4. A voltaic cell that uses the following reaction has a measured emf of 1.19 V under standardconditions. The reduction potential for Cr *3 is also given below. What is E° for the reduction of Tl;?TI; (aq) + 2 Cr?* (ag) 2 TI" (aq) + 2 Cr³" (aq)E° = 1.19 VCr** (aq) + eTI; (aq) + 2 e → TI (aq)Cr² (aq)E° = -0.408 VE° = ??

By taking the values of electrode potential of the two half cells, the total emf of the…

4. A voltaic cell that uses the following reaction has a measured emf of 1.19 V under standard conditions. The reduction potential for Cr * is also given below. What is E° for the reduction of TI;? TI; (aq) + 2 Cr2 (aq) TI (aq) + 2 Cr* (aq) E° = 1.19 V Cr** (aq) + e → Cr²*(aq) TI, (aq) + 2 e → TI (aq) E° - -0.408 V E° - ??

4. A voltaic cell that uses the following reaction has a measured emf of 1.19 V under standard conditions. The reduction potential for Cr * is also given below. What is E° for the reduction of TI;? TI; (aq) + 2 Cr2 (aq) TI (aq) + 2 Cr* (aq) E° = 1.19 V Cr** (aq) + e → Cr²*(aq) TI, (aq) + 2 e → TI (aq) E° - -0.408 V E° - ??

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 77AP

See similar textbooks

Similar questions

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
A solution contains the ions H+, Ag+, Pb2+, and Ba2+, each at a concentration of 1.0 M. (a) Which of these ions would be reduced first at the cathode during an electrolysis? (b) After the first ion has been completely removed by electrolysis, which is the second ion to be reduced? (c) Which, if any, of these ions cannot be reduced by the electrolysis of the aqueous solution?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?