations…

A: Step 1: Step 2: Step 3: Step 4:

Q: Provide the missing compounds and reagents in the reaction scheme. Draw reagent 1. Select Draw…

A: Step 1: Step 2: Step 3: Step 4:

Q: Please correct answer and don't use hand raiting

A: Step 1:Nucleophilic addition reaction between hydrogen cyanide (HCN) and carbonyl compounds…

Q: 19

A: Diamagnetism is a property of all materials and always makes a weak contribution to the material's…

Q: Please find the Rf values of each drug and the name of the unknown sample!

A: Step 1:1. TLC is used for various applications in organic chemistry, such as: a. Examining if two…

Q: Predict the major products of both organic reactions. Be sure to use wedge and dash bonds to show…

A: Step 1:The reaction of alkyne (triple bond) with aqueous acid (H3O+) in the presence of mercuric…

Q: Please correct answer and don't used hand raiting

A: The balanced equation for oxalate and permanganate reaction: 2MnO₄⁻ + 5C₂O₄²⁻ + 16H⁺ → 2Mn²⁺ +…

Q: Indicate which of the reactions shown below are oxidation/reduction reactions. If the reaction is a…

A: In a redox (reduction-oxidation) reaction, one or more elements undergo a change in oxidation state.…

Q: mtl

A: Step 1:The reactant is a secondary alkyl bromide and it is undergoing SN2 reaction with chloride…

Q: Please correct answer and don't use hand raiting

Q: What are the reagent to get the product. Please include mechanism

A: Step 1: Step 2: Step 3: Step 4:

Q: its for practice!

A: Step 1: Step 2: Step 3: Step 4:

Q: 2. Write a complete mechanism for the reaction shown below. 1. I fre 2. H₂O'

Q: Suppose the molecule below is in acidic aqueous solution. Is keto-enol tautomerization possible? •…

Q: sing a damp metal will affect the accuracy of your results. 5. (Must show work to receive credit) A…

A: Step 1:5.)Given:•Mass of unknown metal sample (mmetal)=55g,•Initial temperature of the metal…

Q: Predict the products of this organic reduction: : ☐ + Х H2 а Lindlar catalyst Click and drag to…

Q: Dr. Schaefer performs a reaction of an unknown alkene with ozone. She obtains a single compound with…

A: Alkene+ozone is ozonolysis where the alkene's C=C bonds break and form two C=O bonds. Since there…

Q: 1. Predict the major product(s) of the following reactions. Be sure to consider stereochemistry. 1.…

Q: Please correct answer and don't use hand raiting

A: The process of formation of ionic compounds from their constituent elements involves several…

Q: 13. Use the half reaction basic solution method. CN(aq) + MnO¯(aq) → CNO˜¯(aq)+ MnO2(aq)

A: Step 1: Step 2: Step 3: Step 4:

Q: Electrophilic Addition Reactions Predicting the products of alkyne halogenation or hydrohalogenation…

A: Thank you.

Q: Draw the Lewis structure, including all lone pairs and non-zero formal charges, for the molecule…

A: Step 1: Calculate the total valence electronsAtomValence Electrons# of AtomsCl71F75Total7(1) + 7(5)…

Q: please draw

Q: Which one of the following statements does NOT describe a characteristic of a salt bridge?…

Q: Rank the structures shown from most to least stable. || ||| IV

A: Here we check the stability of compound based on alpha hydrogen and comparison of cis-trans…

Q: Help me understand these

A: Step 1: Step 2: Step 3: Step 4:

Q: 10:20 PM Wed Nov 6 Exam 2 Extra Credit INDEX Cozort, Alexis ล 24%0 4/4 answered Answers are saved…

A: When four different groups are attached to an atom in such a way that the structure is non…

Q: if you answer yes for the first substrate please draw the intermediate forms during a nucleophilic…

Q: 21

A: In chemistry, a substance is considered diamagnetic if all of its electrons are paired. This means…

Q: Resonance (c) ( ) One of the following structures for nitrobenzene is not a significant resonance…

A: In nitrobenzene (C₆H₅NO₂), the nitro group (-NO₂) is attached to a benzene ring. This group has a…

Q: How many sigma (σ) and pi (л) bonds are in the molecule shown? HH H

A: Due to different types of overlapping of atomic orbitals the sigma and pi bonds are formed. Direct…

Q: Please correct answer and don't use hand raiting

A: Approach to solving the question: This is a simple halogenation reaction of alkyne in which halogen…

Q: Need help with steps 2 and 4 PLEASE help me draw it

Q: Please correct answer and don't use hand rating

A: The reaction between benzenesulfonic acid (C₆H₅SO₃H) and methyl chloride (CH₃Cl) in the presence of…

Question

100%

5. For a particular chemical reaction AH = 5.5 kJ and AS = -25 J/K.
Under what temperature condition is the reaction spontaneous?
a. When T < -220 K.
b. When T< 220 K.
c. The reaction is spontaneous at all temperatures.
d. The reaction is not spontaneous at any temperature.
e. When T > 220 K.

AI-Generated Solution

AI-generated content may present inaccurate or offensive content that does not represent bartleby’s views.

Unlock instant AI solutions

Tap the button
to generate a solution

Click the button to generate
a solution

SEE SOLUTION

Similar questions

For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
How does the second law of thermodynamics explain a spontaneous change in a system that becomes more ordered when that process is exothermic?
Thermite reactions have been used for welding metal parts such as railway rails and in metal refining. One such thermite reaction is Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(s). Is the reaction spontaneous at room temperature under standard conditions? During the reaction, the surroundings absorb 851.8 kJ/mol of heat.
10.51 The combustion of acetylene was used in welder's torches for many years because it produces a very hot flame: C2H2(g)+52O2(g)2CO2(g)+H2O(g) H= -1255.5 kJ (a) Use data in Appendix E to calculate S for this reaction, (b) Calculate G and show that the reaction is spontaneous at 25°C. (c) Ls there any temperature range in which this reaction is not spontaneous? (d) Do you think you could use Equation 10.4 to calculate such a temperature range reliably? Explain your answer.
A reaction has H298=100 kj/mol and S298=250 J/mol K. Is the reaction spontaneous at room temperature? If not, under what temperature conditions will it become spontaneous?
Some say that the job of an engineer is to fight nature and the tendencies of entropy. (a) Does this statement seem accurate in any way? (b) How can any engineering design create order without violating the second law of thermodynamics?
What happens to the entropy of the universe during a spontaneous process?
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25°C (b) NaCl(s)NaCl(l) at 25°C (c) 2NaCl(s)2Na(s)+Cl2(g) (d) CO2(g)C(s)+O2(g)
The reaction CO2(g)+H2(g)CO(g)+H2O(g) is not spontaneous at room temperature but becomes spontaneous at a much higher temperature. What can you conclude from this about the signs of H and S , assuming that the enthalpy and entropy changes are not greatly affected by the temperature change? Explain your reasoning.
At 298 K, G = 70.52 kJ for the reaction 2NO(g) + O2(g) 2NO2(g) (a) Calculate _G at the same temperature when PNO = 1.0 104 atm, PO2=2.0103 atm, and PNO2=0.30 atm. (b) Under the conditions in part a, in which direction is the reaction spontaneous?
Given that H f for HF(aq) is -320.1 kJ/mol and S for HF(aq) is 88.7 J/mol K, find Ka for HF at 25C.
Using tabulated thermodynamic data, calculate G for these reactions. (a) Mg3N2(s)+6H2O(l)2NH3(g)+3Mg(OH)2(s) (b) 4CH3NH2(g)+9O2(g)4CO2(g)+10H2O(l)+2N2(g) (c) Fe3O(s)+4CO(g)3Fe(s)+4CO2(g) (d) P4O10(s)+6H2O(l)4H3PO4(aq)